Misplaced Pages

LY-334370: Difference between revisions

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
Browse history interactively
Page 1
Page 2
← Previous editContent deleted Content addedVisualWikitext
Revision as of 14:28, 3 August 2010 editAnypodetos (talk | contribs)Autopatrolled, Extended confirmed users, Pending changes reviewers, Rollbackers39,350 edits See also: Lasmiditan← Previous edit Latest revision as of 12:25, 5 September 2024 edit undoJWBE (talk | contribs)Extended confirmed users10,127 edits removed Category:Fluoroarenes; added Category:4-Fluorophenyl compounds using HotCat 
(26 intermediate revisions by 20 users not shown)
Line 1: Line 1:
{{short description|Chemical compound}}
{{chembox
{{Chembox
| ImageFile = LY334370.png
| Verifiedfields = changed
| ImageSize = 200px
| Watchedfields = changed
| IUPACName = 4-fluoro-''N''-benzamide
| verifiedrevid = 439982052
| ImageFile = LY334370.svg
| ImageFile2 = LY-334370 3D BS.png
| PIN = 4-Fluoro-''N''-benzamide
| OtherNames = LY-334,370 | OtherNames = LY-334,370
| Section1 = {{Chembox Identifiers |Section1={{Chembox Identifiers
| CASNo_Ref = {{cascite|correct|??}}
| CASNo=182563-08-2 | CASNo = 182563-08-2
| PubChem=5311258
| UNII_Ref = {{fdacite|correct|FDA}}
| IUPHAR_ligand = 151
| UNII = 5Q7I1WL2UY
| PubChem = 5311258
| IUPHAR_ligand2 = 151
| IUPHAR_ligand = 20 | IUPHAR_ligand = 20
| SMILES=CN1CCC(c2c3cc(N()C(c4ccc(F)cc4)=O)ccc3n()c2)CC1 | SMILES = CN1CCC(c2c3cc(N()C(c4ccc(F)cc4)=O)ccc3n()c2)CC1
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
}}
| ChemSpiderID = 4470773
| Section2 = {{Chembox Properties
| InChI = 1/C21H22FN3O/c1-25-10-8-14(9-11-25)19-13-23-20-7-6-17(12-18(19)20)24-21(26)15-2-4-16(22)5-3-15/h2-7,12-14,23H,8-11H2,1H3,(H,24,26)
| Formula=C<sub>21</sub>H<sub>22</sub>FN<sub>3</sub>O
| InChIKey = MDMJLMDBRQXOOI-UHFFFAOYAA
| MolarMass=351.42 g/mol
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| Appearance=
| StdInChI = 1S/C21H22FN3O/c1-25-10-8-14(9-11-25)19-13-23-20-7-6-17(12-18(19)20)24-21(26)15-2-4-16(22)5-3-15/h2-7,12-14,23H,8-11H2,1H3,(H,24,26)
| Density=
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| MeltingPt=
| StdInChIKey = MDMJLMDBRQXOOI-UHFFFAOYSA-N
| BoilingPt=
| RTECS =
| Solubility=
| MeSHName = C108218
}}
}}
| Section3 = {{Chembox Hazards
|Section2={{Chembox Properties
| MainHazards=
| C=21 | H=22 | F=1 | N=3 | O=1
| FlashPt=
| Appearance =
| Autoignition=
| Density =
}}
| MeltingPt =
| BoilingPt =
| Solubility =
}}
|Section3={{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
}}
}} }}


