Revision as of 19:18, 11 September 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per [[WP:CHEMVALID|Chem/Drugbox validation← Previous edit |
Latest revision as of 20:56, 23 September 2024 edit undoJWBE (talk | contribs)Extended confirmed users10,129 edits removed Category:Pyridines; added Category:4-Pyridyl compounds using HotCat |
(19 intermediate revisions by 13 users not shown) |
Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{drugbox |
|
|
|
{{Drugbox |
⚫ |
| verifiedrevid = 438696780 |
|
|
|
| Watchedfields = changed |
⚫ |
| IUPAC_name = 6-(4-methoxyphenyl)-5-methyl-3-pyridin-4-ylisoxazolopyridin-4(5H)-one |
|
|
⚫ |
| verifiedrevid = 449871472 |
⚫ |
| image = MMPIP_structure.png |
|
|
⚫ |
| IUPAC_name = 6-(4-methoxyphenyl)-5-methyl-3-pyridin-4-ylisoxazolopyridin-4(5H)-one |
⚫ |
| width = 200 |
|
|
⚫ |
| image = MMPIP_structure.png |
⚫ |
| CAS_number = |
|
|
⚫ |
| width = 200 |
⚫ |
| ATC_prefix = |
|
|
|
|
⚫ |
| ATC_suffix = |
|
|
|
<!--Clinical data--> |
⚫ |
| PubChem = |
|
|
|
| tradename = |
|
⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
⚫ |
| pregnancy_category = |
|
⚫ |
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
⚫ |
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
⚫ |
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
⚫ |
| legal_status = |
|
⚫ |
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
⚫ |
| bioavailability = |
|
|
| protein_bound = |
|
⚫ |
| metabolism = |
|
⚫ |
| elimination_half-life = |
|
⚫ |
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
⚫ |
| CAS_number = 479077-02-6 |
|
⚫ |
| ATC_prefix = |
|
⚫ |
| ATC_suffix = |
|
⚫ |
| PubChem = 9945530 |
|
|
| ChemSpiderID = 8121142 |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = |
|
| DrugBank = |
|
|
| ChEMBL = 593489 |
|
| C=19|H=19|N=3|O=3 |
|
|
|
| IUPHAR_ligand = 3341 |
|
| molecular_weight = 337.372 g/mol |
|
|
|
|
⚫ |
| smiles = COc3ccc(cc3)C2CC(C1C(=O)N2C)ON=C1c4ccncc4 |
|
|
|
<!--Chemical data--> |
⚫ |
| bioavailability = |
|
|
| protein_bound = |
|
| C=19 | H=19 | N=3 | O=3 |
|
⚫ |
| smiles = COc3ccc(cc3)C2CC(C1C(=O)N2C)ON=C1c4ccncc4 |
⚫ |
| metabolism = |
|
⚫ |
| elimination_half-life = |
|
⚫ |
| excretion = |
|
⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
⚫ |
| pregnancy_category= |
|
⚫ |
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
⚫ |
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
⚫ |
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
⚫ |
| legal_status = |
|
⚫ |
| routes_of_administration = |
|
|
}} |
|
}} |
|
|
|
|
|
'''MMPIP''' is a drug used in scientific research that acts as a selective ] for the ] subtype ].<ref name="pmid17609420">{{cite journal |author=Suzuki G, Tsukamoto N, Fushiki H, Kawagishi A, Nakamura M, Kurihara H, Mitsuya M, Ohkubo M, Ohta H |title=In vitro pharmacological characterization of novel isoxazolopyridone derivatives as allosteric metabotropic glutamate receptor 7 antagonists |journal=The Journal of Pharmacology and Experimental Therapeutics |volume=323 |issue=1 |pages=147–56 |year=2007 |month=October |pmid=17609420 |doi=10.1124/jpet.107.124701 |url=}}</ref> This receptor subtype appears to be involved in the downstream response to ] in the brain.<ref name="pmid19158667">{{cite journal |author=Li X, Li J, Peng XQ, Spiller K, Gardner EL, Xi ZX |title=Metabotropic glutamate receptor 7 modulates the rewarding effects of cocaine in rats: involvement of a ventral pallidal GABAergic mechanism |journal=Neuropsychopharmacology |volume=34 |issue=7 |pages=1783–96 |year=2009 |month=June |pmid=19158667 |doi=10.1038/npp.2008.236 |url=}}</ref> |
|
'''MMPIP''' is a drug used in scientific research that acts as a selective ] for the ] subtype ].<ref name="pmid17609420">{{cite journal |vauthors=Suzuki G, Tsukamoto N, Fushiki H, Kawagishi A, Nakamura M, Kurihara H, Mitsuya M, Ohkubo M, Ohta H |title=In vitro pharmacological characterization of novel isoxazolopyridone derivatives as allosteric metabotropic glutamate receptor 7 antagonists |journal=The Journal of Pharmacology and Experimental Therapeutics |volume=323 |issue=1 |pages=147–56 |date=October 2007 |pmid=17609420 |doi=10.1124/jpet.107.124701 |s2cid=10402176 }}</ref> This receptor subtype appears to be involved in the downstream response to ] in the brain.<ref name="pmid19158667">{{cite journal |vauthors=Li X, Li J, Peng XQ, Spiller K, Gardner EL, Xi ZX |title=Metabotropic glutamate receptor 7 modulates the rewarding effects of cocaine in rats: involvement of a ventral pallidal GABAergic mechanism |journal=Neuropsychopharmacology |volume=34 |issue=7 |pages=1783–96 |date=June 2009 |pmid=19158667 |doi=10.1038/npp.2008.236 |pmc=3739975 }}</ref> |
|
|
|
|
|
== References == |
|
==References== |
|
|
{{Reflist}} |
|
<references/> |
|
|
|
|
|
|
|
{{Metabotropic glutamate receptor modulators}} |
|
{{Glutamate_receptor_ligands}} |
|
|
|
|
|
|
] |
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
|
|
|