| Revision as of 19:43, 15 August 2011 editArcadian (talk | contribs)163,050 edits removed Category:Toxicology; added Category:Vertebrate toxins using HotCat← Previous edit |
Latest revision as of 23:29, 26 October 2023 edit undoGraeme Bartlett (talk | contribs)Administrators249,716 edits added Category:Heterocyclic compounds with 5 rings using HotCat |
| (25 intermediate revisions by 18 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 379258277 |
|
|
|
| Watchedfields = changed |
| ⚫ |
|ImageFile=Marinobufagin.png |
|
|
⚫ |
| verifiedrevid = 445026547 |
| ⚫ |
|ImageSize=240 |
|
|
⚫ |
| ImageFile=Marinobufagin.svg |
|
|IUPACName= |
|
|
⚫ |
| ImageSize=240 |
| ⚫ |
|OtherNames=Marinobufagin, Marinobufagenin |
|
|
|
| IUPACName=3β,5-Dihydroxy-14,15-epoxy-5β,14β-bufa-20,22-dienolide |
|
|
| SystematicName=5-indenooxiren-1-yl]-2''H''-pyran-2-one |
|
⚫ |
| OtherNames=Marinobufagin, Marinobufagenin |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo=470-42-8 |
|
| CASNo=470-42-8 |
| ⚫ |
| PubChem= 10104 |
|
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| SMILES= C12CC(C1(CCC3C2CC4(35(O5)C4C6=COC(=O)C=C6)C)O)O |
|
|
|
| UNII = 3KBT25GV2B |
|
}} |
|
|
⚫ |
| PubChem= 11969465 |
|
⚫ |
| SMILES= C12CC(C1(CCC3C2CC4(35(O5)C4C6=COC(=O)C=C6)C)O)O |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 10142870 |
|
|
| InChI = 1/C24H32O5/c1-21-8-5-15(25)12-23(21,27)10-7-17-16(21)6-9-22(2)18(11-19-24(17,22)29-19)14-3-4-20(26)28-13-14/h3-4,13,15-19,25,27H,5-12H2,1-2H3/t15-,16-,17+,18+,19+,21+,22+,23-,24+/m0/s1 |
|
|
| InChIKey = JMNQTHQLNRILMH-OBBGIPBRBU |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C24H32O5/c1-21-8-5-15(25)12-23(21,27)10-7-17-16(21)6-9-22(2)18(11-19-24(17,22)29-19)14-3-4-20(26)28-13-14/h3-4,13,15-19,25,27H,5-12H2,1-2H3/t15-,16-,17+,18+,19+,21+,22+,23-,24+/m0/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = JMNQTHQLNRILMH-OBBGIPBRSA-N }} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| C=24 | H=32 | O=5 |
|
| C=24 | H=32 | O=5 |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards=Toxic |
|
| MainHazards=Toxic |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Marinobufagin''' is a ] ] ] secreted by the ] '']''<ref>Cunha Filho GA, Schwartz CA, Resck IS, Murta MM, Lemos SS, Castro MS, Kyaw C, Pires OR Jr, Leite JR, Bloch C Jr, Schwartz EF. Antimicrobial activity of the bufadienolides marinobufagin and telocinobufagin isolated as major components from skin secretion of the toad Bufo rubescens. ''Toxicon''. 2005 May;45(6):777-82. PMID 15804527</ref> and other related species such as '']''. It is a ] with effects similar to ].<ref>Fedorova OV, Talan MI, Agalakova NI, Lakatta EG, Bagrov AY. Endogenous ligand of alpha(1) sodium pump, marinobufagenin, is a novel mediator of sodium chloride--dependent hypertension. ''Circulation''. 2002 Mar 5;105(9):1122-7. PMID 11877366</ref> |
|
'''Marinobufagenin''' ('''marinobufagin''') is a ] ] ]. It can be found in the plasma and urine of human subjects with myocardial infarction, kidney failure, and heart failure.<ref>{{cite journal |last1=Tian |first1=Jiang |title=Renal ischemia regulates marinobufagenin release in humans |journal=Hypertension |date=7 September 2010 |volume=56 |issue=5 |pages=914–919 |doi=10.1161/hypertensionaha.110.155564 |pmid=20823380 |pmc=2959137 }}</ref> It is also secreted by the ] '']''<ref>{{cite journal | pmid = 15804527 | year = 2005 | last1 = Cunha Filho | first1 = GA | last2 = Schwartz | first2 = CA | last3 = Resck | first3 = IS | last4 = Murta | first4 = MM | last5 = Lemos | first5 = SS | last6 = Castro | first6 = MS | last7 = Kyaw | first7 = C | last8 = Pires Jr | first8 = OR | last9 = Leite | first9 = JR | last10 = Bloch | first10 = Carlos | last11 = Schwartz | first11 = Elisabeth Ferroni | title = Antimicrobial activity of the bufadienolides marinobufagin and telocinobufagin isolated as major components from skin secretion of the toad Bufo rubescens | volume = 45 | issue = 6 | pages = 777–82 | doi = 10.1016/j.toxicon.2005.01.017 | journal = Toxicon| display-authors = 8 }}</ref> and other related species such as '']''. It is a ] with effects similar to ].<ref>{{cite journal | pmid = 11877366 | year = 2002 | last1 = Fedorova | first1 = OV | last2 = Talan | first2 = MI | last3 = Agalakova | first3 = NI | last4 = Lakatta | first4 = EG | last5 = Bagrov | first5 = AY | title = Endogenous ligand of alpha(1) sodium pump, marinobufagenin, is a novel mediator of sodium chloride--dependent hypertension | volume = 105 | issue = 9 | pages = 1122–7 | journal = Circulation | doi=10.1161/hc0902.104710| doi-access = free }}</ref> |
|
|
|
|
|
==References== |
|
==References== |
| Line 33: |
Line 46: |
|
{{Cardiac glycosides}} |
|
{{Cardiac glycosides}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
|
|
|
|
{{med-toxic-stub}} |
|
{{med-toxic-stub}} |