| Revision as of 12:27, 23 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 456544545 of page Lufenuron for the Chem/Drugbox validation project (updated: 'KEGG', 'CASNo'). |
Latest revision as of 21:21, 8 June 2024 edit 2600:1700:14d0:9670:5da6:2147:14cf:afe6 (talk)No edit summary |
| Line 1: |
Line 1: |
|
|
{{Chembox |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
| Watchedfields = changed |
|
|
| verifiedrevid = 462094340 |
|
| UNII = 1R754M4918 |
|
|
|
| ImageFile = Lufenuron 200.svg |
|
| verifiedrevid = 400291545 |
|
|
|
| ImageSize = |
|
| ImageFile = Lufenuron.png |
|
|
| ImageSize = |
|
|
| ImageFile2 = Lufenuron-3D-balls.png |
|
| ImageFile2 = Lufenuron-3D-balls.png |
|
| ImageSize2 = |
|
| ImageSize2 = |
|
| IUPACName = 1--3-(2,6-difluorobenzoyl)urea |
|
| IUPACName = 1--3-(2,6-difluorobenzoyl)urea |
|
| OtherNames = ''N''-amino]carbonyl]-2,6-difluorobenzamide<br />Fluphenacur<br />U.S. EPA PC Code: 118205 |
|
| OtherNames = ''N''-<nowiki>amino]carbonyl]-2,6-difluorobenzamide<br />Fluphenacur<br />U.S. EPA PC Code: 118205 |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| Abbreviations = |
|
|
|
| UNII = 1R754M4918 |
|
|
| Abbreviations = |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 64813 |
|
| ChemSpiderID = 64813 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 1364906 |
|
| InChI = 1/C17H8Cl2F8N2O3/c18-6-5-11(32-17(26,27)14(22)16(23,24)25)7(19)4-10(6)28-15(31)29-13(30)12-8(20)2-1-3-9(12)21/h1-5,14H,(H2,28,29,30,31) |
|
| InChI = 1/C17H8Cl2F8N2O3/c18-6-5-11(32-17(26,27)14(22)16(23,24)25)7(19)4-10(6)28-15(31)29-13(30)12-8(20)2-1-3-9(12)21/h1-5,14H,(H2,28,29,30,31) |
|
| InChIKey = PWPJGUXAGUPAHP-UHFFFAOYAQ |
|
| InChIKey = PWPJGUXAGUPAHP-UHFFFAOYAQ |
| Line 21: |
Line 23: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = PWPJGUXAGUPAHP-UHFFFAOYSA-N |
|
| StdInChIKey = PWPJGUXAGUPAHP-UHFFFAOYSA-N |
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo_Ref = {{cascite|changed|??}} |
|
| CASNo = <!-- blanked - oldvalue: 103055-07-8 --> |
|
| CASNo = 103055-07-8 |
|
| EINECS = |
|
| EINECS = |
|
| PubChem = 71777 |
|
| PubChem = 71777 |
|
| SMILES = Clc1cc(c(Cl)cc1OC(F)(F)C(F)C(F)(F)F)NC(=O)NC(=O)c2c(F)cccc2F |
|
| SMILES = Clc1cc(c(Cl)cc1OC(F)(F)C(F)C(F)(F)F)NC(=O)NC(=O)c2c(F)cccc2F |
|
| InChI = |
|
|
| RTECS = |
|
| RTECS = |
|
| MeSHName = |
|
| MeSHName = |
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI = 39384 |
|
| ChEBI = 39384 |
|
| KEGG_Ref = {{keggcite|changed|kegg}} |
|
| KEGG_Ref = {{keggcite|changed|kegg}} |
|
| KEGG = <!-- blanked - oldvalue: D08150 --> |
|
| KEGG = D08150 |
|
|
}} |
|
|
|Section2={{Chembox Properties |
|
|
| C=17 | H=8 | Cl=2 | F=8 | N=2 | O=3 |
|
|
| Appearance = |
|
|
| Density = |
|
|
| MeltingPtC = 174 |
|
|
| MeltingPt_notes = |
|
|
| BoilingPt = |
|
|
| BoilingPt_notes = |
|
|
| Solubility = |
|
|
| SolubleOther = |
|
|
| Solvent = |
|
|
| pKa = |
|
|
| pKb = |
|
|
}} |
|
|
|Section6={{Chembox Pharmacology |
|
| ATCvet = yes |
|
| ATCvet = yes |
|
| ATCCode_prefix = P53 |
|
| ATCCode_prefix = P53 |
|
| ATCCode_suffix = BC01 |
|
| ATCCode_suffix = BC01 |
|
| ATC_Supplemental =}} |
|
|
| Section2 = {{Chembox Properties |
|
|
