| Revision as of 06:36, 7 December 2010 editحسن علي البط (talk | contribs)Extended confirmed users, Pending changes reviewers19,940 edits added Category:Rhamnosides using HotCat← Previous edit |
Latest revision as of 08:08, 14 July 2024 edit undoHeadbomb (talk | contribs)Edit filter managers, Autopatrolled, Extended confirmed users, Page movers, File movers, New page reviewers, Pending changes reviewers, Rollbackers, Template editors454,470 edits ce |
| (36 intermediate revisions by 18 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Watchedfields = changed |
| ⚫ |
| Name = Kaempferitrin |
|
|
|
| verifiedrevid = 440233634 |
| ⚫ |
| ImageFile = Lespenefril.svg |
|
|
⚫ |
| Name = Kaempferitrin |
| ⚫ |
| ImageSize = 300px |
|
|
⚫ |
| ImageFile = Lespenefril.svg |
| ⚫ |
| ImageName = Kaempferitrin structure |
|
|
⚫ |
| ImageSize = 300px |
| ⚫ |
| IUPACName = <!-- 5-hydroxy-2-(4-hydroxyphenyl)-3,7-bisoxy]chromen-4-one --> |
|
|
⚫ |
| ImageName = Kaempferitrin structure |
| ⚫ |
| OtherNames= Lespenefril<br>Lespenephryl<br>Lespedin<br>lespenephril<br>Kaempferol 3,7-dirhamnoside<br>Kaempferol 3,7 bisrhamnoside |
|
|
|
| IUPACName = 4′,5-Dihydroxy-3,7-bis(α-<small>L</small>-rhamnopyranosyloxy)flavone |
| ⚫ |
| Section1 = {{Chembox Identifiers |
|
|
⚫ |
| SystematicName = 5-Hydroxy-2-(4-hydroxyphenyl)-3,7-bis{oxy}-4''H''-1-benzopyran-4-one |
| ⚫ |
| CASNo = 482-38-2 |
|
|
⚫ |
| OtherNames= Lespenefril<br>Lespenephryl<br>Lespedin<br>lespenephril<br>Kaempferol 3,7-dirhamnoside<br>Kaempferol 3,7 bisrhamnoside |
| ⚫ |
| PubChem = 5486199 |
|
|
⚫ |
|Section1={{Chembox Identifiers |
| ⚫ |
| SMILES = CC1C(C(C(C(O1)OC2=CC(=C3C(=C2)OC(=C(C3=O)OC4C(C(C(C(O4)C)O)O)O)C5=CC=C(C=C5)O)O)O)O)O |
|
|
|
| CASNo_Ref = {{cascite|correct|??}}= {{cascite|correct|??}}= {{cascite|correct|??}} |
|
⚫ |
| CASNo = 482-38-2 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = VPV01U3R59 |
|
⚫ |
| PubChem = 5486199 |
|
|
| KEGG = C16981 |
|
|
| ChemSpiderID = 4588900 |
|
|
| ChEBI = 68883 |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}}= {{ebicite|correct|EBI}}= {{ebicite|correct|EBI}}= {{ebicite|correct|EBI}}= {{ebicite|correct|EBI}}= {{ebicite|correct|EBI}} |
|
|
| ChEMBL = 251766 |
|
⚫ |
| SMILES = CC1C(C(C(C(O1)OC2=CC(=C3C(=C2)OC(=C(C3=O)OC4C(C(C(C(O4)C)O)O)O)C5=CC=C(C=C5)O)O)O)O)O |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula = C<sub>27</sub>H<sub>30</sub>O<sub>14</sub> |
|
| Formula = C<sub>27</sub>H<sub>30</sub>O<sub>14</sub> |
|
| MolarMass = 578.52 g/mol |
|
| MolarMass = 578.52 g/mol |
|
| ExactMass = 578.163556 u |
|
| Density = 1.7 g/mL |
|
| Density = |
|
| MeltingPt = |
|
⚫ |
| BoilingPt = |
|
| MeltingPt = <!-- °C --> |
|
| ⚫ |
| BoilingPt = |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
'''Kaempferitrin''' is a chemical compound. It can be isolated from the leaves of '']''<ref> |
|
'''Kaempferitrin''' is a chemical compound. It can be isolated from the leaves of '']''<ref>{{cite journal |last1=Hamzah |first1=Ahmad Sazali |last2=Lajis |first2=Nordin H. |last3=Sargent |first3=M. V. |date=1994 |title=Kaempferitrin from the leaves of ''Hedyotis verticillata'' and its biological activity |journal=Planta Medica |volume=60 |issue=4 |pages=388–389 |doi=10.1055/s-2006-959513 |pmid=7938277 |s2cid=42952045}} {{INIST|3324508}}.</ref> and from '']''.<ref>{{cite journal |surname=Kobayashi |given=Kenji |date=1944 |title=Tachi shinobu no ichi seibun Kaempferol-birhamnosid ni shūte |trans-title=On kaempferol dirhamnoside, one component of carrot fern |journal=Yakugaku Zasshi |language=ja |volume=64 |issue=9 |page=35 |doi=10.1248/yakushi1944a.64.9_35a |doi-access=free |s2cid=100133209 |s2cid-access=free}}</ref> |
|
|
|
|
|
Kaempferitrin is the 3,7-di] of ]. |
|
Kaempferitrin is the 3,7-di] of ]. |
|
|
|
|
|
==References== |
|
== References == |
|
{{Reflist}} |
|
{{Reflist}} |
|
|
|
|
|
{{flavonol}} |
|
{{flavonol}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
|
|
|
{{Polyphenol-stub}} |
|
{{Aromatic-stub}} |