| Revision as of 11:01, 30 May 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref') per Chem/Drugbox validation (report [[Wik← Previous edit |
Latest revision as of 23:26, 25 October 2023 edit undoBenjah-bmm27 (talk | contribs)Autopatrolled, Extended confirmed users, Pending changes reviewers, Rollbackers14,702 edits added a ball-and-stick model of the molecule based on crystallography |
| (38 intermediate revisions by 25 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
⚫ |
| Reference =<ref>''Merck Index'', 11th Edition, '''5666'''.</ref> |
|
| verifiedrevid = 431585838 |
|
|
|
| ImageFile =Mecoprop.svg |
| ⚫ |
|Reference=<ref>''Merck Index'', 11th Edition, '''5666'''.</ref> |
|
|
⚫ |
| ImageSize = |
|
|ImageFile=(±)-Mecoprop Enantiomers Formulae.png |
|
|
⚫ |
| ImageFile1 = Mecoprop-racemic-dimer-from-xtal-labelled-3D-balls.png |
| ⚫ |
|ImageSize=250px |
|
|
⚫ |
| IUPACName =(''RS'')-2-(4-Chloro-2-methylphenoxy)propanoic acid |
| ⚫ |
|ImageFile1 = Mecoprop-racemic-dimer-from-xtal-labelled-3D-balls.png |
|
|
⚫ |
| OtherNames = |
|
|ImageSize1=250px |
|
|
⚫ |
|Section1={{Chembox Identifiers |
| ⚫ |
|IUPACName=(''RS'')-2-(4-chloro-2-methylphenoxy)propanoic acid |
|
|
⚫ |
| CASNo =93-65-2 |
| ⚫ |
|OtherNames= |
|
|
⚫ |
| CASNo_Ref = {{cascite|correct|CAS}} |
| ⚫ |
|Section1= {{Chembox Identifiers |
|
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| CASNo=93-65-2 |
|
|
|
| UNII = 74N8TKR9P8 |
| ⚫ |
| CASNo_Ref = {{cascite}} |
|
|
| PubChem=7153 |
|
| PubChem =7153 |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
| ⚫ |
| SMILES=CC1=C(C=CC(=C1)Cl)OC(C)C(=O)O |
|
|
|
| ChEMBL = 2145254 |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = C18742 |
|
| KEGG = C18742 |
|
|
| EINECS = 230-386-8 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
| ChemSpiderID = 6886 |
|
⚫ |
| SMILES = CC1=C(C=CC(=C1)Cl)OC(C)C(=O)O |
|
|
| InChI = 1/C10H11ClO3/c1-6-5-8(11)3-4-9(6)14-7(2)10(12)13/h3-5,7H,1-2H3,(H,12,13) |
|
|
| InChIKey = WNTGYJSOUMFZEP-UHFFFAOYAN |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChI = 1S/C10H11ClO3/c1-6-5-8(11)3-4-9(6)14-7(2)10(12)13/h3-5,7H,1-2H3,(H,12,13) |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChIKey = WNTGYJSOUMFZEP-UHFFFAOYSA-N |
|
|
| RTECS = |
|
|
| MeSHName = |
|
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEBI = 75704 |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C=10 | H=11 | Cl=1 | O=3 |
|
| Formula=C<sub>10</sub>H<sub>11</sub>ClO<sub>3</sub> |
|
|
|
| Appearance =Solid |
|
| MolarMass=214.646 |
|
|
|
| Density = |
|
| Appearance=Solid |
|
|
|
| MeltingPtC = 94 to 95 |
|
| Density= |
|
|
| MeltingPt= 94–95 °C <ref name="GESTIS">{{GESTIS|ZVG=510276|Name=Mecoprop|Date=8 September 2008}}</ref> |
|
| MeltingPt_ref = <ref name="GESTIS">{{GESTIS|ZVG=510276|Name=Mecoprop|Date=8 September 2008}}</ref> |
|
| BoilingPt= decomposes <ref name="GESTIS"/> |
|