| Formula = C<sub>17</sub>H<sub>8</sub>Cl<sub>2</sub>F<sub>8</sub>N<sub>2</sub>O<sub>3</sub> |
|
|
| MolarMass = 511.15 g/mol |
|
|
| Appearance = |
|
|
| Density = |
|
|
| MeltingPtC = 174 |
|
|
| Melting_notes = |
|
|
| BoilingPt = |
|
|
| Boiling_notes = |
|
|
| Solubility = |
|
|
| SolubleOther = |
|
|
| Solvent = |
|
|
| pKa = |
|
|
| pKb = }} |
|
|
| Section7 = {{Chembox Hazards |
|
|
| EUClass = |
|
|
| EUIndex = |
|
|
| MainHazards = |
|
|
| NFPA-H = |
|
|
| NFPA-F = |
|
|
| NFPA-R = |
|
|
| NFPA-O = |
|
|
| RPhrases = |
|
|
| SPhrases = |
|
|
| RSPhrases = |
|
|
| FlashPt = |
|
|
| Autoignition = |
|
|
| ExploLimits = |
|
|
| PEL = }} |
|
|
}} |
|
}} |
|
|
|Section7={{Chembox Hazards |
|
|
| MainHazards = |
|
|
| NFPA-H = |
|
|
| NFPA-F = |
|
|
| NFPA-R = |
|
|
| NFPA-S = |
|
|
| FlashPt = |
|
|
| AutoignitionPt = |
|
|
| ExploLimits = |
|
|
| PEL = |
|
|
}} |
|
|
}} |
|
|
|
|
|
'''Lufenuron''' is the ] in the ] ] control medication Program, and one of the two active ingredients in the flea, ], and ] medicine ] (Sentinel). |
|
|
|
|
|
Lufenuron is stored in the animal's body ] and transferred to adult fleas through the host's blood when they feed. Adult fleas transfer it to their growing eggs through their blood, and to hatched larvae feeding on their excrement. It does not kill adult fleas.{{citation needed|date=April 2016}} |
|
|
|
|
|
Lufenuron, a ] pesticide, inhibits the production of ] in insects. Without chitin, a larval flea will never develop a hard outer shell (]). With its inner organs exposed to air, the insect dies from dehydration soon after hatching or molting (shedding its old, smaller shell).{{citation needed|date=April 2016}} |
|
|
|
|
|
Lufenuron is also used to fight ] infections, since fungus cell walls are about one third chitin.<ref>{{cite journal |last1=Ben-Ziony |first1=Yair |last2=Arzi |first2=Boaz |title=Use of lufenuron for treating fungal infections of dogs and cats: 297 cases (1997-1999) |journal=Journal of the American Veterinary Medical Association |volume=217 |issue=10 |pages=1510–3 |year=2000 |pmid=11128542 |doi=10.2460/javma.2000.217.1510 }}</ref> |
|
|
|
|
|
Lufenuron is also sold as an agricultural pesticide for use against ]ns, eriophyid ], and ]. It is an effective antifungal in plants.<ref>{{cite book |title=The Pesticide Encyclopedia |author1=Paranjape, Kalyani |author2=Gowariker, Vasant |author3=Krishnamurthy, V N |ISBN=978-1-78064-014-3 |publisher=CABI |location=Wallingford, Oxfordshire UK Boston, MA |year=2014 |page=283 |url=https://books.google.com/books?id=cnDHBgAAQBAJ&pg=PA283 |quote=Lufenuron, a chitin synthesis inhibitor, is an effective agent against lepidopteran members in crops, eriophid mites and western flower thrips. In non-crop situations too, lufenuron is effective against fleas on animals and on cockroaches in households. This chemical also acts as an anti-fungal agent in plants. ... According to the WHO, lufenuron is a Class III toxin (slightly hazardous). It is safe on mammals, since it is not broken down by the liver or kidneys. |access-date=Nov 22, 2018 }}</ref> |
|
|
|
|
|
== References == |
|
|
{{reflist}} |
|
|
|
|
|
==External links== |
|
|
* {{PPDB|420}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |