| Revision as of 08:58, 7 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (changes to verified fields - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per [[Misplaced Pages:WikiProject Chemicals/Chembox validation|Chem/Drugbo← Previous edit |
Latest revision as of 13:36, 26 December 2023 edit undoBoghog (talk | contribs)Autopatrolled, Extended confirmed users, IP block exemptions, New page reviewers, Pending changes reviewers, Rollbackers, Template editors137,800 edits consistent citation formatting |
| (26 intermediate revisions by 15 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{drugbox |
|
|
|
{{infobox drug |
|
| Verifiedfields = changed |
|
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = I6X824OGWZ |
|
| UNII = I6X824OGWZ |
|
| verifiedrevid = 379645213 |
|
| verifiedrevid = 443480285 |
|
| IUPAC_name = non-3-yl hydroxy(di-2-thienyl)acetate |
|
| IUPAC_name = non-3-yl hydroxy(di-2-thienyl)acetate |
|
| image = Mazaticol2.png |
|
| image = Mazaticol.svg |
|
|
| width = 200 |
|
| CAS_number = 42024-98-6 |
|
| CAS_number = 42024-98-6 |
|
| ATC_prefix = N04 |
|
| ATC_prefix = N04 |
| Line 12: |
Line 13: |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = |
|
| DrugBank = |
|
|
| ChemSpiderID = 61921 |
|
|
| smiles = CC1(CC2C(C1N2C)OC(=O)C(c3cccs3)(c4cccs4)O)C |
|
|
| StdInChI = 1S/C21H27NO3S2/c1-20(2)9-8-14-12-15(13-16(20)22(14)3)25-19(23)21(24,17-6-4-10-26-17)18-7-5-11-27-18/h4-7,10-11,14-16,24H,8-9,12-13H2,1-3H3/t14-,15-,16-/m1/s1 |
|
|
| StdInChIKey = AMHPTVWBZSYFSS-BZUAXINKSA-N |
|
|
|
|
| C=21|H=27|N=1|O=3|S=2 |
|
| C=21|H=27|N=1|O=3|S=2 |
|
| molecular_weight = 405.576 g/mol |
|
|
| bioavailability = |
|
| bioavailability = |
|
| protein_bound = |
|
| protein_bound = |
| Line 24: |
Line 29: |
|
}} |
|
}} |
|
|
|
|
|
'''Mazaticol''' ('''Pentona''') is a ] used as an ] agent in Japan. |
|
'''Mazaticol''' ('''Pentona''') is an ] used as an ] agent in Japan. |
|
|
|
|
|
The compound was known as '''PG-501''' is first mentioned in Japanese studies in the early 1970s, noting "PG-501 was found to have pronounced anti-acetylcholine, anti-tremorine-induced tremor, anti-physostigmine-induced death, anti-haloperidol-induced parkinsonism and anti EEG arousal activities."<ref>{{cite journal | vauthors = Nose T, Kojima M, Ishida R, Shintomi K, Kowa Y | title = | language = Japanese | journal = Nihon Yakurigaku Zasshi. Folia Pharmacologica Japonica | volume = 67 | issue = 4 | pages = 387–405 | date = July 1971 | pmid = 5000167 | doi = 10.1254/fpj.67.387 | doi-access = free }}</ref><ref>{{cite journal | vauthors = Kosaka K |date=1971 |title=パ ー キ ン ソ ン病 に対 す るPG-501の 使 用 経 験/The Beneficial Effect of PG-501 on Parkinsonism |url=https://www.jstage.jst.go.jp/article/jscpt1970/2/3/2_3_230/_article/-char/en |journal= Rinsho Yakuri/Japanese Journal of Clinical Pharmacology and Therapeutics|volume=2 |issue=3 |pages=230–235 |doi=10.3999/jscpt.2.230 |access-date=December 18, 2023|doi-access=free }}</ref> |
|
|
|
|
|
== References == |
|
== References == |
| Line 30: |
Line 37: |
|
|
|
|
|
== External links == |
|
== External links == |
|
* |
|
* {{dead link|date=January 2018 |bot=InternetArchiveBot |fix-attempted=yes }} |
|
|
|
|
|
|
|
|
{{Antiparkinson}} |
|
{{Antiparkinson}} |
|
|
{{Muscarinic acetylcholine receptor modulators}} |
|
{{Cholinergics}} |
|
|
|
|
|
| ⚫ |
{{nervous-system-drug-stub}} |
|
|
] |
|
] |
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
|
|
⚫ |
{{nervous-system-drug-stub}} |