| Revision as of 22:38, 18 September 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (changes to watched fields - added verified revid - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'DrugBank_Ref', 'ChEBI_Ref') per [[WP:CHEMVALID← Previous edit |
Latest revision as of 10:19, 3 April 2023 edit undoGraeme Bartlett (talk | contribs)Administrators249,771 edits added Category:Pyrazolopyrimidines using HotCat |
| (31 intermediate revisions by 21 users not shown) |
| Line 1: |
Line 1: |
|
|
{{short description|Chemical compound}} |
|
{{Drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
|
| Watchedfields = changed |
|
| Watchedfields = changed |
|
| verifiedrevid = 429936519 |
|
| verifiedrevid = 451225761 |
|
| IUPAC_name = bis-(2-{4-pyrimidin-5-yl)-benzenesulfonyl]piperazin-1-yl}-ethyl)carbonate |
|
| IUPAC_name = 5-(2-Ethoxy-5-<nowiki/>{sulfonyl}phenyl)-1-methyl-3-propyl-1,4-dihydro-7H-pyrazolopyrimidin-7-one |
|
| image = Lodenafil.png |
|
| image = Lodenafil.svg |
|
| width = 320 |
|
| width = 250 |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = Helleva |
|
| pregnancy_category = |
|
| pregnancy_category = Not for use in women |
|
| legal_status = Unscheduled |
|
| legal_status = Unscheduled |
|
| routes_of_administration = |
|
| routes_of_administration = ] |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = |
|
| bioavailability = |
|
| metabolism = |
|
| metabolism = |
|
| excretion = |
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = 398507-55-6 |
|
| CAS_number = 398507-55-6 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 29X84F932D |
|
|
| DrugBank = |
|
|
| PubChem = 4742795 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 3929995 |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=43 | H=54 | N=12 | O=9 | S=2 |
|
| C=23 | H=32 | N=6 | O=5 | S=1 |
|
|
| smiles = CCCc1c2c(c(=O)nc(2)c3cc(ccc3OCC)S(=O)(=O)N4CCN(CC4)CCO)n(n1)C |
|
| molecular_weight = 947.092 g/mol |
|
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
| smiles = Cn3nc(CCC)c(n8)c3c(=O)nc8-c5cc(ccc5OCC)S(=O)(=O)N6CCN(CC6)C(=O)N(CC7)CCN7S(=O)(=O)c(ccc2OCC)cc2-c(nc1=O)nc4c1n(C)nc4CCC |
|
|
|
| StdInChI = 1S/C23H32N6O5S/c1-4-6-18-20-21(27(3)26-18)23(31)25-22(24-20)17-15-16(7-8-19(17)34-5-2)35(32,33)29-11-9-28(10-12-29)13-14-30/h7-8,15,30H,4-6,9-14H2,1-3H3,(H,24,25,31) |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = NEYKRKVLEWKOBI-UHFFFAOYSA-N |
|
}} |
|
}} |
|
|
|
|
|
|
] |
| ⚫ |
'''Lodenafil''' is a drug belonging to a class of drugs called ], which many other erectile dysfunction drugs such as ], ], and ] also belong to. Like ] and ] it belongs to a new generation of PDE5 inhibitors. |
|
|
|
|
|
|
⚫ |
'''Lodenafil''' (also known as '''hydroxyhomosildenafil''', trade name '''Helleva''') is a drug belonging to a class of drugs called ], which many other erectile dysfunction drugs such as ], ], and ] also belong to. Like ] and ] it belongs to a new generation of PDE5 inhibitors. |
| ⚫ |
Lodenafil is formulated as a ], '''lodenafil carbonate''', which breaks down in the body to form two molecules of the active drug lodenafil. This formulation has higher oral ] than the parent drug.<ref name="pmid18593576">{{cite journal |author=Toque HA, Teixeira CE, Lorenzetti R, Okuyama CE, Antunes E, De Nucci G |title=Pharmacological characterization of a novel phosphodiesterase type 5 (PDE5) inhibitor lodenafil carbonate on human and rabbit corpus cavernosum |journal=European Journal of Pharmacology |volume=591 |issue=1–3 |pages=189–95 |year=2008 |month=September |pmid=18593576 |doi=10.1016/j.ejphar.2008.06.055 |url=}}</ref> |
|
|
|
|
|
|
⚫ |
