| Revision as of 12:12, 18 April 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (← Previous edit |
Latest revision as of 12:09, 29 September 2024 edit undoJWBE (talk | contribs)Extended confirmed users10,129 edits removed Category:Nitroarenes; added Category:Nitrobenzene derivatives using HotCat |
| (28 intermediate revisions by 19 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 404071433 |
|
|
|
| Watchedfields = changed |
| ⚫ |
| Reference = <ref name=Al></ref><ref name=Ex></ref> |
|
|
⚫ |
| verifiedrevid = 424675835 |
| ⚫ |
| ImageFile = Lactofen.gif |
|
|
⚫ |
| Reference = <ref name=Ex></ref> |
|
| ImageSize = |
|
|
⚫ |
| ImageFile = Lactofen.svg |
|
| IUPACName = ethyl O--DL-lactate |
|
| IUPACName = Ethyl ''O''--<small>DL</small>-lactate |
|
| OtherNames = 2-ethoxy-1-methyl-2-oxoethyl 5--2-nitrobenzoate |
|
| OtherNames = 2-Ethoxy-1-methyl-2-oxoethyl 5--2-nitrobenzoate |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| Abbreviations = |
|
| Abbreviations = |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo = 77501-63-4 |
|
| CASNo = 77501-63-4 |
|
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
|
| UNII = L44N8UV47O |
|
| EINECS = |
|
| EINECS = |
|
| PubChem = |
|
| PubChem = 62276 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
| SMILES = |
|
|
|
| ChemSpiderID = 56077 |
| ⚫ |
| InChI = 1S/C19H15ClF3NO7/c1-3-29-17(25)10(2)30-18(26)13-9-12(5-6-15(13)24(27)28)31-16-7-4-11(8-14(16)20)19(21,22)23/h4-10H,3H2,1-2H3 |
|
|
|
| SMILES = CCOC(=O)C(C)OC(=O)c1cc(ccc1(=O))Oc2ccc(cc2Cl)C(F)(F)F |
|
⚫ |
| InChI = 1/C19H15ClF3NO7/c1-3-29-17(25)10(2)30-18(26)13-9-12(5-6-15(13)24(27)28)31-16-7-4-11(8-14(16)20)19(21,22)23/h4-10H,3H2,1-2H3 |
|
|
| InChIKey = CONWAEURSVPLRM-UHFFFAOYAB |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C19H15ClF3NO7/c1-3-29-17(25)10(2)30-18(26)13-9-12(5-6-15(13)24(27)28)31-16-7-4-11(8-14(16)20)19(21,22)23/h4-10H,3H2,1-2H3 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = CONWAEURSVPLRM-UHFFFAOYSA-N |
|
| RTECS = |
|
| RTECS = |
|
| MeSHName = |
|
| MeSHName = |
| Line 18: |
Line 29: |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = |
|
| KEGG = |
|
|
}} |
|
| ATCCode_prefix = |
|
|
⚫ |
|Section2={{Chembox Properties |
|
| ATCCode_suffix = |
|
|
|
| C=19 | H=15 | Cl=1 | F=3 | N=1 | O=7 |
|
| ATC_Supplemental =}} |
|
| ⚫ |
| Section2 = {{Chembox Properties |
|
|
| Formula = C<sub>19</sub>H<sub>15</sub>ClF<sub>3</sub>NO<sub>7</sub> |
|
|
| MolarMass = 461.78 |
|
|
| Appearance = White crystalline solid |
|
| Appearance = White crystalline solid |
|
| Density = |
|
| Density = |
|
| MeltingPt = 43.9 - 45.5 degrees C |
|
| MeltingPtC = 43.9 to 45.5 |
|
| Melting_notes = |
|
| MeltingPt_notes = |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Boiling_notes = |
|
| BoilingPt_notes = |
|
| Solubility = 0.1 mg/L @ 20 degrees C |
|
| Solubility = 0.1 mg/L @ 20 degrees C |
|
| SolubleOther = |
|
| SolubleOther = |
| Line 35: |
Line 43: |
|
| pKa = |
|
| pKa = |
|
| pKb = }} |
|
| pKb = }} |
|
| Section7 = {{Chembox Hazards |
|
|Section7={{Chembox Hazards |
|
| EUClass = |
|
|
| EUIndex = |
|
|
| MainHazards = |
|
| MainHazards = |
|
| NFPA-H = |
|
| NFPA-H = |
|
| NFPA-F = |
|
| NFPA-F = |
|
| NFPA-R = |
|
| NFPA-R = |
|
| NFPA-O = |
|
| NFPA-S = |
|
| RPhrases = |
|
|
| SPhrases = |
|
|
| RSPhrases = |
|
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = |
|
| AutoignitionPt = |
|
| ExploLimits = |
|
| ExploLimits = |
|
| PEL = }} |
|
| PEL = }} |
|
}} |
|
}} |
|
|
|
|
|
'''Lactofen''' is a complex ester of ] and is a ] selective ]. It is used in postemergence applications to certain crops which are resistant to its action.<ref></ref> The name "Lactofen" is approved by the ] and the ], and is also approved in China (乳氟禾草灵). It has no ISO common name.<ref name=Al/> |
|
