| Revision as of 20:54, 9 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'DrugBank_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChIKey_Ref') per Chem/Drugbox validation (report← Previous edit |
Latest revision as of 00:19, 4 August 2023 edit undo2405:4802:1f91:7e70:cdbe:480:c59:9e2a (talk)No edit summary |
| (4 intermediate revisions by 4 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 443933437 |
|
| verifiedrevid = 443935235 |
|
|ImageFile=Mannose-1-phosphate.svg |
|
| ImageFile=Mannose-1-phosphate.svg |
|
|ImageSize=200px |
|
| ImageSize=200px |
| ⚫ |
|IUPACName= dihydrogen |
|
|
|
| IUPACName=1-''O''-Phosphono-<small>D</small>-mannopyranose |
|
⚫ |
|SystematicName= dihydrogen |
|
phosphate |
|
phosphate |
|
|OtherNames=Mannose-1-P; <small>D</small>-mannose-1-phosphate; <small>D</small>-Mannopyranose-1-phosphate |
|
| OtherNames=Mannose-1-P; <small>D</small>-mannose-1-phosphate; <small>D</small>-Mannopyranose-1-phosphate |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| CASNo=27251-84-9 |
|
| CASNo=27251-84-9 |
|
| CASNo_Ref = {{cascite|correct}} |
|
| CASNo_Ref = {{cascite|correct}} |
|
| PubChem=644175 |
|
| PubChem=644175 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 559210 |
|
| ChemSpiderID = 559210 |
|
| ChemSpiderID_Comment = Unspecified anomer |
|
| ChemSpiderID_Comment = Unspecified anomer |
|
| ChemSpiderID1_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID1_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID1 = 388412 |
|
| ChemSpiderID1 = 388412 |
|
| ChemSpiderID1_Comment = alpha anomer |
|
| ChemSpiderID1_Comment = alpha anomer |
|
| ChemSpiderID2_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID2_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID2 = 2496902 |
|
| ChemSpiderID2 = 2496902 |
|
| ChemSpiderID2_Comment = beta anomer |
|
| ChemSpiderID2_Comment = beta anomer |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI = 35374 |
|
| ChEBI = 35374 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = HXXFSFRBOHSIMQ-QTVWNMPRSA-N |
|
| StdInChIKey = HXXFSFRBOHSIMQ-QTVWNMPRSA-N |
|
| SMILES = O=P(O)(OC1O((O)(O)1O)CO)O |
|
| SMILES = O=P(O)(OC1O((O)(O)1O)CO)O |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C6H13O9P/c7-1-2-3(8)4(9)5(10)6(14-2)15-16(11,12)13/h2-10H,1H2,(H2,11,12,13)/t2-,3-,4+,5+,6?/m1/s1 |
|
| StdInChI = 1S/C6H13O9P/c7-1-2-3(8)4(9)5(10)6(14-2)15-16(11,12)13/h2-10H,1H2,(H2,11,12,13)/t2-,3-,4+,5+,6?/m1/s1 |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| C=6|H=13|O=9|P=1 |
|
| C=6 | H=13 | O=9 | P=1 |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
| Line 50: |
Line 52: |
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
|
|
|
{{organic-compound-stub}} |
|
{{organic-compound-stub}} |