| Revision as of 18:46, 22 February 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (← Previous edit |
Latest revision as of 07:00, 17 December 2024 edit undoValenzuela400 (talk | contribs)Extended confirmed users13,305 edits commonscat-inline |
| (36 intermediate revisions by 24 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Chembox |
|
{{no footnotes|date=September 2007}} |
|
|
|
|Verifiedfields = changed |
|
{{chembox |
|
|
|
|Watchedfields = changed |
|
| verifiedrevid = 407829088 |
|
|
|
|verifiedrevid = 415361066 |
|
| Name = Jasmone |
|
|
| ImageFile = Jasmone.png |
|
|Name = Jasmone |
|
|
|ImageFile = Jasmon structural formation V1.svg |
|
| OtherNames = cis-jasmone |
|
|
|
|ImageSize = 180 |
|
| Section1 = {{Chembox Identifiers |
|
|
|
|ImageFile1 = Jasmone molecule ball.png |
|
| SMILES = CC\C=C/CC1=C(CCC1=O)C |
|
|
|
|ImageAlt1 = Ball-and-stick model of jasmone |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
|
|PIN = 3-methyl-2-cyclopent-2-en-1-one |
|
| CASNo = 488-10-8 |
|
|
|
|OtherNames = ''cis''-Jasmone |
|
| RTECS = |
|
|
|
|Section1={{Chembox Identifiers |
|
}} |
|
|
|
|SMILES = CC\C=C/CC1=C(CCC1=O)C |
|
| Section2 = {{Chembox Properties |
|
|
|
|PubChem = 1549018 |
|
| Formula = C<sub>11</sub>H<sub>16</sub>O |
|
|
|
|ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
| MolarMass = 164.246 g/mol |
|
|
|
|ChemSpiderID = 1266012 |
|
| Appearance = colorless to pale yellow liquid |
|
|
|
|SMILES2 = O=C1\C(=C(/CC1)C)C\C=C/CC |
|
| Density = 0.94 g/mL, liquid |
|
|
|
|StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
| Solubility = in water |
|
|
|
|StdInChI = 1S/C11H16O/c1-3-4-5-6-10-9(2)7-8-11(10)12/h4-5H,3,6-8H2,1-2H3/b5-4- |
|
| MeltingPt = 203-205 C |
|
|
|
|StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
| BoilingPt = 146 °C at 27 mm Hg |
|
|
|
|StdInChIKey = XMLSXPIVAXONDL-PLNGDYQASA-N |
|
| pKa = |
|
|
|
|CASNo_Ref = {{cascite|correct|CAS}} |
|
| pKb = |
|
|
|
|CASNo = 488-10-8 |
|
| Viscosity = |
|
|
|
|UNII_Ref = {{fdacite|correct|FDA}} |
|
}} |
|
|
|
|UNII = RC4W0G9YUK |
|
| Section7 = {{Chembox Hazards |
|
|
|
}} |
|
| ExternalMSDS = |
|
|
|
|Section2={{Chembox Properties |
|
| MainHazards = |
|
|
|
|Formula = C<sub>11</sub>H<sub>16</sub>O |
|
| RPhrases = |
|
|
|
|MolarMass = 164.246 g/mol |
|
| SPhrases = |
|
|
|
|Appearance = colorless to pale yellow liquid |
|
}} |
|
|
|
|Density = 0.94 g/mL, liquid |
|
| Section8 = {{Chembox Related |
|
|
|
|Solubility = in water |
|
| OtherCpds = ] |
|
|
|
|MeltingPtC = 203 to 205 |
|
}} |
|
|
|
| BoilingPtC = 146 |
|
|
| BoilingPt_notes = at 27 mmHg |
|
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Jasmone''' is a natural ] extracted from the volatile portion of the oil from ] flowers. It is a colorless to pale yellow liquid that has the odor of jasmine. Jasmone can exist in two ]ic forms with differing geometry around the pentenyl double bond, cis-jasmone and trans-jasmone. The natural extract contains only the cis form, while synthetic material is often a mixture containing both forms, with the cis form predominating. Both forms have similar odors and chemical properties. |
|
'''Jasmone''' is an ], which is a volatile portion of the oil from ] flowers. It is a colorless to pale yellow liquid. Jasmone can exist in two ]ic forms with differing geometry around the pentenyl double bond, ''cis''-jasmone and ''trans''-jasmone. The natural extract contains only the cis form, while synthetic material is often a mixture of both, with the cis form predominating. Both forms have similar odors and chemical properties. Its structure was deduced by ].<ref>{{cite journal |
|
|
| title = Über Jasminriechstoffe I. Die Konstitution des Jasmons | trans-title = On Jasmine Perfumes I. The Composition of Jasmone |
|
|
|
|
|
|first1=L. |last1=Ruzicka |first2=M. |last2=Pfeiffer | journal = ] |
|
Jasmone is produced within plants by the metabolism of ], from ] by the ]. It can act as either an attractant or a repellent for various insects. Commercially jasmone is used primarily in perfumes and cosmetics. |
|
|
|
|
|
==References== |
|
|
{{reflist}} |
|
|
*{{cite journal |
|
|
| title = Biosynthesis of cis-Jasmone: a pathway for the inactivation and the disposal of the plant stress hormone jasmonic acid to the gas phase? |
|
|
| author = Thomas Koch, Katja Bandemer, Wilhelm Boland |
|
|
| journal = ] |
|
|
| year = 1997 |
|
|
| volume = 80 |
|
|
| issue = 3 |
|
|
| pages = 838–850 |
|
|
| doi = 10.1002/hlca.19970800318 |
|
|
}} |
|
|
*{{cite journal |
|
|
| title = Über Jasminriechstoffe I. Die Konstitution des Jasmons |
|
|
| author = L. Ruzicka, M. Pfeiffer |
|
|
| journal = ] |
|
|
| year = 1933 |
|
| year = 1933 |
|
| volume = 16 |
|
| volume = 16 |
| Line 59: |
Line 45: |
|
| pages = 1208–1214 |
|
| pages = 1208–1214 |
|
| doi = 10.1002/hlca.193301601153 |
|
| doi = 10.1002/hlca.193301601153 |
|
}} |
|
}}</ref> |
|
|
|
|
|
|
Jasmone is produced by some plants by the metabolism of ], via a ].<ref>{{cite journal|first1=P. |last1=Dąbrowska |first2=W. |last2=Boland |title=''iso''-OPDA: An Early Precursor of ''cis''-Jasmone in Plants? |journal= ] |date=2007 |volume=8 |issue=18 |pages=2281–2285 |doi=10.1002/cbic.200700464|pmid=18033720 }}</ref> It can act as either an attractant or a repellent for various insects. Commercially, jasmone is used primarily in perfumes and cosmetics. |
|
] |
|
|
|
|
|
|
|
==References== |
|
] |
|
|
|
{{reflist}} |
|
] |
|
|
|
==External links== |
|
] |
|
|
|
* {{commonscat-inline}} |
|
] |
|
|
|
] |
|
|
] |
|
|
] |