'''Lactofen''' is a complex ester of ] and is a ] selective ]<ref name="Purdue" /><ref name="SDSU-Ext-soy-guide">{{cite book | url=http://extension.sdstate.edu/sites/default/files/2019-01/P-00010_0.pdf | title=2019 South Dakota Pest Management Guide - Soybeans - A guide to managing weeds, insects, and diseases | author=]}}</ref> and ].<ref name="NDSU-Ext">{{cite web | title=White Mold in Soybeans - Crops | website=] | url=http://www.ag.ndsu.edu/crops/soybean-articles/white-mold-in-soybeans | access-date=2021-07-29}}</ref><ref name="Mich-State-Ext">{{cite web | title=Applying foliar fungicides for control of white mold in soybeans | website=] | url=http://www.canr.msu.edu/news/applying_foliar_fungicides_for_control_of_white_mold_in_soybeans | access-date=2021-07-29}}</ref><ref name="Uga-Ext">{{cite web | last=Kichler | first=Jeremy | title=Questions of the Week!! 7/19/21 - Colquitt County Ag Report | website=] | date=2021-07-19 | url=http://site.extension.uga.edu/colquittag/2021/07/questions-of-the-week-7-19-21/ | access-date=2021-07-29}}</ref> It is used in postemergence applications to certain crops which are resistant to its action.<ref name="Purdue"></ref> The name "Lactofen" is approved by the ] and the ], and is also approved in China (乳氟禾草灵). |
|
|
|
|
|
Lactofen is applied as a foliar spray and is commonly used to control ] ]s in ], ]s, ]es and ]s. It may be combined with oil or fertilizer adjuvants and surfactants. Some formulations include solvents such as ]s and ].<ref name=Ex/> |
|
Lactofen is applied as a foliar spray and is commonly used to control ] ]s in ], ]s, ]es and ]s. It may be combined with oil or fertilizer adjuvants and surfactants. Some formulations include solvents such as ]s and ].<ref name=Ex/> It is also used as a fungicide for '']'' white moulds on ].<ref name="NDSU-Ext" /><ref name="Mich-State-Ext" /><ref name="Uga-Ext" /> |
|
|
|
|
|
Lactofen is available in solid form or as an emulsifiable concentrate under the trade name COBRA.<ref name=Ex/> |
|
Lactofen is available in solid form or as an emulsifiable concentrate under the trade name COBRA.<ref name=Ex/> |
|
|
|
|
|
==Toxicology== |
|
==Toxicology== |
|
Lactofen is slightly to non-toxic to humans when ingested or inhaled. It can cause skin irritation including reddening, swelling and possibly corrosive burns. It is a severe eye irritant and can cause permanent damage to eyes when there is sufficient exposure.<ref>Valent USA. 1993. Material Safety Data Sheet for Valent Cobra Herbicide. Valent USA Corporation. Walnut Creek, CA.</ref> |
|
Lactofen is slightly non-toxic to humans when ingested or inhaled. It can cause skin irritation including reddening, swelling and possibly corrosive burns. It is a severe eye irritant and can cause permanent damage to the eyes when there is sufficient exposure.<ref>Valent USA. 1993. Material Safety Data Sheet for Valent Cobra Herbicide. Valent USA Corporation. Walnut Creek, CA.</ref> |
|
|
|
|
|
It was found to be practically non-toxic to the species of bird that were studied.<ref name=HH>Herbicide Handbook of the Weed Science Society of America. 1989. Sixth edition. Champaign, IL</ref> Toxicity to fish and other aquatic organisms varied and it was eliminated in fish within fourteen days. It is of low toxicity to bees.<ref>US Environmental Protection Agency. 1995. File: Lactofen, Integrated Risk Information System (IRIS). National Library of Medicine "Toxline" Database, 4/95.</ref> |
|
It was found to be practically non-toxic to the species of birds that were studied.<ref name=HH>Herbicide Handbook of the Weed Science Society of America. 1989. Sixth edition. Champaign, IL</ref> Toxicity to fish and other aquatic organisms varied and it was eliminated in fish within fourteen days. It is of low toxicity to bees.<ref>US Environmental Protection Agency. 1995. File: Lactofen, Integrated Risk Information System (IRIS). National Library of Medicine "Toxline" Database, 4/95.</ref> |
|
|
|
|
|
Lactofen has a very low solubility in water and is not expected to contaminate surface waters. It binds tightly to soil and is then broken down in between one and seven days.<ref name=HH/><ref>US Environmental Protection Agency. 1987. Fact Sheet Number 128: Lactofen. Washington, DC.</ref> |
|
Lactofen has a very low solubility in water and is not expected to contaminate surface waters. It binds tightly to soil and is then broken down in between one and seven days.<ref name=HH/><ref>US Environmental Protection Agency. 1987. Fact Sheet Number 128: Lactofen. Washington, DC.</ref> |
| Line 67: |
Line 70: |
|
==References== |
|
==References== |
|
{{Reflist}} |
|
{{Reflist}} |
|
|
|
|
|
==External links== |
|
|
* {{PPDB|1160}} |
|
|
|
|
|
{{Herbicides}} |
|
{{Herbicides}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |