Revision as of 13:27, 6 January 2011 editAnypodetos (talk | contribs)Autopatrolled, Extended confirmed users, Pending changes reviewers, Rollbackers39,350 edits Phase III study started← Previous edit |
Latest revision as of 20:00, 22 January 2023 edit undoEntranced98 (talk | contribs)Extended confirmed users, Pending changes reviewers, Rollbackers172,831 edits Importing Wikidata short description: "Type of selective glucocorticoid receptor agonist"Tag: Shortdesc helper |
(37 intermediate revisions by 20 users not shown) |
Line 1: |
Line 1: |
|
|
{{Short description|Type of selective glucocorticoid receptor agonist}} |
|
{{Drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
⚫ |
| IUPAC_name = (2''R'')-1,1,1-trifluoro-4-(5-fluoro-2,3-dihydro-1-benzofuran-7-yl)-4-methyl-2-<nowiki>methyl]pentan-2-ol |
|
|
|
| verifiedrevid = 406275524 |
|
| image = BOL-303242-X skeletal.svg |
|
|
⚫ |
| IUPAC_name = (2''R'')-1,1,1-trifluoro-4-(5-fluoro-2,3-dihydro-1-benzofuran-7-yl)-4-methyl-2-<nowiki>methyl]pentan-2-ol |
⚫ |
| CAS_number = 887375-26-0 |
|
|
|
| image = Mapracorat_skeletal.svg |
|
| CAS_supplemental = |
|
|
|
| width = 250 |
⚫ |
| ATC_prefix = none |
|
|
|
|
⚫ |
| ATC_suffix = |
|
|
|
<!--Clinical data--> |
⚫ |
| ATC_supplemental = |
|
|
|
| tradename = |
⚫ |
| PubChem = 24795088 |
|
|
| DrugBank = |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
⚫ |
| chemical_formula = |
|
|
⚫ |
| pregnancy_category = |
⚫ |
| C=25 | H=26 | F=4 | N=2 | O=2 |
|
|
⚫ |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
| molecular_weight = 462.479 g/mol |
|
|
⚫ |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
⚫ |
| smiles = c14OCCc4cc(F)cc1C(C)(C)CC(O)(C(F)(F)F)CNc(cccc2n3)c2ccc3C |
|
|
⚫ |
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
⚫ |
| bioavailability = |
|
|
⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
⚫ |
| protein_bound = |
|
|
⚫ |
| legal_status = Investigational |
⚫ |
| metabolism = |
|
⚫ |
| elimination_half-life = |
|
⚫ |
| excretion = |
|
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
⚫ |
| pregnancy_category= |
|
⚫ |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
⚫ |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
⚫ |
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
⚫ |
| legal_status = Investigational |
|
|
| routes_of_administration = Topical (], ]) |
|
| routes_of_administration = Topical (], ]) |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
⚫ |
| bioavailability = |
|
⚫ |
| protein_bound = |
|
⚫ |
| metabolism = |
|
⚫ |
| elimination_half-life = |
|
⚫ |
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
⚫ |
| CAS_number = 887375-26-0 |
|
⚫ |
| ATC_prefix = none |
|
⚫ |
| ATC_suffix = |
|
⚫ |
| ATC_supplemental = |
|
⚫ |
| PubChem = 24795088 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
|
| DrugBank = |
|
|
| KEGG = D10136 |
|
|
| KEGG_Ref = {{keggcite|changed|kegg}} |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 25104194 |
|
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
|
| UNII = 145V79YBVP |
|
|
|
|
|
<!--Chemical data--> |
|
⚫ |
| chemical_formula = |
|
⚫ |
| C=25 | H=26 | F=4 | N=2 | O=2 |
|
⚫ |
| smiles = c14OCCc4cc(F)cc1C(C)(C)CC(O)(C(F)(F)F)CNc(cccc2n3)c2ccc3C |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C25H26F4N2O2/c1-15-7-8-18-20(5-4-6-21(18)31-15)30-14-24(32,25(27,28)29)13-23(2,3)19-12-17(26)11-16-9-10-33-22(16)19/h4-8,11-12,30,32H,9-10,13-14H2,1-3H3/t24-/m1/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = VJGFOYBQOIPQFY-XMMPIXPASA-N |
|
}} |
|
}} |
|
|
|
|
'''Mapracorat''' (], code names '''BOL-303242-X''', '''ZK 245186'''<ref name="pmid20824100">{{pmid|20824100}}</ref>) is an ] belonging to the experimental class of ]s (SEGRAs). It is in ]s for the topical treatment of ]<ref name="NCT00944632">{{ClinicalTrialsGov|NCT00944632|Dose Escalation of Different Concentrations of ZK 245186 in Atopic Dermatitis}}</ref> and inflammation following ]<ref name="NCT00905450">{{ClinicalTrialsGov|NCT00905450|Evaluation of BOL-303242-X Versus Vehicle for the Treatment of Inflammation Following Cataract Surgery}}</ref>. Preliminary investigation for the treatment of ] has been conducted in cellular models.<ref name="pmid20824100" /> |