'''LY-334,370''' is a selective ] receptor ]<ref name="pmid9641544">{{cite journal | author = Dupuis DS, Colpaert FC, Pauwels PJ | title = G-protein activation at 5-HT<sub>1A</sub> receptors by the 5-HT<sub>1F</sub> ligand LY-334,370 in guinea-pig brain sections and recombinant cell lines | journal = Br. J. Pharmacol. | volume = 124 | issue = 2 | pages = 283–90 | year = 1998 | pmid = 9641544 | doi = 10.1038/sj.bjp.0701832 | issn = }}</ref> which was under development by ] for the treatment of ] headaches.<ref name="pmid10668103">{{cite journal | author = Shepheard S, Edvinsson L, Cumberbatch M, Williamson D, Mason G, Webb J, Boyce S, Hill R, Hargreaves R | title = Possible antimigraine mechanisms of action of the 5HT<sub>1F</sub> receptor agonist LY-334,370 | journal = Cephalalgia | volume = 19 | issue = 10 | pages = 851–8 | year = 1999 | pmid = 10668103 | doi = 10.1046/j.1468-2982.1999.1910851.x | issn = }}</ref> The drug showed efficacy in a phase II clinical trial<ref name="pmid11675061">{{cite journal | author = Goldstein DJ, Roon KI, Offen WW, Ramadan NM, Phebus LA, Johnson KW, Schaus JM, Ferrari MD | title = Selective seratonin 1F (5-HT<sub>1F</sub>) receptor agonist LY334370 for acute migraine: a randomised controlled trial | journal = Lancet | volume = 358 | issue = 9289 | pages = 1230–4 | year = 2001 | pmid = 11675061 | doi = 10.1016/S0140-6736(01)06347-4 | issn = }}</ref> but further development was halted due to toxicity detected in animals.<ref name="pmid16797716">{{cite journal | author = Ramadan NM, Buchanan TM | title = New and future migraine therapy | journal = Pharmacol. Ther. | volume = 112 | issue = 1 | pages = 199–212 | year = 2006 | pmid = 16797716 | doi = 10.1016/j.pharmthera.2005.04.010 | issn = }}</ref> '''LY-334370''' is a selective ] ]<ref name="pmid9641544">{{cite journal |vauthors=Dupuis DS, Colpaert FC, Pauwels PJ | title = G-protein activation at 5-HT<sub>1A</sub> receptors by the 5-HT<sub>1F</sub> ligand LY-334,370 in guinea-pig brain sections and recombinant cell lines | journal = Br. J. Pharmacol. | volume = 124 | issue = 2 | pages = 283–90 | year = 1998 | pmid = 9641544 | doi = 10.1038/sj.bjp.0701832 | pmc=1565387}}</ref> which was under development by ] for the treatment of ] headaches.<ref name="pmid10668103">{{cite journal |vauthors=Shepheard S, Edvinsson L, Cumberbatch M, Williamson D, Mason G, Webb J, Boyce S, Hill R, Hargreaves R | title = Possible antimigraine mechanisms of action of the 5HT<sub>1F</sub> receptor agonist LY-334,370 | journal = Cephalalgia | volume = 19 | issue = 10 | pages = 851–8 | year = 1999 | pmid = 10668103 | doi = 10.1046/j.1468-2982.1999.1910851.x | s2cid = 8439008 }}</ref> The drug showed efficacy in a phase II clinical trial<ref name="pmid11675061">{{cite journal |vauthors=Goldstein DJ, Roon KI, Offen WW, Ramadan NM, Phebus LA, Johnson KW, Schaus JM, Ferrari MD | title = Selective seratonin 1F (5-HT<sub>1F</sub>) receptor agonist LY334370 for acute migraine: a randomised controlled trial | journal = Lancet | volume = 358 | issue = 9289 | pages = 1230–4 | year = 2001 | pmid = 11675061 | doi = 10.1016/S0140-6736(01)06347-4 | s2cid = 39926402 }}</ref> but further development was halted due to toxicity detected in animals.<ref name="pmid16797716">{{cite journal |vauthors=Ramadan NM, Buchanan TM | title = New and future migraine therapy | journal = Pharmacol. Ther. | volume = 112 | issue = 1 | pages = 199–212 | year = 2006 | pmid = 16797716 | doi = 10.1016/j.pharmthera.2005.04.010 }}</ref>


==See also== ==See also==
* ]
* ], another 5-HT<sub>1F</sub> agonist for the treatment of migraine
* ]
* ]


==References== ==References==
Line 38: Line 56:
* {{MeshName|4-fluoro-N-(3-(1-methyl-4-piperidinyl)-1H-indol-5-yl)benzamide}} * {{MeshName|4-fluoro-N-(3-(1-methyl-4-piperidinyl)-1H-indol-5-yl)benzamide}}


{{Serotonin receptor modulators}}
{{Serotonergics}}


] ]
]
] ]
] ]
] ]
] ]
]


{{nervous-system-drug-stub}} {{nervous-system-drug-stub}}