Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Luminespib: Difference between pages - Misplaced Pages

Article snapshot taken from[REDACTED] with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
(Difference between pages)
Page 1
Page 2
Content deleted Content addedVisualWikitext
Revision as of 13:30, 24 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{chembox}} taken from revid 457300756 of page NVP-AUY922 for the Chem/Drugbox validation project (updated: 'ChEMBL', 'StdInChI', 'StdInChIKey', 'CASNo').  Latest revision as of 00:26, 3 December 2023 edit Citation bot (talk | contribs)Bots5,459,267 edits Add: doi-access. | Use this bot. Report bugs. | Suggested by Corvus florensis | #UCB_webform 369/2499 
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}}
{{Chembox {{Chembox
| Verifiedfields = changed
| ImageFile = NVP-AUY 922.svg
| Watchedfields = changed
| verifiedrevid = 462257909
| ImageFile = Luminespib.svg
| ImageSize = 200px | ImageSize = 200px
| IUPACName = 5-(2,4-dihydroxy-5-isopropyl-phenyl)-N-ethyl-4-isoxazole-3-carboxamide | PIN = 5--''N''-ethyl-4-{4-phenyl}-1,2-oxazole-3-carboxamide
| OtherNames = NVP-AUY-922; AUY922; VER-52296 | OtherNames = NVP-AUY-922; AUY922; VER-52296

| Section1 = {{Chembox Identifiers | Section1 = {{Chembox Identifiers
| CASNo = <!-- blanked - oldvalue: 747412-49-3 --> | CASNo = 747412-49-3
| CASNo_Ref = {{cascite|correct|CAS}} | CASNo_Ref = {{cascite|changed|??}}
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 252164
| ChEBI = 83656
| StdInChI = 1S/C26H31N3O5/c1-4-27-26(32)24-23(18-7-5-17(6-8-18)15-29-9-11-33-12-10-29)25(34-28-24)20-13-19(16(2)3)21(30)14-22(20)31/h5-8,13-14,16,30-31H,4,9-12,15H2,1-3H3,(H,27,32)
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| StdInChIKey = NDAZATDQFDPQBD-UHFFFAOYSA-N
| PubChem = | ChEMBL = 252164
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| ChemSpiderID = 21377936
| StdInChI = 1S/C26H31N3O5/c1-4-27-26(32)24-23(18-7-5-17(6-8-18)15-29-9-11-33-12-10-29)25(34-28-24)20-13-19(16(2)3)21(30)14-22(20)31/h5-8,13-14,16,30-31H,4,9-12,15H2,1-3H3,(H,27,32)
| SMILES = CC(C)c1cc(c(O)cc1O)c2onc(C(=O)NCC)c2c3ccc(cc3)CN4CCOCC4
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| InChI = InChI=1S/C26H31N3O5/c1-4-27-26(32)24-23(18-7-5-17(6-8-18)15-29-9-11-33-12-10-29)25(34-28-24)20-13-19(16(2)3)21(30)14-22(20)31/h5-8,13-14,16,30-31H,4,9-12,15H2,1-3H3,(H,27,32)
| StdInChIKey = NDAZATDQFDPQBD-UHFFFAOYSA-N
| PubChem = 135539077
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 21377936
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D10646
| UNII = C6V1DAR5EB
| DrugBank = DB11881
| SMILES = CC(C)c1cc(c(O)cc1O)c2onc(C(=O)NCC)c2c3ccc(cc3)CN4CCOCC4
| InChI = InChI=1S/C26H31N3O5/c1-4-27-26(32)24-23(18-7-5-17(6-8-18)15-29-9-11-33-12-10-29)25(34-28-24)20-13-19(16(2)3)21(30)14-22(20)31/h5-8,13-14,16,30-31H,4,9-12,15H2,1-3H3,(H,27,32)
}} }}

