| Revision as of 19:25, 31 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per [[WP:CHEMVALID|Chem/Drugbox validation← Previous edit |
Latest revision as of 03:10, 24 December 2024 edit undoCitation bot (talk | contribs)Bots5,429,667 edits Added bibcode. | Use this bot. Report bugs. | Suggested by Whoop whoop pull up | Category:O-methylated flavonols | #UCB_Category 32/33 |
| (15 intermediate revisions by 13 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 423639727 |
|
|
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 447708649 |
|
| Name = Jaceidin |
|
| Name = Jaceidin |
|
| ImageFile = Jaceidin.PNG |
|
| ImageFile = Jaceidin.svg |
|
| ImageSize = 200px |
|
|
| ImageName = Chemical structure of jaceidin |
|
| ImageName = Chemical structure of jaceidin |
|
| IUPACName = 5,7-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-3,6-dimethoxychromen-4-one |
|
| IUPACName = 4′,5,7-Trihydroxy-3,3′,6-trimethoxyflavone |
|
|
| SystematicName = 5,7-Dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-3,6-dimethoxy-4''H''-1-benzopyran-4-one |
|
| OtherNames = Jaceidine<br>Quercetagetin 3,3',6-trimethyl ether |
|
| OtherNames = Jaceidine<br>Quercetagetin 3,3′,6-trimethyl ether |
|
|Section1= {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo = 10173-01-0 |
|
| CASNo = 10173-01-0 |
|
| CASNo_Ref = |
|
| CASNoOther = |
|
| CASOther = |
|
|
| PubChem = 5464461 |
|
| PubChem = 5464461 |
|
| SMILES = COC1=C(C=CC(=C1)C2=C(C(=O)C3=C(C(=C(C=C3O2)O)OC)O)OC)O |
|
| SMILES = COC1=C(C=CC(=C1)C2=C(C(=O)C3=C(C(=C(C=C3O2)O)OC)O)OC)O |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
| InChI = |
|
|
|
| ChemSpiderID = 4576662 |
|
|
| InChI = 1/C18H16O8/c1-23-11-6-8(4-5-9(11)19)16-18(25-3)15(22)13-12(26-16)7-10(20)17(24-2)14(13)21/h4-7,19-21H,1-3H3 |
|
|
| InChIKey = XUWTZJRCCPNNJR-UHFFFAOYAP |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C18H16O8/c1-23-11-6-8(4-5-9(11)19)16-18(25-3)15(22)13-12(26-16)7-10(20)17(24-2)14(13)21/h4-7,19-21H,1-3H3 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = XUWTZJRCCPNNJR-UHFFFAOYSA-N |
|
| MeSHName = |
|
| MeSHName = |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C=18 | H=16 | O=8 |
|
| Formula = C<sub>18</sub>H<sub>16</sub>O<sub>8</sub> |
|
|
| MolarMass = 360.31 g/mol |
|
|
| ExactMass = 360.084517 u |
|
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = <!-- °C --> |
|
| MeltingPtC = 130-135 |
|
| BoilingPt = <!-- °C --> |
|
| BoilingPt = |
|
| Solubility = |
|
| Solubility = |
|
}} |
|
}} |
|
}} |
|
}} |
|
'''Jaceidin''' is an ]. It can be found in '']'',<ref>synthetized.<ref> |
|
'''Jaceidin''' is an ]. It can be found in '']'',<ref>{{cite journal | doi = 10.1016/S0305-1978(98)00124-0 | title = Jaceidin and chrysosplenetin chemotypes of Chamomilla recutita (L.) Rauschert | journal = Biochemical Systematics and Ecology | volume = 27 | issue = 7 | pages = 727–732 | year = 1999 | last1 = Repčák | first1 = Miroslav | last2 = Švehlı́Ková | first2 = Vanda | last3 = Imrich | first3 = Ján | last4 = Pihlaja | first4 = Kalevi | bibcode = 1999BioSE..27..727R }}</ref> in '']'' and can be synthesized.<ref>{{cite journal | doi = 10.1007/BF02146923 | title = The synthesis of jaceidin | journal = Experientia | volume = 24 | issue = 2 | pages = 108–109 | year = 1968 | last1 = Fukui | first1 = K. | last2 = Matsumoto | first2 = T. | last3 = Nakamura | first3 = S. | last4 = Nakayama | first4 = M. | last5 = Horie | first5 = T. | pmid = 5643784 | s2cid = 9912322 }}</ref> Jaceidin has many different characteristics, such as a molar mass of 360.31 g/mol. It also has a melting point of 130-135 °C.<ref>{{Cite web | url = http://www.hmdb.ca/metabolites/HMDB0033819 | title = Jaceidin | id = HMDB0033819 | work = Human Metabolome Database}}</ref> |
|
|
|
|
|
==Glycosides== |
|
== Glycosides == |
|
* ] |
|
* ] |
|
|
|
|
|
==References== |
|
== References == |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
|
{{flavonol}} |
|
{{flavonol}} |
|
|
|
|
|
] |
|
] |
|
|
|
|
|
|
|
|
{{natural-phenol-stub}} |
|
|
|
{{aromatic-stub}} |