| Revision as of 13:38, 8 June 2011 editCydebot (talk | contribs)6,812,251 editsm Robot - Removing category Class A drugs per CFD at Misplaced Pages:Categories for discussion/Log/2011 May 31.← Previous edit |
Latest revision as of 18:15, 17 December 2023 edit undo2601:2c3:57f:2a30:2db7:7687:63ee:f92a (talk) No reference provided. |
| (27 intermediate revisions by 22 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 400293538 |
|
| verifiedrevid = 433206490 |
|
| ImageFile = Macromerine.svg |
|
| ImageFile = Macromerine.svg |
|
| ImageSize = |
|
| ImageSize = |
|
| IUPACName = 1-(3,4-dimethoxyphenyl)-2-(dimethylamino)ethanol |
|
| IUPACName = (''R'')-1-(3,4-Dimethoxyphenyl)-2-(dimethylamino)ethanol |
|
| OtherNames = |
|
| OtherNames = |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 144706 |
|
| ChemSpiderID = 144706 |
| Line 12: |
Line 13: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = YAIPYAQVBZPSSC-UHFFFAOYSA-N |
|
| StdInChIKey = YAIPYAQVBZPSSC-UHFFFAOYSA-N |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo = 2970-95-8 |
|
| CASNo = 2970-95-8 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = I2097PW32Q |
|
| PubChem = 165055 |
|
| PubChem = 165055 |
|
| SMILES = O(c1ccc(cc1OC)C(O)CN(C)C)C |
|
| SMILES = O(c1ccc(cc1OC)C(O)CN(C)C)C |
|
| InChI = 1/C12H19NO3/c1-13(2)8-10(14)9-5-6-11(15-3)12(7-9)16-4/h5-7,10,14H,8H2,1-4H3}} |
|
| InChI = 1/C12H19NO3/c1-13(2)8-10(14)9-5-6-11(15-3)12(7-9)16-4/h5-7,10,14H,8H2,1-4H3}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C=12 |
|
| Formula = C<sub>12</sub>H<sub>19</sub>NO<sub>3</sub> |
|
|
|
| H=19 |
|
| MolarMass = 225.284 g/mol |
|
|
|
| N=1 |
|
|
| O=3 |
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
| Line 24: |
Line 30: |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = }} |
|
| Solubility = }} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = }} |
|
| AutoignitionPt = }} |
|
}} |
|
}} |
|
{{Unreferenced|date=October 2008}} |
|
|
'''Macromerine''' is a ] ]. It can be synthesized or extracted from the ] (''] macromeris''), ''C. macromeris'' v. ''runyonii'', ''C. elephantidens'', and other related members of the ] family. The plants may have been used by ] ] for their entheogenic effects. |
|
|
|
|
|
|
|
'''Macromerine''' is a ] derivative. It was first identified from the cactus '']''.<ref>{{Cite journal | doi = 10.1021/jo00970a024| pmid = 5016327| title = Isolation, structure, synthesis, and absolute configuration of the cactus alkaloid, macromerine| journal = The Journal of Organic Chemistry| volume = 37| issue = 5| pages = 773–5| year = 1972| last1 = Brown| first1 = Stanley D.| last2 = Hodgkins| first2 = Joe E.| last3 = Reinecke| first3 = Manfred G.}}</ref> It can also be found in ''C. runyonii'',<ref>{{cite journal | doi = 10.1002/jps.2600570334| pmid = 5655598| title = Cactus Alkaloids IV. Macromerine from Coryphantha runyonii| journal = Journal of Pharmaceutical Sciences| volume = 57| issue = 3| pages = 515–6| year = 1968| last1 = Below| first1 = L.E.| last2 = Leung| first2 = A.Y.| last3 = Paul| first3 = A.G.| last4 = McLaughlin| first4 = J.L.}}</ref> ''C. elephantidens'', and other related members of the family ]. |
|
==Chemistry== |
|
|
Macromerine is in a family of chemicals called the phenethylamines, and it is a close ] of ]. The full chemical name of macromerine is 1-(3,4-dimethoxyphenyl)-2-(dimethylamino)ethanol. |
|
|
|
|
|
|
==Dosage== |
|
== Chemistry == |
|
|
Macromerine is a phenethylamine derivative with the molecular formula C<sub>12</sub>H<sub>19</sub>NO<sub>3</sub>. |
|
Macromerine is said to have "1/5" the potency of mescaline, so a dosage could be 1250-2500 ] based on the dosage of mescaline ]. |
|
|
|
|
|
|
==Effects== |
|
== Effects == |
|
|
At least one study found macromerine to be non-psychoactive,<ref>{{Cite journal | doi = 10.1007/BF00421429| pmid = 4711372| title = Macromerine, normacromerine and bisnormacromerine: Non-psychoactive methylated derivatives of norepinephrine| journal = Psychopharmacologia| volume = 30| issue = 2| pages = 145–51| year = 1973| last1 = Vogel| first1 = W. H.| last2 = Evans| first2 = B. D.| last3 = Bonnem| first3 = E. M.| last4 = Fischer| first4 = J. F.| last5 = McLaughlin| first5 = J. L.| s2cid = 19823706}}</ref> however as a phenethylamine derivative, it may be psychoactive. |
|
Little is known about the psychedelic effects of macromerine. ] states that a ] of macromerine-containing cactus, Doñana, "had been very mild and very strange, with many waves of intense ] and extremely persistent after effects, such as distorted vision and a very weird feeling of unreality lasting for weeks after its use." |
|
|
|
|
|
|
|
== See also == |
|
However, considering Doñana is usually no more than 0.1 percent macromerine, several pounds of the dried cactus would be required to consume a psychedelic dosage of macromerine. What is more likely is that the combination of all ]s present in the cactus produce the effects of Doñana. |
|
|
|
|
|
|
|
* ] |
|
==Legality== |
|
|
|
* ] |
|
Macromerine is not illegal in any known part of the world. |
|
|
|
|
|
|
==External links== |
|
==References== |
|
⚫ |
{{reflist}}{{Phenethylamines}} |
|
* |
|
|
* |
|
|
* |
|
|
|
|
|
|
⚫ |
] |
|
{{Hallucinogens}} |
|
|
|
] |
|
{{Serotonergics}} |
|
| ⚫ |
{{Phenethylamines}} |
|
|
|
|
| ⚫ |
] |
|
|
] |
|
|
] |
|
] |
|
|
] |