| Revision as of 18:52, 9 June 2011 editZéroBot (talk | contribs)704,777 editsm r2.7.1) (robot Adding: fr:Isobutyryl-coenzyme A← Previous edit |
Latest revision as of 22:31, 11 June 2024 edit undoKormiSK (talk | contribs)Extended confirmed users923 edits removed Category:Coenzymes using HotCat |
| (13 intermediate revisions by 9 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 265862835 |
|
|
|
| Watchedfields = changed |
| ⚫ |
|ImageFile=Isobutyryl-coenzyme A.png |
|
|
⚫ |
| verifiedrevid = 433428721 |
| ⚫ |
|ImageSize=250px |
|
|
⚫ |
| ImageFile=Isobutyryl-coenzyme A.png |
|
|IUPACName= <small>''S''-[2-[3-<nowiki>[[</nowiki>4-<nowiki>[[[</nowiki> 5-(6-Aminopurin-9-yl)-4-hydroxy-3-phosphonooxyoxolan- |
|
|
⚫ |
| ImageSize=250px |
|
2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxy- |
|
|
|
| IUPACName = 3′-''O''-Phosphonoadenosine 5′-ethyl}amino)-3-oxopropyl]amino}-4-oxobutyl dihydrogen diphosphate] |
|
2-hydroxy-3,3-dimethylbutanoyl]amino]propanoylamino]ethyl] 2-methylpropanethioate</small> |
|
|
|
| SystematicName = ''O''<sup>1</sup>-<nowiki/>{methyl} ''O''<sup>3</sup>-ethyl}amino)-3-oxopropyl]amino}-4-oxobutyl] dihydrogen diphosphate |
|
|OtherNames=Isobutyryl-coenzyme A |
|
| OtherNames = Isobutyryl-coenzyme A |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo=15621-60-0 |
|
| CASNo=15621-60-0 |
|
| PubChem=808 |
|
| PubChem=808 |
| ⚫ |
| SMILES=CC(C)C(=O)SCCNC(=O)CCNC(=O) C(C(C)(C)COP(=O)(O)OP(=O)(O) OCC1C(C(C(O1)N2C=NC3=C2N=CN=C3N) O)OP(=O)(O)O)O |
|
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
| ⚫ |
| MeSHName=Isobutyryl-coenzyme+A |
|
|
|
| ChEBI = 15479 |
|
⚫ |
| SMILES = CC(C)C(=O)SCCNC(=O)CCNC(=O)C(C(C)(C)COP(=O)(O)OP(=O)(O)OCC1C(C(C(O1)N2C=NC3=C2N=CN=C3N)O)OP(=O)(O)O)O |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C25H42N7O17P3S/c1-13(2)24(37)53-8-7-27-15(33)5-6-28-22(36)19(35)25(3,4)10-46-52(43,44)49-51(41,42)45-9-14-18(48-50(38,39)40)17(34)23(47-14)32-12-31-16-20(26)29-11-30-21(16)32/h11-14,17-19,23,34-35H,5-10H2,1-4H3,(H,27,33)(H,28,36)(H,41,42)(H,43,44)(H2,26,29,30)(H2,38,39,40)/t14-,17-,18-,19+,23-/m1/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = AEWHYWSPVRZHCT-NDZSKPAWSA-N |
|
⚫ |
| MeSHName=Isobutyryl-coenzyme+A |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>25</sub>H<sub>42</sub>N<sub>7</sub>O<sub>17</sub>P<sub>3</sub>S |
|
| Formula=C<sub>25</sub>H<sub>42</sub>N<sub>7</sub>O<sub>17</sub>P<sub>3</sub>S |
|
| MolarMass=837.62 g/mol |
|
| MolarMass=837.62 g/mol |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
'''Isobutyryl-coenzyme A''' is a starting material for many natural products derived from Poly-Ketide Synthase (PKS) assembly lines, as well as PKS-NRPS hybrid assembly lines. These products can often be used as antibiotics. Notably, it is also an intermediate in the metabolism of the amino acid ], and structurally similar to intermediates in the catabolism of other small amino acids. |
|
'''Isobutyryl-coenzyme A''' is an intermediate in the metabolism of ]. |
|
|
|
|
|
|
==See also== |
|
==See also== |
| Line 36: |
Line 44: |
|
{{Amino acid metabolism intermediates}} |
|
{{Amino acid metabolism intermediates}} |
|
|
|
|
|
] |
|
] |
|
|
|
|
|
|
|
|
|
{{organic-compound-stub}} |
|
{{organic-compound-stub}} |
|
|
|
|
] |
|
|
] |
|