| Revision as of 13:09, 18 January 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,081 edits Script assisted update of identifiers from ChemSpider, CommonChemistry and FDA for the Chem/Drugbox validation project - Updated: ChEMBL.← Previous edit |
Latest revision as of 19:57, 12 August 2023 edit undoOAbot (talk | contribs)Bots442,978 editsm Open access bot: doi added to citation with #oabot. |
| (27 intermediate revisions by 19 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{Drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 400291303 |
|
|
|
| Watchedfields = changed |
| ⚫ |
| IUPAC_name = 2--2-(2,6-dichlorophenyl)acetamide |
|
|
⚫ |
| verifiedrevid = 408580400 |
| ⚫ |
| image = Loviride.png |
|
|
⚫ |
| IUPAC_name = 2--2-(2,6-dichlorophenyl)acetamide |
|
⚫ |
| image = Loviride.svg |
|
|
| width = 175 |
|
|
|
|
|
<!--Clinical data--> |
|
|
| tradename = |
|
⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
⚫ |
| pregnancy_category = |
|
⚫ |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled --> |
|
⚫ |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
⚫ |
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
⚫ |
| legal_status = |
|
⚫ |
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
⚫ |
| bioavailability = |
|
⚫ |
| protein_bound = |
|
⚫ |
| metabolism = |
|
⚫ |
| elimination_half-life = |
|
⚫ |
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|changed|CAS}} |
|
⚫ |
| CAS_number = 147362-57-0 |
|
⚫ |
| ATC_prefix = None |
|
⚫ |
| ATC_suffix = |
|
⚫ |
| ATC_supplemental = |
|
⚫ |
| PubChem = 3963 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
⚫ |
| DrugBank = |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 3826 |
|
| ChemSpiderID = 3826 |
|
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
| InChI = 1/C17H16Cl2N2O2/c1-9-6-7-11(10(2)22)14(8-9)21-16(17(20)23)15-12(18)4-3-5-13(15)19/h3-8,16,21H,1-2H3,(H2,20,23) |
|
|
|
| UNII = 3S1R1LZ09H |
|
| InChIKey = CJPLEFFCVDQQFZ-UHFFFAOYAQ |
|
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
| ⚫ |
| smiles = Clc1cccc(Cl)c1C(Nc2cc(ccc2C(=O)C)C)C(=O)N |
|
|
⚫ |
| KEGG = D04786 |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 37624 |
|
| ChEMBL = 37624 |
|
|
|
|
|
<!--Chemical data--> |
|
⚫ |
| C=17 | H=16 | Cl=2 | N=2 | O=2 |
|
⚫ |
| smiles = Clc1cccc(Cl)c1C(Nc2cc(ccc2C(=O)C)C)C(=O)N |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C17H16Cl2N2O2/c1-9-6-7-11(10(2)22)14(8-9)21-16(17(20)23)15-12(18)4-3-5-13(15)19/h3-8,16,21H,1-2H3,(H2,20,23) |
|
| StdInChI = 1S/C17H16Cl2N2O2/c1-9-6-7-11(10(2)22)14(8-9)21-16(17(20)23)15-12(18)4-3-5-13(15)19/h3-8,16,21H,1-2H3,(H2,20,23) |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = CJPLEFFCVDQQFZ-UHFFFAOYSA-N |
|
| StdInChIKey = CJPLEFFCVDQQFZ-UHFFFAOYSA-N |
|
|
| synonyms = R089439; loveride{{Citation needed|date=February 2010}} |
| ⚫ |
| CAS_number = |
|
|
| CAS_supplemental = |
|
| ⚫ |
| ATC_prefix = none |
|
| ⚫ |
| ATC_suffix = |
|
| ⚫ |
| ATC_supplemental = |
|
| ⚫ |
| PubChem = 3963 |
|
| ⚫ |
| DrugBank = |
|
| ⚫ |
| KEGG = D04786 |
|
|
| synonyms = R089439 |
|
| ⚫ |
| C=17 | H=16 | Cl=2 | N=2 | O=2 |
|
|
| molecular_weight = 351.227 g/mol |
|
| ⚫ |
| bioavailability = |
|
| ⚫ |
| protein_bound = |
|
| ⚫ |
| metabolism = |
|
| ⚫ |
| elimination_half-life = |
|
| ⚫ |
| excretion = |
|
| ⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| ⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| ⚫ |
