| Revision as of 23:37, 19 April 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (← Previous edit |
Latest revision as of 19:32, 20 December 2023 edit undoJJMC89 bot III (talk | contribs)Bots, Administrators3,748,564 editsm Moving Category:Eli Lilly and Company brands to Category:Drugs developed by Eli Lilly and Company per Misplaced Pages:Categories for discussion/Log/2023 December 9#Category:AstraZeneca brands |
| (32 intermediate revisions by 24 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{drugbox |
|
|
|
{{Drugbox |
|
| verifiedrevid = 413962947 |
|
|
|
| Verifiedfields = changed |
|
| IUPAC_name = N-(4-(2-methoxyphenoxy)phenyl)- N-(2,2,2-trifluoroethylsulfonyl)pyrid- 3-ylmethylamine |
|
|
|
| Watchedfields = changed |
|
| image = LY-487,379_structure.png |
|
|
|
| verifiedrevid = 424939072 |
|
| width = 200 |
|
|
|
| IUPAC_name = N-(4-(2-methoxyphenoxy)phenyl)- N-(2,2,2-trifluoroethylsulfonyl)pyrid- 3-ylmethylamine |
|
| CAS_number = |
|
|
|
| image = LY-487,3793Dan.svg |
|
| ATC_prefix = none |
|
|
|
| width = 200 |
|
| ATC_suffix = |
|
|
|
|
|
| PubChem = 9825084 |
|
|
|
<!--Clinical data--> |
|
|
| tradename = |
|
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
|
| pregnancy_category = |
|
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
|
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
|
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
|
| legal_status = |
|
|
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
|
| bioavailability = |
|
|
| protein_bound = |
|
|
| metabolism = |
|
|
| elimination_half-life = |
|
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|CAS}} |
|
|
| CAS_number = 353231-17-1 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 7WF5ZLL4D9 |
|
|
| ATC_prefix = none |
|
|
| ATC_suffix = |
|
|
| PubChem = 9825084 |
|
| IUPHAR_ligand = 1402 |
|
| IUPHAR_ligand = 1402 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
| DrugBank = |
|
|
|
| ChEMBL = 108939 |
|
| C=21|H=19|F=3|N=2|O=4|S=1 |
|
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| molecular_weight = 452.446 g/mol |
|
|
|
| DrugBank = |
|
| smiles = c3ncccc3CN(S(=O)(=O)CC(F)(F)F)c2ccc(cc2)Oc1ccccc1OC |
|
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
| bioavailability = |
|
|
| protein_bound = |
|
| ChemSpiderID = 8000831 |
|
|
|
|
| metabolism = |
|
|
|
<!--Chemical data--> |
|
| elimination_half-life = |
|
|
| excretion = |
|
| C=21 | H=19 | F=3 | N=2 | O=4 | S=1 |
|
|
| smiles = c3ncccc3CN(S(=O)(=O)CC(F)(F)F)c2ccc(cc2)Oc1ccccc1OC |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
|
|
| StdInChI = 1S/C21H19F3N2O4S/c1-29-19-6-2-3-7-20(19)30-18-10-8-17(9-11-18)26(14-16-5-4-12-25-13-16)31(27,28)15-21(22,23)24/h2-13H,14-15H2,1H3 |
|
| pregnancy_category= |
|
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
|
|
| StdInChIKey = ALMACYDZFBMGOR-UHFFFAOYSA-N |
|
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
|
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
|
| legal_status = |
|
|
| routes_of_administration = |
|
|
}} |
|
}} |
|
|
|
|
|
|
