| Revision as of 11:25, 24 February 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Script assisted update of identifiers from ChemSpider, CommonChemistry and FDA for the Chem/Drugbox validation project - Updated: InChI1->InChI ChEMBL.← Previous edit |
Latest revision as of 23:13, 2 December 2020 edit undoMonkbot (talk | contribs)Bots3,695,952 editsm Task 18 (cosmetic): eval 2 templates: del empty params (3×); cvt lang vals (1×);Tag: AWB |
| (15 intermediate revisions by 11 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
|
|
| verifiedrevid = 461936838 |
|
| Name = Kyotorphin |
|
| Name = Kyotorphin |
|
| ImageFile = Kyotorphin.png |
|
| ImageFile = Kyotorphin.png |
|
|
| ImageSize = 200px |
|
| ImageName = Chemical structure of kyotorphin |
|
| ImageName = Chemical structure of kyotorphin |
|
| IUPACName = (2''S'')-2-<nowiki>amino]-5-(diaminomethylideneamino)pentanoic acid |
|
| IUPACName = (2''S'')-2-<nowiki>amino]-5- (diaminomethylideneamino)pentanoic acid |
|
| OtherNames = Kiotorphin<br><small>L</small>-Tyrosyl-<small>L</small>-Arginine |
|
| OtherNames = Kiotorphin<br><small>L</small>-Tyrosyl-<small>L</small>-arginine |
|
| Section1 = {{Chembox Identifiers |
|
| Section1 = {{Chembox Identifiers |
|
| PubChem = 123804 |
|
| PubChem = 123804 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 110353 |
|
| ChemSpiderID = 110353 |
|
| InChI = 1/C15H23N5O4/c16-11(8-9-3-5-10(21)6-4-9)13(22)20-12(14(23)24)2-1-7-19-15(17)18/h3-6,11-12,21H,1-2,7-8,16H2,(H,20,22)(H,23,24)(H4,17,18,19)/t11-,12-/m0/s1 |
|
| InChI = 1/C15H23N5O4/c16-11(8-9-3-5-10(21)6-4-9)13(22)20-12(14(23)24)2-1-7-19-15(17)18/h3-6,11-12,21H,1-2,7-8,16H2,(H,20,22)(H,23,24)(H4,17,18,19)/t11-,12-/m0/s1 |
|
| InChIKey = JXNRXNCCROJZFB-RYUDHWBXBC |
|
| InChIKey = JXNRXNCCROJZFB-RYUDHWBXBC |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 273521 |
|
| ChEMBL = 273521 |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C15H23N5O4/c16-11(8-9-3-5-10(21)6-4-9)13(22)20-12(14(23)24)2-1-7-19-15(17)18/h3-6,11-12,21H,1-2,7-8,16H2,(H,20,22)(H,23,24)(H4,17,18,19)/t11-,12-/m0/s1 |
|
| StdInChI = 1S/C15H23N5O4/c16-11(8-9-3-5-10(21)6-4-9)13(22)20-12(14(23)24)2-1-7-19-15(17)18/h3-6,11-12,21H,1-2,7-8,16H2,(H,20,22)(H,23,24)(H4,17,18,19)/t11-,12-/m0/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = JXNRXNCCROJZFB-RYUDHWBXSA-N |
|
| StdInChIKey = JXNRXNCCROJZFB-RYUDHWBXSA-N |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo = 70904-56-2 |
|
| CASNo = 70904-56-2 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| SMILES = O=C(O)(NC(=O)(N)Cc1ccc(O)cc1)CCC/N=C(\N)N |
|
|
|
| UNII = 02N30CW3X0 |
|
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEBI = 17537 |
|
⚫ |
| SMILES = O=C(O)(NC(=O)(N)Cc1ccc(O)cc1)CCC/N=C(\N)N |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
| Section2 = {{Chembox Properties |
|
| Formula = C<sub>15</sub>H<sub>23</sub>N<sub>5</sub>O<sub>4</sub> |
|
| C=15|H=23|N=5|O=4 |
|
| MolarMass = 337.374 g/mol |
|
|
| Density = |
|
| Density = |
|
| MeltingPt = |
|
| MeltingPt = |
| Line 25: |
Line 36: |
|
}} |
|
}} |
|
|
|
|
|
'''Kyotorphin''' (L-tyrosyl-L-arginine) is a neuroactive ] which plays a role in pain regulation in the brain. It was first isolated from bovine brain, by Japanese scientists in 1979.<ref>{{cite journal |author=Takagi H, Shiomi H, Ueda H, Amano H |title=A novel analgesic dipeptide from bovine brain is a possible Met-enkephalin releaser |journal=Nature |volume=282 |issue=5737 |pages=410–2 |year=1979 |month=November |pmid=228202 |doi= 10.1038/282410a0|url=}}</ref> Kyotorphin was named for the site of its discovery, ], Japan and because of its ]- (or ]-) like analgesic activity. Kyotorphin has an ] effect, but it does not interact with the ]. Instead, it acts by releasing an ] and stabilizing it from degradation. It may also possess properties of ]/]. It has been shown that kyotorphin is present in the human ] and that it is lower in patients with persistent pain.<ref>{{cite journal |author=Nishimura K, Kaya K, Hazato T, Ueda H, Satoh M, Takagi H |title= |language=Japanese |journal=Masui |volume=40 |issue=11 |pages=1686–90 |year=1991 |month=November |pmid=1766121 |doi= |url=}}</ref> |
|
'''Kyotorphin''' (<small>L</small>-tyrosyl-<small>L</small>-arginine) is a neuroactive ] which plays a role in pain regulation in the brain. It was first isolated from bovine brain, by Japanese scientists in 1979.<ref>{{cite journal |vauthors=Takagi H, Shiomi H, Ueda H, Amano H |title=A novel analgesic dipeptide from bovine brain is a possible Met-enkephalin releaser |journal=Nature |volume=282 |issue=5737 |pages=410–2 |date=November 1979 |pmid=228202 |doi= 10.1038/282410a0}}</ref> Kyotorphin was named for the site of its discovery, ], Japan and because of its ]- (or ]-) like analgesic activity. Kyotorphin has an ] effect, but it does not interact with the ]. Instead, it acts by releasing ] and stabilizing it from degradation. It may also possess properties of ]/]. It has been shown that kyotorphin is present in the human ] and that its concentration is lower in patients with persistent pain.<ref>{{cite journal |vauthors=Nishimura K, Kaya K, Hazato T, Ueda H, Satoh M, Takagi H |title= |language=ja |journal=Masui |volume=40 |issue=11 |pages=1686–90 |date=November 1991 |pmid=1766121 }}</ref> |
|
|
|
|
|
==References== |
|
==References== |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
|
|
{{Opioidergics}} |
|
] |
|
|
|
|
|
|
] |
|
] |
|
] |
|