Misplaced Pages

Lanostane: Difference between revisions

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
Browse history interactively
Page 1
Page 2
← Previous editContent deleted Content addedVisualWikitext
Revision as of 01:56, 7 January 2011 editJorge Stolfi (talk | contribs)Autopatrolled, Extended confirmed users, Rollbackers27,608 edits typo "ü"← Previous edit Latest revision as of 23:07, 8 December 2023 edit undoMaxim Masiutin (talk | contribs)Extended confirmed users, IP block exemptions, Pending changes reviewers31,043 edits Removed proxy/dead URL that duplicated identifier. | Use this bot. Report bugs
(19 intermediate revisions by 13 users not shown)
Line 1: Line 1:
{{Chembox {{Chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 424957756
| ImageFile = Lanostane.svg | ImageFile = Lanostane.svg
| ImageSize = 200px | ImageAlt =
| ImageAlt = | ImageSize = 250
| IUPACName = | IUPACName =
| OtherNames = 4,4,14-Trimethylcholestane | OtherNames = 4,4,14α-Trimethylcholestane
| Section1 = {{Chembox Identifiers |Section1={{Chembox Identifiers
| CASNo = 474-20-4 | CASNo = 474-20-4
| CASNo_Comment = (5α) | CASNo_Comment = (5α)
| CASNo_Ref = {{cascite|correct|CAS}} | CASNo_Ref = {{cascite|correct|CAS}}
| CASNo1 = 57496-02-3 | CASNo1 = 57496-02-3
| CASNo1_Comment = (5β) | CASNo1_Comment = (5β)
| CASNo1_Ref = {{cascite|correct|CAS}} | CASNo1_Ref = {{cascite|correct|CAS}}
| PubChem = | PubChem1 = 9548665
| PubChem1_Comment = (5α)
| SMILES1 = C(CCCC(C)C)1()CC2(C)3()CC4()C(C)(C)CCC4(C)3()CC21C
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| SMILES1_Comment = (5α)
| ChemSpiderID = 7827588
| SMILES2 = C(CCCC(C)C)1()CC2(C)3()CC4()C(C)(C)CCC4(C)3()CC21C
| SMILES2_Comment = () | ChemSpiderID_Comment = ()
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = 20265
| ChEBI_Comment = (5α)
| SMILES1 = C(CCCC(C)C)1()CC2(C)3()CC4()C(C)(C)CCC4(C)3()CC21C
| SMILES1_Comment = (5α)
| SMILES2 = C(CCCC(C)C)1()CC2(C)3()CC4()C(C)(C)CCC4(C)3()CC21C
| SMILES2_Comment = (5β)
| InChI = 1/C30H54/c1-21(2)11-9-12-22(3)23-15-19-30(8)25-13-14-26-27(4,5)17-10-18-28(26,6)24(25)16-20-29(23,30)7/h21-26H,9-20H2,1-8H3/t22-,23-,24+,25-,26+,28-,29-,30+/m1/s1
| InChI_Comment = (5α)
| InChIKey = ZQIOPEXWVBIZAV-ZKYCIREVBA
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C30H54/c1-21(2)11-9-12-22(3)23-15-19-30(8)25-13-14-26-27(4,5)17-10-18-28(26,6)24(25)16-20-29(23,30)7/h21-26H,9-20H2,1-8H3/t22-,23-,24+,25-,26+,28-,29-,30+/m1/s1
| StdInChI_Comment = (5α)
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = ZQIOPEXWVBIZAV-ZKYCIREVSA-N
}}
|Section2={{Chembox Properties
| C=30 | H=54
| Appearance =
| Density =
| MeltingPtC = 98 to 99
| MeltingPt_ref = <ref>{{cite journal | doi = 10.1002/hlca.19500330658 | author = Voser, W. | last2 = Montavon | first2 = M. | last3 = Günthard | first3 = Hs. H. | last4 = Jeger | first4 = O. | last5 = Ruzicka | first5 = L. | title = Zur Kenntnis der Triterpene. 156. Mitteilung. Zur Konstitution des Lanostadienols | journal = Helvetica Chimica Acta | year = 1950 | volume = 33 | issue = 6 | pages = 1893–1910}}</ref>
| BoilingPt =
| Solubility =
}}
|Section3={{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
}} }}
| Section2 = {{Chembox Properties
| C=30 | H=54
| Appearance =
| Density =
| MeltingPt = 98-99 °C<ref>{{cite journal | doi = 10.1002/hlca.19500330658 | author = Voser, W. | last2 = Montavon | first2 = M. | last3 = Günthard | first3 = Hs. H. | last4 = Jeger | first4 = O. | last5 = Ruzicka | first5 = L. | title = Zur Kenntnis der Triterpene. 156. Mitteilung. Zur Konstitution des Lanostadienols | journal = Helvetica Chimica Acta | year = 1950 | volume = 33 | pages = 1893–1910}}</ref>
| BoilingPt =
| Solubility = }}
| Section3 = {{Chembox Hazards
| MainHazards =
| FlashPt =
| Autoignition = }}
}} }}


'''Lanostane''' or '''4,4,14-trimethylcholestane''' is a ] with formula {{chem|C|30|H|54}}. It is a ], specifically a ]. It is an isomer of ]. '''Lanostane''' or '''4,4,14α-trimethylcholestane''' is a ] ] with formula {{chem|C|30|H|54}}. It is a ], specifically a ]. It is an isomer of ].


The name is applied to two ]s, distinguished by the prefixes '''5α-''' and '''5β-''', which differ by the handedness of the bonds at a particular ] atom (number 5 in the standard steroid numbering scheme).<ref name=iupac69/> The name is applied to two ]s, distinguished by the prefixes '''5α-''' and '''5β-''', which differ by the handedness of the bonds at a particular ] atom (number 5 in the standard steroid numbering scheme).<ref name=iupac69/>
Line 40: Line 61:
</gallery> </gallery>


Replacement of a ] atom attached to ] number 3 in the 5α isomer with a ] results in ], the ] ] of the ]s in animals.<ref name=iupac69>IUPAC Commission on the Nomenclature of Organic Chemistry and IUPAC-IUB Commission on Biochemical Nomenclature (1969), ''The Nomenclature of Steroids - Revised Tentative Rules''. European J. of Biochemistry, volume 10, 1-19</ref> Replacement of a ] atom attached to ] number 3 in the 5α isomer with a ] results in ], the ] ] of the ]s in animals.<ref name=iupac69>{{cite journal |author=IUPAC Commission on the Nomenclature of Organic Chemistry and IUPAC-IUB Commission on Biochemical Nomenclature |year=1969 |title=The Nomenclature of Steroids Revised Tentative Rules |journal=European Journal of Biochemistry |volume=10 |issue=1 |pages=1–19 |doi=10.1111/j.1432-1033.1969.tb00650.x |doi-access=free }}</ref>

==References== ==References==
{{reflist}} {{reflist}}


{{Saponins}}
]
{{Tetracyclics}}

]
] ]