| BoilingPt = decomposes <ref name="GESTIS"/> |
|
| Solubility= 900 mg/l (20 °C) <ref name="GESTIS"/> |
|
| Solubility = 900 mg/L (20 °C)<ref name="GESTIS"/> |
| ⚫ |
}} |
|
| ⚫ |
|Section3= {{Chembox Hazards |
|
| ⚫ |
| MainHazards= Xn, N <ref name="GESTIS"/> |
|
|
| FlashPt= |
|
|
| Autoignition= |
|
|
}} |
|
}} |
|
⚫ |
|Section3={{Chembox Hazards |
|
⚫ |
| MainHazards = Xn, N <ref name="GESTIS"/> |
|
|
| FlashPt = |
|
|
| AutoignitionPt = |
|
⚫ |
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Mecoprop''', or methylchlorophenoxypropionic acid (MCPP), is a common general use ] found in many household weed killers and "weed-and-feed" type lawn fertilizers.<ref>{{HPD|2529}}</ref> It is primarily used to control broadleaf weeds.<ref name="EXTOXNET"> at EXTOXNET</ref> It is often used in combination with other chemically related herbicides such as ], ], and ]. |
|
'''Mecoprop''' (also known as '''methylchlorophenoxypropionic acid''' and '''MCPP''') is a common general use ] found in many household weed killers and "weed-and-feed" type lawn fertilizers.<ref>{{CPID|id=2083|name=2-(2-Methyl-4-chlorophenoxy)propionic acid}}</ref> It is primarily used to control ].<ref name="EXTOXNET"> at EXTOXNET</ref> It is often used in combination with other chemically related herbicides such as ], ], and ], which mimic the plant hormone ] (auxin) and kill most broadleaf weeds by causing uncontrolled growth. |
|
|
|
| ⚫ |
Mecoprop is a mixture of two ]s, with the (R)-(+)-] ("Mecoprop-P", "Duplosan KV") possessing the herbicidal activity<ref>{{ cite journal | journal = Acta Cryst. | volume = B36 | issue = 4 | month = April | year = 1980 | pages = 992–994 | doi = 10.1107/S0567740880005134 | title = (+-)-2-(4-Chloro-2-methylphenoxy)propionic acid (mecoprop) | author = G. Smith, C. H. L. Kennard, A. H. White and P. G. Hodgson }}</ref>. |
|
|
|
|
|
|
The ] has classified mecoprop as toxicity class III - slightly toxic.<ref name="EXTOXNET"/> |
|
The ] has classified mecoprop as toxicity class III - slightly toxic.<ref name="EXTOXNET"/> |
|
|
|
|
⚫ |
Mecoprop is a mixture of two ]s, with the (''R'')-(+)-] ("Mecoprop-P", "Duplosan KV") possessing the herbicidal activity.<ref>{{ cite journal | journal = Acta Crystallogr. B| volume = 36 | issue = 4 |date=April 1980 | pages = 992–994 | doi = 10.1107/S0567740880005134 | title = (±)-2-(4-Chloro-2-methylphenoxy)propionic acid (mecoprop) |author1=G. Smith |author2=C. H. L. Kennard |author3=A. H. White |author4=P. G. Hodgson }}</ref> |
|
|
|
|
|
] |
|
|
|
|
|
== See also == |
|
== See also == |
|
* ] |
|
* ] |
|
* ] |
|
* ] |
|
|
|
|
|
== References == |
|
== References == |
| Line 47: |
Line 64: |
|
== External links == |
|
== External links == |
|
* |
|
* |
|
|
* {{PPDB|430|Name=Mecoprop}} |
|
* |
|
|
|
* {{PPDB|431|Name=Mecoprop-P}} |
|
* |
|
|
|
{{Herbicides}} |
|
* |
|
|
⚫ |
] |
|
|
|
|
] |
|
] |
| ⚫ |
] |
|
|
] |
|
] |
|
|
|
|
] |
|
|
] |
|