'''LY-487,379''' is a drug used in scientific research that acts as a selective ] for the ] group II subtype ].<ref>{{cite journal | vauthors = Johnson MP, Baez M, Jagdmann GE, Britton TC, Large TH, Callagaro DO, Tizzano JP, Monn JA, Schoepp DD | display-authors = 6 | title = Discovery of allosteric potentiators for the metabotropic glutamate 2 receptor: synthesis and subtype selectivity of N-(4-(2-methoxyphenoxy)phenyl)-N-(2,2,2- trifluoroethylsulfonyl)pyrid-3-ylmethylamine | journal = Journal of Medicinal Chemistry | volume = 46 | issue = 15 | pages = 3189–92 | date = July 2003 | pmid = 12852748 | doi = 10.1021/jm034015u }}</ref> It is used to study the structure and function of this receptor subtype,<ref>{{cite journal | vauthors = Schaffhauser H, Rowe BA, Morales S, Chavez-Noriega LE, Yin R, Jachec C, Rao SP, Bain G, Pinkerton AB, Vernier JM, Bristow LJ, Varney MA, Daggett LP | display-authors = 6 | title = Pharmacological characterization and identification of amino acids involved in the positive modulation of metabotropic glutamate receptor subtype 2 | journal = Molecular Pharmacology | volume = 64 | issue = 4 | pages = 798–810 | date = October 2003 | pmid = 14500736 | doi = 10.1124/mol.64.4.798 | s2cid = 15919973 }}</ref><ref>{{cite journal | vauthors = Poisik O, Raju DV, Verreault M, Rodriguez A, Abeniyi OA, Conn PJ, Smith Y | title = Metabotropic glutamate receptor 2 modulates excitatory synaptic transmission in the rat globus pallidus | journal = Neuropharmacology | volume = 49 | pages = 57–69 | year = 2005 | issue = Suppl 1 | pmid = 15993439 | doi = 10.1016/j.neuropharm.2005.03.006 | s2cid = 21881395 }}</ref> and LY-487,379 along with various other mGluR<sub>2/3</sub> agonists and positive modulators are being investigated as possible ] and ] drugs.<ref>{{cite journal | vauthors = Galici R, Echemendia NG, Rodriguez AL, Conn PJ | title = A selective allosteric potentiator of metabotropic glutamate (mGlu) 2 receptors has effects similar to an orthosteric mGlu2/3 receptor agonist in mouse models predictive of antipsychotic activity | journal = The Journal of Pharmacology and Experimental Therapeutics | volume = 315 | issue = 3 | pages = 1181–1187 | date = December 2005 | pmid = 16123306 | doi = 10.1124/jpet.105.091074 | s2cid = 9159875 | url = http://pdfs.semanticscholar.org/3000/65580e1d888e0d2383e21447ec7b1f1b6a6a.pdf | archive-url = https://web.archive.org/web/20190221225118/http://pdfs.semanticscholar.org/3000/65580e1d888e0d2383e21447ec7b1f1b6a6a.pdf | url-status = dead | archive-date = 2019-02-21 }}</ref><ref>{{cite journal | vauthors = Marino MJ, Conn PJ | title = Glutamate-based therapeutic approaches: allosteric modulators of metabotropic glutamate receptors | journal = Current Opinion in Pharmacology | volume = 6 | issue = 1 | pages = 98–102 | date = February 2006 | pmid = 16368268 | doi = 10.1016/j.coph.2005.09.006 }}</ref><ref>{{cite journal | vauthors = Harich S, Gross G, Bespalov A | title = Stimulation of the metabotropic glutamate 2/3 receptor attenuates social novelty discrimination deficits induced by neonatal phencyclidine treatment | journal = Psychopharmacology | volume = 192 | issue = 4 | pages = 511–9 | date = July 2007 | pmid = 17318501 | doi = 10.1007/s00213-007-0742-y | s2cid = 7551116 }}</ref><ref>{{cite journal | vauthors = Conn PJ, Jones CK | title = Promise of mGluR2/3 activators in psychiatry | journal = Neuropsychopharmacology | volume = 34 | issue = 1 | pages = 248–9 | date = January 2009 | pmid = 19079073 | pmc = 2907744 | doi = 10.1038/npp.2008.156 }}</ref><ref>{{cite journal | vauthors = Hermes ML, Renaud LP | title = Postsynaptic and presynaptic group II metabotropic glutamate receptor activation reduces neuronal excitability in rat midline paraventricular thalamic nucleus | journal = The Journal of Pharmacology and Experimental Therapeutics | volume = 336 | issue = 3 | pages = 840–9 | date = March 2011 | pmid = 21139059 | doi = 10.1124/jpet.110.176149 | s2cid = 25111011 | url = http://pdfs.semanticscholar.org/3338/3c0769e7c9f9bffbedd6fdbfec4124dc0140.pdf | archive-url = https://web.archive.org/web/20190222071207/http://pdfs.semanticscholar.org/3338/3c0769e7c9f9bffbedd6fdbfec4124dc0140.pdf | url-status = dead | archive-date = 2019-02-22 }}</ref> |
