Lonazolac: Difference between revisions

Browse history interactively← Previous editContent deleted Content addedVisual Wikitext

Revision as of 04:56, 2 September 2011 editCheMoBot (talk \| contribs)Bots141,565 edits Updating {{drugbox}} (changes to watched fields - added verified revid - updated 'ChemSpiderID_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per Chem/Drugbox validation (report [[Misplaced Pages talk:Wiki← Previous edit		Latest revision as of 08:16, 9 September 2024 edit undoJWBE (talk \| contribs)Extended confirmed users10,127 edits removed Category:Chloroarenes; added Category:4-Chlorophenyl compounds using HotCat
(12 intermediate revisions by 11 users not shown)
Line 1:		Line 1:
			{{Short description\|Chemical compound}}
	{{Drugbox		{{Drugbox
			\| Verifiedfields = changed
	\| Watchedfields = changed		\| Watchedfields = changed
	\| verifiedrevid = ~~444592177~~		\| verifiedrevid = 447986412
	\| IUPAC_name = acetic acid		\| IUPAC_name = acetic acid
	\| image = lonazolac.png		\| image = lonazolac.png
Line 25:		Line 27:

	<!--Identifiers-->		<!--Identifiers-->
			\| CAS_number_Ref = {{cascite\|correct\|CAS}}
	\| CAS_number =		\| CAS_number = 53808-88-1
	\| ATC_prefix = M01		\| ATC_prefix = M01
	\| ATC_suffix = AB09		\| ATC_suffix = AB09
Line 35:		Line 38:
	\| KEGG_Ref = {{keggcite\|correct\|kegg}}		\| KEGG_Ref = {{keggcite\|correct\|kegg}}
	\| KEGG = D07265		\| KEGG = D07265
			\| ChEBI_Ref = {{ebicite\|changed\|EBI}}
			\| ChEBI = 76164
			\| ChemSpiderID_Ref = {{chemspidercite\|changed\|chemspider}}
			\| ChemSpiderID = 61957

	<!--Chemical data-->		<!--Chemical data-->
	\| C=17 \| H=13 \| Cl=1 \| N=2 \| O=2		\| C=17 \| H=13 \| Cl=1 \| N=2 \| O=2
			\| smiles = c1ccc(cc1)n2cc(c(n2)c3ccc(cc3)Cl)CC(=O)O
	\| molecular_weight = 312.75032 g/mol
			\| StdInChI_Ref = {{stdinchicite\|changed\|chemspider}}
			\| StdInChI = 1S/C17H13ClN2O2/c18-14-8-6-12(7-9-14)17-13(10-16(21)22)11-20(19-17)15-4-2-1-3-5-15/h1-9,11H,10H2,(H,21,22)
			\| StdInChIKey_Ref = {{stdinchicite\|changed\|chemspider}}
			\| StdInChIKey = XVUQHFRQHBLHQD-UHFFFAOYSA-N
	}}		}}

	'''Lonazolac''' is a ].		'''Lonazolac''' is a ] (NSAID).

			==References==
			{{Reflist\|2}}


	{{Anti-inflammatory and antirheumatic products}}		{{Anti-inflammatory and antirheumatic products}}
			{{Prostanoidergics}}
	{{NSAIDs}}

	]		]
	]		]
	]		]