| Revision as of 01:37, 12 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per Chem/Drugbox validation← Previous edit |
Latest revision as of 14:54, 21 February 2023 edit undoOzzie10aaaa (talk | contribs)Autopatrolled, Extended confirmed users, New page reviewers213,612 editsm Cleaned up using AutoEd |
| (21 intermediate revisions by 18 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{Wikify|date=February 2011}} |
|
|
|
{{Drugbox |
|
⚫ |
| verifiedrevid = 444367111 |
|
⚫ |
| IUPAC_name = Bis(2-aminoethyl) {4-phenyl}arsonodithioite |
|
⚫ |
| image = melaminylthioarsenate.png |
|
|
| alt = Skeletal formula of melarsomine |
|
|
| width = 240 |
|
|
| image2 = Melarsomine 3D spacefill.png |
|
|
| alt2 = Space-filling model of the melarsomine molecule |
|
|
|
|
|
|
<!--Clinical data--> |
|
{{drugbox |
|
|
|
| tradename = Immiticide, Diroban |
|
|
| Drugs.com = {{drugs.com|international|melarsomine}} |
|
⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
⚫ |
| pregnancy_category = |
|
⚫ |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
⚫ |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
⚫ |
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
⚫ |
| legal_status = |
|
⚫ |
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
⚫ |
| bioavailability = |
|
⚫ |
| protein_bound = |
|
|
| metabolism = |
|
⚫ |
| elimination_half-life = |
|
⚫ |
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
⚫ |
| CAS_number = 128470-15-5 |
|
⚫ |
| ATC_prefix = none |
|
⚫ |
| ATC_suffix = |
|
⚫ |
| PubChem = 65962 |
|
⚫ |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
⚫ |
| DrugBank = |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = 374GJ0S41A |
|
| UNII = 374GJ0S41A |
| ⚫ |
| verifiedrevid = 443786704 |
|
| ⚫ |
| IUPAC_name = Bis(2-aminoethyl) {4-phenyl}arsonodithioite |
|
| ⚫ |
| image = melaminylthioarsenate.png |
|
| ⚫ |
| CAS_number = 128470-15-5 |
|
| ⚫ |
| ATC_prefix = none |
|
| ⚫ |
| ATC_suffix = |
|
| ⚫ |
| PubChem = 65962 |
|
| ⚫ |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| ⚫ |
| DrugBank = |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D08168 |
|
| KEGG = D08168 |
|
| chemical_formula = |
|
| ChemSpiderID = 59365 |
|
|
|
|
|
<!--Chemical data--> |
|
|
| chemical_formula = |
|
| C=13 | H=21 | As=1 | N=8 | S=2 |
|
| C=13 | H=21 | As=1 | N=8 | S=2 |
|
| molecular_weight = 428.41 g/mol |
|
| ⚫ |
| bioavailability = |
|
|
| smiles = C1=CC(=CC=C1NC2=NC(=NC(=N2)N)N)(SCCN)SCCN |
|
| smiles = C1=CC(=CC=C1NC2=NC(=NC(=N2)N)N)(SCCN)SCCN |
|
|
| StdInChI = 1S/C13H21AsN8S2/c15-5-7-23-14(24-8-6-16)9-1-3-10(4-2-9)19-13-21-11(17)20-12(18)22-13/h1-4H,5-8,15-16H2,(H5,17,18,19,20,21,22) |
| ⚫ |
| protein_bound = |
|
|
| metabolism = |
|
| StdInChIKey = MGEOLZFMLHYCFZ-UHFFFAOYSA-N |
| ⚫ |
| elimination_half-life = |
|
| ⚫ |
| excretion = |
|
| ⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| ⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| ⚫ |
| pregnancy_category= |
|
| ⚫ |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
| ⚫ |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| ⚫ |
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
| ⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| ⚫ |
| legal_status = |
|
| ⚫ |
| routes_of_administration = |
|
|
}} |
|
}} |
|
|
|
|
|
|
'''Melarsomine''' (melaminylthioarsenate) is an ]-based ]. In the U.S., it is marketed under the trade names ''Immiticide'' (]) and ''Diroban'' (]), and is approved by the ] ] for the treatment of adult ] (''Dirofilaria immitis'') infection in ]s. It is not approved for treatment in cats, or dogs in late-stage infection.<ref name="Tilley2008">{{cite book| vauthors = Tilley LP |title=Manual of Canine and Feline Cardiology|url=https://books.google.com/books?id=nggxUPtJsAYC&pg=PA196|year=2008|publisher=Elsevier Health Sciences|isbn=978-1-4160-2398-2|pages=194–197}}</ref><ref name="BonaguraTwedt2013">{{cite book| vauthors = Bonagura JD, Twedt DC |title=Kirk's Current Veterinary Therapy XV|url=https://books.google.com/books?id=KlJKAgAAQBAJ&pg=PT2502|year=2013|publisher=Elsevier Health Sciences|isbn=978-0-323-22762-9|page=2502}}</ref> |
|
'''Melarsomine''' (melaminylthioarsenate) is a ]. |
|
|
|
|
|
|
==References== |
|
|
{{reflist|30em}} |
|
|
|
|
|
==External links== |
|
|
* |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
|
|
|
|
|
{{pharmacology-stub}} |
|
{{antiinfective-drug-stub}} |