| pregnancy_category= |
|
| ⚫ |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
| ⚫ |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| ⚫ |
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
| ⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| ⚫ |
| legal_status = |
|
| ⚫ |
| routes_of_administration = |
|
|
}} |
|
}} |
|
|
|
|
|
'''Loviride''' (also called '''Loveride'''{{Citation needed|date=February 2010}}) was an antiviral drug manufactured by ] (now part of ]) that is active against ]. Loviride is an ] that entered phase III clinical trials in the late 1990s but failed to gain marketing approval because of poor potency. It is of clinical significance only in those patients who were enrolled in clinical trials to evaluate loviride (e.g., CAESAR and AVANTI), because in those trials Loviride was often given alone and with no companion drug, leading to a high probability of developing ] mutations such as K103N which result in cross-class resistance to all NNRTI's. |
|
'''Loviride''' is an experimental antiviral drug manufactured by ] (now part of ]) that is active against ]. Loviride is a ] that entered ] clinical trials in the late 1990s, but failed to gain marketing approval because of poor potency.<ref>{{cite web | url = http://www.aidsmap.com/cms1032278.asp | title = Loviride | website = aidsmap.com | archive-url = https://web.archive.org/web/20070927192511/http://www.aidsmap.com/cms1032278.asp | archive-date = 2007-09-27 }}</ref> It is of clinical significance only in those patients who were enrolled in clinical trials to evaluate loviride (e.g., CAESAR<ref>{{cite journal | vauthors = Kroon ED, Wit FW | collaboration = CAESAR Coordinating Committee | doi = 10.1016/S0140-6736(97)04441-3 | title = Randomised trial of addition of lamivudine or lamivudine plus loviride to zidovudine-containing regimens for patients with HIV-1 infection: The CAESAR trial | journal = The Lancet | year = 1997 | volume = 349 | issue = 9063 | pages = 1413–1421 | s2cid = 20008082 | url = https://dare.uva.nl/personal/pure/en/publications/randomised-trial-of-addition-of-lamivudine-or-lamivudine-plus-loviride-to-zidovudinecontaining-regimens-for-patients-with-hiv1-infection-the-caesar-trial(60592251-8bcd-4787-8c25-b7115864937b).html }}</ref> and AVANTI<ref>{{cite journal | vauthors = Gatell J, Lange J, Gartland M | title = AVANTI 1: randomized, double-blind trial to evaluate the efficacy and safety of zidovudine plus lamivudine versus zidovudine plus lamivudine plus loviride in HIV-infected antiretroviral-naive patients. AVANTI Study Group | journal = Antiviral Therapy | volume = 4 | issue = 2 | pages = 79–86 | year = 1999 | pmid = 10682152 | doi = 10.1177/135965359900400204 | s2cid = 22443598 | doi-access = free }}</ref>), because in those trials loviride was often given alone and with no companion drug, leading to a high probability of developing ] mutations such as K103N which result in cross-class resistance to the NNRTIs ] and ]. |
|
|
<!-- This graphic is pointless without at least some description, explanation, or context |
|
|
==Synthesis== |
|
|
] {{US patent|5407961}} (1995).]]--> |
|
|
|
|
|
==External links== |
|
== References == |
|
|
{{reflist}} |
|
* |
|
|
|
|
|
|
{{HIVpharm}} |
|
{{HIVpharm}} |
|
|
|
|
|
] |
|
] |
| ⚫ |
] |
|
|
] |
|
] |
|
⚫ |
] |
|
] |
|
] |
|
|
] |
|
|
|
|
|
|
|
|
{{antimicrobial-stub}} |
|
{{antimicrobial-stub}} |