Revision as of 11:01, 3 December 2010 editBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Script assisted update of identifiers from ChemSpider, CommonChemistry and FDA for the Chem/Drugbox validation project - Updated: InChI1->InChI StdInChI StdInChIKey.← Previous edit |
Latest revision as of 00:20, 25 January 2023 edit undoEntranced98 (talk | contribs)Extended confirmed users, Pending changes reviewers, Rollbackers174,416 edits Importing Wikidata short description: "Chemical compound"Tag: Shortdesc helper |
(7 intermediate revisions by 6 users not shown) |
Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{drugbox |
|
|
|
{{Drugbox |
|
| IUPAC_name = |
|
|
|
| verifiedrevid = 400295104 |
⚫ |
| image = Magnesium pyridoxal 5-phosphate glutamate.png |
|
|
|
| IUPAC_name = (2''S'')-2,5-diamino-5-oxopentanoic acid;<br />(4-formyl-5-hydroxy-6-methylpyridin-3-yl)methyl dihydrogen phosphate |
|
⚫ |
| image = Magnesium pyridoxal 5-phosphate glutamate.png |
|
|
|
|
|
<!--Clinical data--> |
|
|
| tradename = Sedalipid |
|
⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
⚫ |
| pregnancy_category = |
|
⚫ |
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
⚫ |
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
⚫ |
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
⚫ |
| legal_status = |
|
⚫ |
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
⚫ |
| bioavailability = |
|
⚫ |
| protein_bound = |
|
⚫ |
| metabolism = |
|
⚫ |
| elimination_half-life = |
|
⚫ |
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
⚫ |
| CAS_number = 62055-05-4 |
|
|
| CAS_supplemental = (] salt) |
|
⚫ |
| ATC_prefix = C10 |
|
⚫ |
| ATC_suffix = AX07 |
|
⚫ |
| PubChem = 173846 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
⚫ |
| DrugBank = |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 151728 |
|
| ChemSpiderID = 151728 |
|
|
|
|
| InChI = 1/C8H10NO6P.C5H10N2O3/c1-5-8(11)7(3-10)6(2-9-5)4-15-16(12,13)14;6-3(5(9)10)1-2-4(7)8/h2-3,11H,4H2,1H3,(H2,12,13,14);3H,1-2,6H2,(H2,7,8)(H,9,10)/t;3-/m.0/s1 |
|
|
|
<!--Chemical data--> |
|
| InChIKey = BCARVEADLDZBJT-HVDRVSQOBJ |
|
|
|
| C=13 | H=20 | N=3 | O=9 | P=1 |
|
| smiles = O=C(N)CC(N)C(=O)O.O=P(O)(O)OCc1cnc(c(O)c1C=O)C |
|
| smiles = O=C(N)CC(N)C(=O)O.O=P(O)(O)OCc1cnc(c(O)c1C=O)C |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C8H10NO6P.C5H10N2O3/c1-5-8(11)7(3-10)6(2-9-5)4-15-16(12,13)14;6-3(5(9)10)1-2-4(7)8/h2-3,11H,4H2,1H3,(H2,12,13,14);3H,1-2,6H2,(H2,7,8)(H,9,10)/t;3-/m.0/s1 |
|
| StdInChI = 1S/C8H10NO6P.C5H10N2O3/c1-5-8(11)7(3-10)6(2-9-5)4-15-16(12,13)14;6-3(5(9)10)1-2-4(7)8/h2-3,11H,4H2,1H3,(H2,12,13,14);3H,1-2,6H2,(H2,7,8)(H,9,10)/t;3-/m.0/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = BCARVEADLDZBJT-HVDRVSQOSA-N |
|
| StdInChIKey = BCARVEADLDZBJT-HVDRVSQOSA-N |
⚫ |
| CAS_number = 62055-05-4 |
|
⚫ |
| ATC_prefix = C10 |
|
⚫ |
| ATC_suffix = AX07 |
|
⚫ |
| PubChem = 173846 |
|
⚫ |
| DrugBank = |
|
|
| chemical_formula = |
|
|
| molecular_weight = |
|
⚫ |
| bioavailability = |
|
⚫ |
| protein_bound = |
|
⚫ |
| metabolism = |
|
⚫ |
| elimination_half-life = |
|
⚫ |
| excretion = |
|
⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
⚫ |
| pregnancy_category= |
|
⚫ |
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
⚫ |
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
⚫ |
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
⚫ |
| legal_status = |
|
⚫ |
| routes_of_administration = |
|
|
}} |
|
}} |
|
'''Magnesium pyridoxal 5-phosphate glutamate''' (trade name '''Sedalipid''') is a ].<ref name="pmid11317472">{{cite journal |author=Schuitemaker GE, van der Pol GA, Aretz CP, Dinant GJ |title=A placebo-controlled, double-blind, randomised trial of magnesium-pyridoxal-5'-phosphate-glutamate for hypercholesterolaemia and other clinical-chemical risk factors of cardiovascular disease in a primary care setting |journal=Eur. J. Clin. Pharmacol. |volume=56 |issue=12 |pages=857–63 |year=2001 |pmid=11317472 |doi=10.1007/s002280000247}}</ref> |
|
'''Magnesium pyridoxal 5-phosphate glutamate''' (trade name '''Sedalipid''') is a ].<ref name="pmid11317472">{{cite journal |vauthors=Schuitemaker GE, van der Pol GA, Aretz CP, Dinant GJ |title=A placebo-controlled, double-blind, randomised trial of magnesium-pyridoxal-5'-phosphate-glutamate for hypercholesterolaemia and other clinical-chemical risk factors of cardiovascular disease in a primary care setting |journal=Eur. J. Clin. Pharmacol. |volume=56 |issue=12 |pages=857–63 |year=2001 |pmid=11317472 |doi=10.1007/s002280000247}}</ref> |
|
|
|
|
|
==References== |
|
==References== |