|
'''Mapracorat''' (], code names '''BOL-303242-X''', '''ZK-245186'''<ref name="pmid20824100">{{cite journal | vauthors = Cavet ME, Harrington KL, Ward KW, Zhang JZ | title = Mapracorat, a novel selective glucocorticoid receptor agonist, inhibits hyperosmolar-induced cytokine release and MAPK pathways in human corneal epithelial cells | journal = Molecular Vision | volume = 16 | pages = 1791–800 | date = September 2010 | pmid = 20824100 | pmc = 2932489 }}</ref>) is an ] belonging to the experimental class of ]s (SEGRAs). It is in ]s for the topical treatment of ],<ref name="NCT00944632">{{ClinicalTrialsGov|NCT00944632|Dose Escalation of Different Concentrations of ZK 245186 in Atopic Dermatitis}}</ref> inflammation following ],<ref name="NCT00905450">{{ClinicalTrialsGov|NCT00905450|Evaluation of BOL-303242-X Versus Vehicle for the Treatment of Inflammation Following Cataract Surgery}}</ref> and ].<ref>{{ClinicalTrialsGov|NCT01289431|Mapracorat Ophthalmic Formulation in Subjects With Allergic Conjunctivitis}}</ref> Preliminary investigation for the treatment of ] has been conducted in cellular models.<ref name="pmid20824100" /> |
|
|
|
|
|
== Clinical trials== |
|
== Clinical trials== |
|
Phase II clinical trials with mapracorat started in summer 2009. One trial was a ] dose finding study for an ] against atopic dermatitis. It tested concentrations of 0.01%, 0.03% and 0.1% versus ] over four weeks in around 64 patients. This trial was conducted by ], a part of ] specialized on ], and completed in September or October 2010.<ref name="NCT00944632" /> The other trial, also with a double blind design, evaluated an ] ] for the treatment of inflammation following cataract surgery. Various concentrations and dosing schemes were tested versus placebo in about 550 patients. The study was conducted by ] and completed in September 2010.<ref name="NCT00905450" /> Its successor study, a phase III trial, started in November 2010 and is scheduled to run until February 2012.<ref name="NCT01230125">{{ClinicalTrialsGov|NCT01230125|Mapracorat Ophthalmic Suspension for the Treatment of Ocular Inflammation Following Cataract Surgery}}</ref> |
|
Phase II clinical trials with mapracorat started in summer 2009. One trial was a ] dose finding study for an ] against atopic dermatitis. It tested concentrations of 0.01%, 0.03% and 0.1% versus ] over four weeks in around 64 patients. This trial was conducted by Intendis, a part of ] specialized on ], and completed in September or October 2010.<ref name="NCT00944632" /> The other trial, also with a double blind design, evaluated an ] ] for the treatment of inflammation following cataract surgery. Various concentrations and dosing schemes were tested versus placebo in about 550 patients. The study was conducted by ] and completed in September 2010.<ref name="NCT00905450" /> Its successor study, a phase III trial, started in November 2010 and completed in August 2011.<ref name="NCT01230125">{{ClinicalTrialsGov|NCT01230125|Mapracorat Ophthalmic Suspension for the Treatment of Ocular Inflammation Following Cataract Surgery}}</ref> |
|
|
|
|
|
{{as of|2011|1}} no study results are available. |
|
{{as of|2017|1}} no study results are available. |
|
|
|
|
|
==References== |
|
== See also == |
|
|
* ] |
⚫ |
{{Reflist}} |
|
|
|
* ] |
|
|
* ] |
|
|
|
|
|
== References == |
|
⚫ |
{{Reflist|2}} |
|
|
|
|
|
{{Glucocorticoids and antiglucocorticoids}} |
|
|
{{Glucocorticoid receptor modulators}} |
|
|
|
|
|
] |
|
] |
|
|
] |
|
|
] |
|
] |
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
|
{{musculoskeletal-drug-stub}} |
|
|
|
|
|
{{antineoplastic-drug-stub}} |
|
{{dermatologic-drug-stub}} |
|
{{dermatologic-drug-stub}} |