Revision as of 01:16, 31 July 2011 editArcadian (talk | contribs)163,050 edits removed Category:Oncology; added Category:Carcinogenesis using HotCat← Previous edit |
Latest revision as of 12:13, 12 July 2024 edit undoCitation bot (talk | contribs)Bots5,427,474 edits Added bibcode. | Use this bot. Report bugs. | Suggested by Abductive | Category:Carcinogenesis | #UCB_Category 8/44 |
(18 intermediate revisions by 13 users not shown) |
Line 1: |
Line 1: |
|
{{DISPLAYTITLE:M<sub>1</sub>G}} |
|
{{DISPLAYTITLE:M<sub>1</sub>G}} |
|
{{chembox |
|
{{chembox |
|
|
| Name = M<sub>1</sub>G |
⚫ |
| verifiedrevid = 373444032 |
|
|
|
| Verifiedfields = changed |
⚫ |
| ImageFile = DNA-adduct M1G.png |
|
|
|
| Watchedfields = changed |
|
| ImageSize = |
|
|
⚫ |
| verifiedrevid = 442286189 |
⚫ |
| IUPACName = pyrimidopurin-10(''3H'')-one |
|
|
⚫ |
| ImageFile = File:M1G V2.png |
|
| OtherNames = |
|
|
⚫ |
| IUPACName = Pyrimidopurin-10(''3H'')-one |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
⚫ |
| CASNo=103408-45-3 |
|
|
|
| CASNo_Ref = {{cascite|correct|??}} |
⚫ |
| PubChem=124218 |
|
|
⚫ |
| CASNo=103408-45-3 |
⚫ |
| SMILES=C1=CN2C(=O)C3=C(N=CN3)N=C2N=C1 |
|
|
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
|
| UNII = M1G1G9A3TZ |
|
⚫ |
| PubChem=124218 |
|
⚫ |
| SMILES=C1=CN2C(=O)C3=C(N=CN3)N=C2N=C1 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 110673 |
|
|
| InChI = 1/C8H5N5O/c14-7-5-6(11-4-10-5)12-8-9-2-1-3-13(7)8/h1-4H,(H,10,11) |
|
|
| InChIKey = ZREGNVKUSNORFO-UHFFFAOYAI |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C8H5N5O/c14-7-5-6(11-4-10-5)12-8-9-2-1-3-13(7)8/h1-4H,(H,10,11) |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = ZREGNVKUSNORFO-UHFFFAOYSA-N |
|
|
| RTECS = |
|
|
| MeSHName = C107643 |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C=8 | H=5 | N=5 | O=1 |
|
| Formula=C<sub>8</sub>H<sub>5</sub>N<sub>5</sub>O |
|
|
|
| Appearance= |
|
| MolarMass=187.1582 |
|
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
|
}} |
|
}} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
⚫ |
'''M<sub>1</sub>G''' (pyrimido<nowiki></nowiki>purin-10(''3H'')-one) is a ] which is a ] of ] (BER) of a specific type of ] called M<sub>1</sub>dG. The M<sub>1</sub>dG adduct in turn is formed by a ] between ] nucleotides in DNA and either ]<ref name="martnett">{{cite journal | author = Marnett LJ | title = Lipid peroxidation-DNA damage by malondialdehyde | journal = Mutat. Res. | volume = 424 | issue = 1-2 | pages = 83–95 | year = 1999 | pmid = 10064852 | doi = 10.1016/S0027-5107(99)00010-X | url = | issn = }}</ref> or base ].<ref name="seto">{{cite journal | author = Seto H, Okuda T, Takesue T, Ikemura T | title = Reaction of Malonaldehyde with Nucleic Acid. I. Formation of Fluorescent Pyrimidopurin-10(3H)-one Nucleosides | journal = Bulletin of the Chemical Society of Japan | volume = 56 | issue = 6 | pages = 1799–1802 | year = 1983 | pmid = | doi = 10.1246/bcsj.56.1799 | url = | issn = }}</ref> If not repaired, these adducts are ] and ]. |
|
|
|
|
|
|
⚫ |