| Section2 = {{Chembox Properties | Section2 = {{Chembox Properties
| C=26|H=31|N=3|O=5 | C=26 | H=31 | N=3 | O=5
| Appearance = Colorless solid<ref name=Brough>{{cite journal | doi = 10.1021/jm701018h | title = 4,5-Diarylisoxazole Hsp90 Chaperone Inhibitors: Potential Therapeutic Agents for the Treatment of Cancer | year = 2008 | last1 = Brough | first1 = Paul A. | last2 = Aherne | first2 = Wynne | last3 = Barril | first3 = Xavier | last4 = Borgognoni | first4 = Jenifer | last5 = Boxall | first5 = Kathy | last6 = Cansfield | first6 = Julie E. | last7 = Cheung | first7 = Kwai-Ming J. | last8 = Collins | first8 = Ian | last9 = Davies | first9 = Nicholas G. M. | journal = Journal of Medicinal Chemistry | volume = 51 | issue = 2 | pages = 196–218 | pmid = 18020435}}</ref> | Appearance = Colorless solid<ref name=Brough>{{cite journal | doi = 10.1021/jm701018h | title = 4,5-Diarylisoxazole Hsp90 Chaperone Inhibitors: Potential Therapeutic Agents for the Treatment of Cancer | year = 2008 | last1 = Brough | first1 = Paul A. | last2 = Aherne | first2 = Wynne | last3 = Barril | first3 = Xavier | last4 = Borgognoni | first4 = Jenifer | last5 = Boxall | first5 = Kathy | last6 = Cansfield | first6 = Julie E. | last7 = Cheung | first7 = Kwai-Ming J. | last8 = Collins | first8 = Ian | last9 = Davies | first9 = Nicholas G. M. | journal = Journal of Medicinal Chemistry | volume = 51 | issue = 2 | pages = 196–218 | pmid = 18020435 | url = https://figshare.com/articles/4_5_Diarylisoxazole_Hsp90_Chaperone_Inhibitors_Potential_Therapeutic_Agents_for_the_Treatment_of_Cancer/2961214 }}</ref>
| Density = | Density =
| MeltingPt = | MeltingPt =
| BoilingPt = | BoilingPt =
| Solubility = | Solubility =
}} }}

| Section3 = {{Chembox Hazards | Section3 = {{Chembox Hazards
| MainHazards = | MainHazards =
| FlashPt = | FlashPt =
| AutoignitionPt =
| Autoignition =
}} }}
}} }}

'''Luminespib''' (],<ref>{{cite web|title=WHO Drug Information. International Nonproprietary Names for Pharmaceutical Substances (INN). Recommended International Nonproprietary Names: List 70|url=https://www.who.int/medicines/publications/druginformation/innlists/RL70.pdf|publisher=World Health Organization|access-date=16 July 2016|pages=297–8}}</ref> previously known as '''NVP-AUY922''') is an experimental drug candidate for the treatment of cancer. It was discovered through a collaboration between The ] and the pharmaceutical company ]<ref>{{cite web | url = http://www.icr.ac.uk/about_us/annual_research_report/9719.pdf | title = Structure-based design of cancer therapeutics | publisher = The Institute of Cancer Research | access-date = 2011-10-25 | archive-url = https://web.archive.org/web/20110625222638/http://icr.ac.uk/about_us/annual_research_report/9719.pdf | archive-date = 2011-06-25 | url-status = dead }}</ref> and licensed to ].<ref>{{cite web|url=http://www.vernalis.com/development/oncology/auy922 |title=AUY922 |publisher=Vernalis |url-status=dead|archive-url=https://web.archive.org/web/20110929015547/http://www.vernalis.com/development/oncology/auy922 |archive-date=2011-09-29 }}</ref> From 2011 to 2014 it was in Phase II clinical trials.<ref>{{cite news | url = http://www.ft.com/intl/cms/s/0/715446aa-b219-11e0-9d80-00144feabdc0.html#axzz1TL06XsgO | title = Small caps: Vernalis drug fillip | newspaper = Financial Times | date = July 19, 2011}}</ref><ref name=Sidera2014rev>{{cite journal |author1=Sidera, K. |author2=Patsavoudi, E. | title = HSP90 inhibitors: current development and potential in cancer therapy. | journal = Recent Patents on Anti-Cancer Drug Discovery| volume = 9 | issue = 1 | pages = 1–20 |date=Jan 2014 | pmid = 23312026 | doi = 10.2174/15748928113089990031 }}</ref> Chemically it is a ] isoxazole amide<ref name=Sidera2014rev/>