|
'''LY-487,379''' is a drug used in scientific research that acts as a selective ] for the ] group II subtype ].<ref>{{Cite pmid|12852748}}</ref> It is used to study the structure and function of this receptor subtype,<ref>{{Cite journal | first1 = H. |
|
|
| author2 = Rowe |
|
|
| author3 = Morales |
|
|
| last1 = Schaffhauser | first2 = B. A. | first3 = S. |
|
|
| last4 = Chavez-noriega |
|
|
| last6 = Jachec |
|
|
| author4 = Chavez-noriega | first4 = L. E. |
|
|
| author5 = Yin | first5 = R. |
|
|
| last7 = Rao |
|
|
| last5 = Yin |
|
|
| last3 = Morales |
|
|
| author6 = Jachec |
|
|
| last2 = Rowe |
|
|
| author1 = | first6 = C. |
|
|
| author7 = Rao |
|
|
| last9 = Pinkerton | first7 = S. P. |
|
|
| author8 = Bain | first8 = G. |
|
|
| author9 =Pinkerton | first9 = A. B. |
|
|
| title = Pharmacological Characterization and Identification of Amino Acids Involved in the Positive Modulation of Metabotropic Glutamate Receptor Subtype 2 |
|
|
| journal = Molecular Pharmacology |
|
|
| volume = 64 | issue = 4 |
|
|
| pages = 798–810 |
|
|
| last8 = Bain |
|
|
| year = 2003 | pmid = 14500736 | first10 = JM |
|
|
| doi = 10.1124/mol.64.4.798 |
|
|
}}</ref><ref>{{Cite journal |
|
|
| author1 = | first1 = O. |
|
|
| author2 = |
|
|
| last1 = Poisik |
|
|
| last2 = Raju | first2 = D. V. |
|
|
| author3 = |
|
|
| last3 = Verreault| first3 = M. |
|
|
| author4 = |
|
|
| last4 = Rodriguez| first4 = A. |
|
|
| author5 = |
|
|
| last5 = Abeniyi| first5 = O. A. |
|
|
| author6 = |
|
|
| last6 = Conn| first6 = P. J. |
|
|
| author7 = |
|
|
| last7 = Smith| first7 = Y. |
|
|
| title = Metabotropic glutamate receptor 2 modulates excitatory synaptic transmission in the rat globus pallidus |
|
|
| journal = Neuropharmacology |
|
|
| volume = 49 |
|
|
| pages = 57–50 |
|
|
| year = 2005 |
|
|
| doi = 10.1016/j.neuropharm.2005.03.006| pmid=15993439 |
|
|
}}</ref> and LY-487,379 along with various other mGluR<sub>2/3</sub> agonists and positive modulators are being investigated as possible ] and ] drugs.<ref>{{Cite journal |
|
|
| author1 = | first1 = R. | first2 = N. G. |
|
|
| author3 = |
|
|
| last1 = Galici |
|
|
| author2 = | first3 = A. L. | first4 = P. J. |
|
|
| title = A Selective Allosteric Potentiator of Metabotropic Glutamate (mGlu) 2 Receptors Has Effects Similar to an Orthosteric mGlu2/3 Receptor Agonist in Mouse Models Predictive of Antipsychotic Activity |
|
|
| journal = Journal of Pharmacology and Experimental Therapeutics |
|
|
| last3 = Rodriguez |
|
|
| volume = 315 |
|
|
| last4 = Conn |
|
|
| issue = 3 |
|
|
| pages = 1181–7 |
|
|
| year = 2005 |
|
|
| pmid = 16123306 |
|
|
| doi = 10.1124/jpet.105.091074 |
|
|
| last2 = Echemendia |
|
|
| author4 = |
|
|
}}</ref><ref>{{Cite pmid|16368268}}</ref><ref>{{Cite pmid|17318501}}</ref><ref>{{Cite pmid|190790739}}</ref> |
|
|
|
|
|
|
==See also== |
|
== See also == |
|
* ] |
|
* ] |
|
* ] |
|
* ] |
|
|
|
|
|
== References == |
|
== References == |
|
{{reflist}} |
|
{{Reflist|2}} |
|
|
|
|
{{Glutamate_receptor_ligands}} |
|
|
|
|
|
|
|
{{Metabotropic glutamate receptor modulators}} |
|
] |
|
|
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
{{pharmacology-stub}} |
|
{{nervous-system-drug-stub}} |