'''M<sub>1</sub>G''' ('''pyrimidopurin-10(''3H'')-one''') is a ] which is a ] of ] (BER) of a specific type of ] called M<sub>1</sub>dG. The M<sub>1</sub>dG adduct in turn is formed by a ] between ] nucleotides in ] and either ] (propanedial) <ref name="martnett">{{cite journal | author = Marnett LJ | title = Lipid peroxidation-DNA damage by malondialdehyde | journal = Mutat. Res. | volume = 424 | issue = 1–2 | pages = 83–95 | year = 1999 | pmid = 10064852 | doi = 10.1016/S0027-5107(99)00010-X | bibcode = 1999MRFMM.424...83M }}</ref> or ].<ref name="seto">{{cite journal |vauthors=Seto H, Okuda T, Takesue T, Ikemura T | title = Reaction of Malonaldehyde with Nucleic Acid. I. Formation of Fluorescent Pyrimidopurin-10(3H)-one Nucleosides | journal = Bulletin of the Chemical Society of Japan | volume = 56 | issue = 6 | pages = 1799–1802 | year = 1983 | doi = 10.1246/bcsj.56.1799 | doi-access = free }}</ref> If not repaired, these adducts are ]ic and ]ic. |
⚫ |
Malondialdehyde is an end product of ]<ref name="seto"/> while base propenal is a result of DNA peroxidation.<ref name="pmid17311424">{{cite journal | author = Knutson CG, Akingbade D, Crews BC, Voehler M, Stec DF, Marnett LJ | title = Metabolism in vitro and in vivo of the DNA base adduct, M1G | journal = Chem. Res. Toxicol. | volume = 20 | issue = 3 | pages = 550–7 | year = 2007 | month = March | pmid = 17311424 | doi = 10.1021/tx600334x | url = | issn = }}</ref> |
|
|
|
|
|
|
⚫ |
Malondialdehyde is an end product of ]<ref name="seto"/> while ] is a result of DNA peroxidation.<ref name="pmid17311424">{{cite journal |vauthors=Knutson CG, Akingbade D, Crews BC, Voehler M, Stec DF, Marnett LJ | title = Metabolism in vitro and in vivo of the DNA base adduct, M1G | journal = Chem. Res. Toxicol. | volume = 20 | issue = 3 | pages = 550–7 |date=March 2007 | pmid = 17311424 | doi = 10.1021/tx600334x | doi-access = free }}</ref> |
⚫ |
M<sub>1</sub>dG is the major ] DNA adduct in humans. M<sub>1</sub>dG adducts have been detected in cell DNA in ], ], ] and ] in concentrations of 1-120 per 10<sup>8</sup> ].<ref name="martnett"/> Detection and quantification of M<sub>1</sub>dG adducts in the body as measured by free M<sub>1</sub>G is a tool for detecting DNA damage that may lead to cancer. Free M<sub>1</sub>G is also ] for ].<ref name="martnett"/> |
|
|
|
|
|
⚫ |
M<sub>1</sub>dG is the major ] DNA adduct in humans. M<sub>1</sub>dG adducts have been detected in cell DNA in ], ], ] and ] in concentrations of 1-120 per 10<sup>8</sup> ].<ref name="martnett"/> Detection and quantification of M<sub>1</sub>dG adducts in the body as measured by free M<sub>1</sub>G is a tool for detecting DNA damage that may lead to cancer. Free M<sub>1</sub>G is also ] for ].<ref name="martnett"/> |
|
|
|
|
|
==References== |
|
==References== |
Line 38: |
Line 52: |
|
* {{MeshName|pyrimido(1,2-a)purin-10(3H)-one}} |
|
* {{MeshName|pyrimido(1,2-a)purin-10(3H)-one}} |
|
* {{MeshName|3-(2'-deoxy-beta-D-erythro-pentofuranosyl)pyrimido(1,2-alpha)purin-10(3H)-one}} |
|
* {{MeshName|3-(2'-deoxy-beta-D-erythro-pentofuranosyl)pyrimido(1,2-alpha)purin-10(3H)-one}} |
|
|
|
|
|
|
|
{{biochemistry-stub}} |
|
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
] |
|