| Revision as of 15:42, 9 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'DrugBank_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'ChEBI_Ref') per Chem/Drugbox validation (report [[Wikipedia_talk:WikiProject_Ch← Previous edit |
Latest revision as of 14:30, 25 October 2024 edit undoMarbletan (talk | contribs)Extended confirmed users5,418 editsNo edit summary |
| (12 intermediate revisions by 12 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
| verifiedrevid = 443887540 |
|
| verifiedrevid = 443889003 |
|
|ImageFile=isoxathion.png |
|
| ImageFile=Isoxathion Formula V.2.svg |
|
|ImageSize=200px |
|
| ImageSize=250px |
|
|ImageFile1=Isoxathion-3D-balls.png |
|
| ImageFile1=Isoxathion-3D-balls.png |
|
|ImageSize1=250px |
|
| ImageSize1=250px |
|
|
| PIN=''O'',''O''-Diethyl ''O''-(5-phenyl-1,2-oxazol-3-yl) phosphorothioate |
|
|IUPACName=Diethoxy--thioxophosphorane |
|
|
|OtherNames=• ''O,O''-Diethyl ''O''-5-phenyl-1,2-oxazol-3-yl phosphorothioate<br>• ''O,O''-Diethyl ''O''-(5-phenyl-3-isoxazolyl) phosphorothioate |
|
| OtherNames=''O,O''-Diethyl ''O''-(5-phenyl-3-isoxazolyl) phosphorothioate |
|
|Section1= {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 27255 |
|
| ChemSpiderID = 27255 |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
| Line 18: |
Line 18: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = SDMSCIWHRZJSRN-UHFFFAOYSA-N |
|
| StdInChIKey = SDMSCIWHRZJSRN-UHFFFAOYSA-N |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo=18854-01-8 |
|
| CASNo=18854-01-8 |
|
| PubChem=29307 |
|
| PubChem=29307 |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = IRA3YFG6CX |
|
| UNII = IRA3YFG6CX |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
| Line 26: |
Line 27: |
|
| SMILES = S=P(Oc2noc(c1ccccc1)c2)(OCC)OCC |
|
| SMILES = S=P(Oc2noc(c1ccccc1)c2)(OCC)OCC |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>13</sub>H<sub>16</sub>NO<sub>4</sub>PS |
|
| Formula=C<sub>13</sub>H<sub>16</sub>NO<sub>4</sub>PS |
|
| MolarMass=313.31 g/mol |
|
| MolarMass=313.31 g/mol |
|
| Appearance=Yellowish liquid |
|
| Appearance=Yellowish liquid |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3= {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Isoxathion''' is a ] ] with the ] C<sub>13</sub>H<sub>16</sub>NO<sub>4</sub>PS. It is an ], specifically an ] ]. |
|
'''Isoxathion''' is a ] with the ] C<sub>13</sub>H<sub>16</sub>NO<sub>4</sub>PS.<ref>{{PPDB|413}}</ref> It is an ], specifically an ] ]. |
|
|
|
|
|
==References== |
|
|
{{Reflist|2}} |
|
|
|
|
|
==External links== |
|
==External links== |
|
* |
|
* |
|
|
|
|
|
{{insecticides}} |
|
{{insecticides}} |
|
|
{{Acetylcholine metabolism and transport modulators}} |
|
{{Cholinergics}} |
|
|
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
{{organic-compound-stub}} |
|
{{organic-compound-stub}} |
|
|
|
|
] |
|