| Revision as of 11:58, 23 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 400145489 of page Linoelaidic_acid for the Chem/Drugbox validation project (updated: 'ChEMBL', 'CASNo'). |
Latest revision as of 02:59, 4 February 2023 edit 109.241.162.167 (talk) the term 'geometric isomer' is obsolete and its usage is strongly discouraged by IUPAC |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
|
| verifiedrevid = 400143251 |
|
| verifiedrevid = 462091801 |
|
| Reference=<ref> at Sigma-Aldrich</ref> |
|
|
|
| Reference =<ref> at chemexper.com</ref><ref> at pubchem.ncbi.nlm.nih.gov</ref> |
|
| ImageFile = Linoelaidic acid.png |
|
| ImageFile = Linoelaidic acid.png |
|
| ImageSize = 250px |
|
| ImageSize = 250px |
|
| Name = Linoelaidic acid |
|
| Name = Linolelaidic acid |
|
| IUPACName = (9''E'',12''E'')-octadeca-9,12-dienoic acid |
|
| IUPACName = (9''E'',12''E'')-Octadeca-9,12-dienoic acid |
|
| OtherNames = ''trans, trans''-9,12-octadecadienoic acid |
|
| OtherNames = ''trans'',''trans''-9,12-Octadecadienoic acid, Linoelaidic acid |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 4445609 |
|
| ChemSpiderID = 4445609 |
|
| InChI = 1/C18H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h6-7,9-10H,2-5,8,11-17H2,1H3,(H,19,20)/b7-6+,10-9+ |
|
| InChI = 1/C18H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h6-7,9-10H,2-5,8,11-17H2,1H3,(H,19,20)/b7-6+,10-9+ |
| Line 17: |
Line 17: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = OYHQOLUKZRVURQ-AVQMFFATSA-N |
|
| StdInChIKey = OYHQOLUKZRVURQ-AVQMFFATSA-N |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo = <!-- blanked - oldvalue: 506-21-8 --> |
|
|
| ChEMBL = 93204 |
|
| CASNo = 506-21-8 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 7552P0K6PN |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEMBL = 93204 |
|
| PubChem = 5282457 |
|
| PubChem = 5282457 |
|
| SMILES = O=C(O)CCCCCCC/C=C/C/C=C/CCCCC |
|
| SMILES = O=C(O)CCCCCCC/C=C/C/C=C/CCCCC |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C=18 | H=32 | O=2 |
|
| Formula = C<sub>18</sub>H<sub>32</sub>O<sub>2</sub> |
|
|
| MolarMass = 280.45 g/mol |
|
| MolarMass = 280.45 g/mol |
|
| Density = |
|
| Density = |
|
| MeltingPt = −5 °C |
|
| MeltingPtC = 28-29 |
|
|
| MeltingPt_ref = <ref>{{Cite journal | doi = 10.1021/ja01874a022| title = The Elaidinization of Linoleic Acid| journal = Journal of the American Chemical Society| volume = 61| issue = 5| pages = 1062| year = 1939| last1 = Kass| first1 = J.P.| last2 = Burr| first2 = G.O.| bibcode = 1939JAChS..61.2492E}}</ref> |
|
| BoilingPt = 229-230 °C at 16 mmHg |
|
|
|
| BoilingPtC = 229 to 230 |
|
|
| BoilingPt_notes = at 16 mmHg |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Linolelaidic acid''' is an ] ] (TFA) and is a ] of ]. It is found in partially ] vegetable oils. It is a white (or colourless) viscous liquid. |
|
|
|
|
|
TFAs are classified as conjugated and nonconjugated, corresponding usually to the structural elements {{chem2|\sCH\dCH\sCH\dCH\s}} and {{chem2|\sCH\dCH\sCH2\sCH\dCH\s}}, respectively. Nonconjugated TFAs are represented by ] and linolelaidic acid. Their presence is linked heart diseases. The TFA ], which is of animal origin, poses less of a health risk.<ref>Park, Yeonhwa "Conjugated linoleic acid (CLA): Good or bad trans fat?" Journal of Food Composition and Analysis 2009, vol. 22, S4-S12. {{doi|10.1016/j.jfca.2008.12.002}}</ref> |
|
|
|
|
|
==References== |
|
|
<references/> |
|
|
|
|
|
{{Fatty acids}} |
|
|
|
|
|
] |
|
|
] |
|
|
|
|
|
{{Organic-chem-stub}} |