Lodenafil is formulated as a ] in the form of the ] ], '''lodenafil carbonate''', which breaks down in the body to form two molecules of the active drug lodenafil. This formulation has higher oral ] than the parent drug.<ref name="pmid18593576">{{cite journal |vauthors=Toque HA, Teixeira CE, Lorenzetti R, Okuyama CE, Antunes E, De Nucci G |title=Pharmacological characterization of a novel phosphodiesterase type 5 (PDE5) inhibitor lodenafil carbonate on human and rabbit corpus cavernosum |journal=European Journal of Pharmacology |volume=591 |issue=1–3 |pages=189–95 |date=September 2008 |pmid=18593576 |doi=10.1016/j.ejphar.2008.06.055 |s2cid=29575687 }}</ref> |
| ⚫ |
It is manufactured by ] in ] and sold there under the brand-name Helleva <ref> Product page. Retrieved on September 16, 2009.</ref>. |
|
|
|
|
|
|
⚫ |
It is manufactured by ] in ] and sold there under the brand-name Helleva.<ref> {{webarchive|url=https://web.archive.org/web/20150315222530/http://2cristalia.com.br/lerNoticia.php?idN=776 |date=2015-03-15 }} Product page. Retrieved on September 16, 2009.</ref> |
| ⚫ |
It has undergone Phase III clinical trials,<ref> Lodenafil article. Retrieved on September 16, 2009.</ref><ref name="pmid19040623">{{cite journal |author=Glina S, Toscano I, Gomatzky C, de Góes PM, Júnior AN, Claro JF, Pagani E |title=Efficacy and tolerability of lodenafil carbonate for oral therapy in erectile dysfunction: a phase II clinical trial |journal=The Journal of Sexual Medicine |volume=6 |issue=2 |pages=553–7 |year=2009 |month=February |pmid=19040623 |doi=10.1111/j.1743-6109.2008.01079.x |url=}}</ref><ref name="pmid20214718">{{cite journal |author=Glina S, Fonseca GN, Bertero EB, Damião R, Rocha LC, Jardim CR, Cairoli CE, Teloken C, Torres LO, Faria GE, da Silva MB, Pagani E |title=Efficacy and Tolerability of Lodenafil Carbonate for Oral Therapy of Erectile Dysfunction: A Phase III Clinical Trial |journal=The Journal of Sexual Medicine |volume= 7|issue= 5|pages= 1928–1936|year=2010 |month=February |pmid=20214718 |doi=10.1111/j.1743-6109.2010.01711.x |url=}}</ref> but is not yet approved for use in the ] by the ]. |
|
|
|
|
|
|
⚫ |
It has undergone Phase III clinical trials,<ref name="pmid19040623">{{cite journal |vauthors=Glina S, Toscano I, Gomatzky C, de Góes PM, Júnior AN, Claro JF, Pagani E |title=Efficacy and tolerability of lodenafil carbonate for oral therapy in erectile dysfunction: a phase II clinical trial |journal=The Journal of Sexual Medicine |volume=6 |issue=2 |pages=553–7 |date=February 2009 |pmid=19040623 |doi=10.1111/j.1743-6109.2008.01079.x }}</ref><ref name="pmid20214718">{{cite journal |vauthors=Glina S, Fonseca GN, Bertero EB, Damião R, Rocha LC, Jardim CR, Cairoli CE, Teloken C, Torres LO, Faria GE, da Silva MB, Pagani E |title=Efficacy and Tolerability of Lodenafil Carbonate for Oral Therapy of Erectile Dysfunction: A Phase III Clinical Trial |journal=The Journal of Sexual Medicine |volume= 7|issue= 5|pages= 1928–1936|date=February 2010 |pmid=20214718 |doi=10.1111/j.1743-6109.2010.01711.x }}</ref> but is not yet approved for use in the ] by the ]. |
|
|
|
|
|
|
== See also == |
|
|
* ] |
|
|
|
|
|
== References == |
|
== References == |
|
{{Reflist}} |
|
{{Reflist}} |
|
|
|
|
|
|
{{Sexual dysfunction pharmacotherapies}} |
|
<!--- Categories ---> |
|
|
|
|
|
<references/> |
|
|
|
|
|
{{Urologicals}} |
|
|
{{Phosphodiesterase inhibitors}} |
|
{{Phosphodiesterase inhibitors}} |
|
{{Piperazines}} |
|
{{Piperazines}} |
|
|
|
|
|
] |
|
] |
|
|
] |
|
|
|
|
|
] |
|
<!--- Links to the same article in other languages - if the articles exist already --> |
|
|
|
] |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
{{genito-urinary-drug-stub}} |
|
{{genito-urinary-drug-stub}} |
|
|
|
|
] |
|