Luminespib is an ] of ] (Hsp90),<ref name=Brough/> which is a chaperone protein that plays a role in the modification of a variety of proteins that have been implicated in ]. Luminespib has shown promising activity in preclinical testing against several different tumor types.<ref>{{cite journal | doi = 10.1186/bcr1996 | title = NVP-AUY922: a small molecule HSP90 inhibitor with potent antitumor activity in preclinical breast cancer models | year = 2008 | last1 = Jensen | first1 = Michael | last2 = Schoepfer | first2 = Joseph | last3 = Radimerski | first3 = Thomas | last4 = Massey | first4 = Andrew | last5 = Guy | first5 = Chantale T | last6 = Brueggen | first6 = Josef | last7 = Quadt | first7 = Cornelia | last8 = Buckler | first8 = Alan | last9 = Cozens | first9 = Robert | journal = Breast Cancer Research | volume = 10 | issue = 2 | pages = R33 | pmid = 18430202 | pmc = 2397535 | doi-access = free }}</ref><ref>{{cite journal | doi = 10.1158/1535-7163.MCT-09-0683 | title = Mechanistic Evaluation of the Novel HSP90 Inhibitor NVP-AUY922 in Adult and Pediatric Glioblastoma | year = 2010 | last1 = Gaspar | first1 = N. | last2 = Sharp | first2 = S. Y. | last3 = Eccles | first3 = S. A. | last4 = Gowan | first4 = S. | last5 = Popov | first5 = S. | last6 = Jones | first6 = C. | last7 = Pearson | first7 = A. | last8 = Vassal | first8 = G. | last9 = Workman | first9 = P. | journal = Molecular Cancer Therapeutics | volume = 9 | issue = 5 | pages = 1219–1233 | pmid = 20457619 | pmc = 2875164 }}</ref><ref>{{cite journal | pmid = 21508365 | year = 2011 | last1 = Okui | first1 = T | last2 = Shimo | first2 = T | last3 = Hassan | first3 = NM | last4 = Fukazawa | first4 = T | last5 = Kurio | first5 = N | last6 = Takaoka | first6 = M | last7 = Naomoto | first7 = Y | last8 = Sasaki | first8 = A | title = Antitumor effect of novel HSP90 inhibitor NVP-AUY922 against oral squamous cell carcinoma | volume = 31 | issue = 4 | pages = 1197–204 | journal = Anticancer Research }}</ref><ref>{{cite journal | doi = 10.1158/0008-5472.CAN-07-5256 | title = NVP-AUY922: A Novel Heat Shock Protein 90 Inhibitor Active against Xenograft Tumor Growth, Angiogenesis, and Metastasis | year = 2008 | last1 = Eccles | first1 = S. A. | last2 = Massey | first2 = A. | last3 = Raynaud | first3 = F. I. | last4 = Sharp | first4 = S. Y. | last5 = Box | first5 = G. | last6 = Valenti | first6 = M. | last7 = Patterson | first7 = L. | last8 = De Haven Brandon | first8 = A. | last9 = Gowan | first9 = S. | journal = Cancer Research | volume = 68 | issue = 8 | pages = 2850–2860 | pmid = 18413753 | doi-access = free }}</ref>

A related compound, NVP-HSP990, was abandoned by Novartis in 2012 after it failed to show efficacy in an early clinical trial.<ref name=Sidera2014rev/>

==See also==
* ]s

==References==
{{reflist}}

]
]
]
]
]


{{antineoplastic-drug-stub}}
Misplaced Pages:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Luminespib: Difference between pages Add topic