| Revision as of 13:45, 22 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 456602040 of page Kyotorphin for the Chem/Drugbox validation project (updated: 'CASNo'). |
Latest revision as of 23:13, 2 December 2020 edit Monkbot (talk | contribs)Bots3,695,952 editsm Task 18 (cosmetic): eval 2 templates: del empty params (3×); cvt lang vals (1×);Tag: AWB |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
⚫ |
| verifiedrevid = 461936838 |
|
| Watchedfields = changed |
|
| ⚫ |
| verifiedrevid = 415673112 |
|
|
| Name = Kyotorphin |
|
| Name = Kyotorphin |
|
| ImageFile = Kyotorphin.png |
|
| ImageFile = Kyotorphin.png |
| Line 22: |
Line 20: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = JXNRXNCCROJZFB-RYUDHWBXSA-N |
|
| StdInChIKey = JXNRXNCCROJZFB-RYUDHWBXSA-N |
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo = <!-- blanked - oldvalue: 70904-56-2 --> |
|
| CASNo = 70904-56-2 |
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 02N30CW3X0 |
|
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI = 17537 |
|
| ChEBI = 17537 |
|
| SMILES = O=C(O)(NC(=O)(N)Cc1ccc(O)cc1)CCC/N=C(\N)N |
|
| SMILES = O=C(O)(NC(=O)(N)Cc1ccc(O)cc1)CCC/N=C(\N)N |
| Line 35: |
Line 35: |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Kyotorphin''' (<small>L</small>-tyrosyl-<small>L</small>-arginine) is a neuroactive ] which plays a role in pain regulation in the brain. It was first isolated from bovine brain, by Japanese scientists in 1979.<ref>{{cite journal |vauthors=Takagi H, Shiomi H, Ueda H, Amano H |title=A novel analgesic dipeptide from bovine brain is a possible Met-enkephalin releaser |journal=Nature |volume=282 |issue=5737 |pages=410–2 |date=November 1979 |pmid=228202 |doi= 10.1038/282410a0}}</ref> Kyotorphin was named for the site of its discovery, ], Japan and because of its ]- (or ]-) like analgesic activity. Kyotorphin has an ] effect, but it does not interact with the ]. Instead, it acts by releasing ] and stabilizing it from degradation. It may also possess properties of ]/]. It has been shown that kyotorphin is present in the human ] and that its concentration is lower in patients with persistent pain.<ref>{{cite journal |vauthors=Nishimura K, Kaya K, Hazato T, Ueda H, Satoh M, Takagi H |title= |language=ja |journal=Masui |volume=40 |issue=11 |pages=1686–90 |date=November 1991 |pmid=1766121 }}</ref> |
|
|
|
|
|
==References== |
|
|
{{reflist}} |
|
|
|
|
|
{{Opioidergics}} |
|
|
|
|
|
] |