Revision as of 01:20, 14 January 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (changes to verified fields - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (report [[Wikip← Previous edit |
Latest revision as of 01:59, 3 January 2024 edit undoInnerstream (talk | contribs)Autopatrolled, Extended confirmed users4,062 editsmNo edit summary |
(27 intermediate revisions by 16 users not shown) |
Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 340936364 |
|
| verifiedrevid = 407762837 |
|
|Reference=<ref name="c21">, chemicalland21.com</ref> |
|
|
|ImageFile=Meglumine.png |
|
| ImageFile = Meglumine.svg |
|
|
| ImageFile_Ref = {{chemboximage|correct|??}} |
|
|ImageSize=200px |
|
| ImageSize = 200 |
⚫ |
|IUPACName=(2''R'',3''R'',4''R'',5''S'')-6-Methylaminohexane-1,2,3,4,5-pentol |
|
|
|
| ImageName = Stereo, skeletal formula of meglumine |
|
|OtherNames=• 1-Deoxy-1-methylamino-sorbitol<br>• 1-Deoxy-1-methylamino-<small>D</small>-glucitol |
|
|
⚫ |
| SystematicName = (2''R'',3''R'',4''R'',5''S'')-6-(Methylamino)hexane-1,2,3,4,5-pentol |
|
|
| OtherNames = ''N''-Methyl-<small>D</small>-glucamine; Methylglucamine; ''N''-Methylglucamine; 1-Deoxy-1-(methylamino)-<small>D</small>-glucitol; 1-Deoxy-1-methylaminosorbitol; ''N''-Methylsorbitylamine; Meglumin <!-- synonyms from Chemical Abstracts Service--> |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
⚫ |
| CASNo = 6284-40-8 |
|
| CASNo_Ref = {{cascite}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
⚫ |
| CASNo=6284-40-8 |
|
|
| PubChem=8567 |
|
| PubChem = 8567 |
|
|
| ChemSpiderID = 8249 |
⚫ |
| KEGG_Ref = {{keggcite|changed|kegg}} |
|
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
| KEGG = D01796 |
|
|
|
| UNII = 6HG8UB2MUY |
|
| SMILES=CNCC(C(C(C(CO)O)O)O)O |
|
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
⚫ |
}} |
|
|
|
| ChEBI = 59732 |
|
⚫ |
| UNII_Ref = {{fdacite|changed|FDA}} |
|
|
| ChEMBL = 1200570 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| SMILES = O((O)CNC)(O)(O)CO |
|
|
| StdInChI =1S/C7H17NO5/c1-8-2-4(10)6(12)7(13)5(11)3-9/h4-13H,2-3H2,1H3/t4-,5+,6+,7+/m0/s1 |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = MBBZMMPHUWSWHV-BDVNFPICSA-N |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
⚫ |
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C=7 | H=17 | N=1 | O=5 |
|
| Formula=C<sub>7</sub>H<sub>17</sub>NO<sub>5</sub> |
|
|
⚫ |
| Appearance = White crystals |
|
| MolarMass=195.21358 |
|
|
|
| LogP = −2.509 |
⚫ |
| Appearance=White powder |
|
|
| Density= |
|
| pKa = 9.52 |
|
|
| pKb = 0.526 |
|
| MeltingPt=128-132 °C |
|
|
⚫ |
}} |
|
| BoilingPt= |
|
|
⚫ |
|Section3={{Chembox Related |
|
| Solubility= |
|
|
|
| OtherFunction_label = |
⚫ |
}} |
|
|
|
| OtherFunction = |
⚫ |
|Section3={{Chembox Hazards |
|
|
|
| OtherCompounds = |
|
| MainHazards= |
|
|
⚫ |
}} |
|
| FlashPt= |
|
|
| Autoignition= |
|
⚫ |
}} |
|
|
}} |
|
}} |
|
|
|
|
|
'''Meglumine''' is an ] derived from ]. It is often used as an ] in pharmaceuticals and in conjunction with iodinated compounds in ] such as ] and ].<ref name="c21"/><ref>{{PubChem|8567}}</ref> |
|
'''Meglumine''' is a ] derived from ] that contains an ] modification. It is often used as an ] in pharmaceuticals<ref>{{cite web | url = https://drugs.ncats.io/drug/6HG8UB2MUY | title = Meglumine | work = Inxight Drugs | publisher = National Center for Advancing Translational Sciences }}</ref> and in conjunction with iodinated compounds in ] such as ], ], and ].<ref>, chemicalland21.com</ref> |
|
|
|
|
|
==See also== |
|
==See also== |
Line 41: |
Line 51: |
|
|
|
|
|
] |
|
] |
|
|
|
|
|
|
|
|
{{organic-compound-stub}} |
|
{{organic-compound-stub}} |
|
{{pharma-stub}} |
|
{{pharma-stub}} |
|
|
|
|
] |
|
|
] |
|
|
] |
|