| Revision as of 22:53, 12 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (no changed fields - added verified revid - updated 'ChEMBL_Ref', 'ChEBI_Ref', 'ChEBI_Ref') per Chem/Drugbox validation (report [[Misplaced Pages talk:WikiProject_Pharmacology|erro← Previous edit |
Latest revision as of 12:35, 28 September 2024 edit undoBoghog (talk | contribs)Autopatrolled, Extended confirmed users, IP block exemptions, New page reviewers, Pending changes reviewers, Rollbackers, Template editors137,925 edits consistent citation formatting |
| (25 intermediate revisions by 22 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{drugbox |
|
|
|
{{cs1 config|name-list-style=vanc|display-authors=6}} |
| ⚫ |
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
|
{{Drugbox |
| ⚫ |
| UNII = M30686U4X4 |
|
|
|
| Watchedfields = changed |
|
| verifiedrevid = 443668779 |
|
| verifiedrevid = 444522501 |
|
| IUPAC_name = methyl (2''S'')-2-amino-3-(3,4-dihydroxyphenyl)propanoate |
|
| IUPAC_name = methyl (2''S'')-2-amino-3-(3,4-dihydroxyphenyl)propanoate |
|
| image = Melevodopa.svg |
|
| image = Melevodopa.svg |
|
|
| width = |
|
|
|
|
|
<!-- Clinical data --> |
|
|
| tradename = Levomet |
|
⚫ |
| pregnancy_category = |
|
⚫ |
| legal_status = |
|
⚫ |
| routes_of_administration = |
|
|
|
|
|
<!-- Pharmacokinetic data --> |
|
⚫ |
| bioavailability = |
|
⚫ |
| protein_bound = |
|
⚫ |
| metabolism = |
|
|
| metabolites = |
|
⚫ |
| elimination_half-life = |
|
⚫ |
| excretion = |
|
|
|
|
|
<!-- Identifiers --> |
|
⚫ |
| CAS_number = 7101-51-1 |
|
⚫ |
| ATC_prefix = N04 |
|
⚫ |
| ATC_suffix = BA04 |
|
⚫ |
| PubChem = 23497 |
|
⚫ |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
⚫ |
| DrugBank = |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 21968 |
|
| ChemSpiderID = 21968 |
|
⚫ |
| UNII_Ref = {{fdacite|correct|FDA}} |
|
⚫ |
| UNII = M30686U4X4 |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D07304 |
|
| KEGG = D07304 |
|
|
| synonyms = Levodopa methyl ester; <small>L</small>-DOPA methyl ester; LDME; CHF-1301 |
|
| InChI = 1/C10H13NO4/c1-15-10(14)7(11)4-6-2-3-8(12)9(13)5-6/h2-3,5,7,12-13H,4,11H2,1H3/t7-/m0/s1 |
|
|
|
|
|
| InChIKey = XBBDACCLCFWBSI-ZETCQYMHBU |
|
|
|
<!-- Chemical data --> |
| ⚫ |
| smiles = O=C(OC)(N)Cc1cc(O)c(O)cc1 |
|
|
⚫ |
| C=10 | H=13 | N=1 | O=4 |
|
⚫ |
| SMILES = O=C(OC)(N)Cc1cc(O)c(O)cc1 |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C10H13NO4/c1-15-10(14)7(11)4-6-2-3-8(12)9(13)5-6/h2-3,5,7,12-13H,4,11H2,1H3/t7-/m0/s1 |
|
| StdInChI = 1S/C10H13NO4/c1-15-10(14)7(11)4-6-2-3-8(12)9(13)5-6/h2-3,5,7,12-13H,4,11H2,1H3/t7-/m0/s1 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = XBBDACCLCFWBSI-ZETCQYMHSA-N |
|
| StdInChIKey = XBBDACCLCFWBSI-ZETCQYMHSA-N |
| ⚫ |
| CAS_number = 7101-51-1 |
|
| ⚫ |
| ATC_prefix = N04 |
|
| ⚫ |
| ATC_suffix = BA04 |
|
| ⚫ |
| PubChem = 23497 |
|
| ⚫ |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| ⚫ |
| DrugBank = |
|
| ⚫ |
| C=10|H=13|N=1|O=4 |
|
|
| molecular_weight = 211.215 g/mol |
|
| ⚫ |
| bioavailability = |
|
| ⚫ |
| protein_bound = |
|
| ⚫ |
| metabolism = |
|
| ⚫ |
| elimination_half-life = |
|
| ⚫ |
| excretion = |
|
| ⚫ |
| pregnancy_category= |
|
| ⚫ |
| legal_status = |
|
| ⚫ |
| routes_of_administration = |
|
|
}} |
|
}} |
|
|
|
|
|
|
'''Melevodopa''', also known as '''levodopa methyl ester''' ('''LDME''') and sold under the brand name '''Levomet''', is a ] agent. It is the ] ] of ].<ref name="BuckinghamBaggaleyRoberts2010">{{cite book | vauthors = Buckingham J, Baggaley K, Roberts A, Szabo L | title=Dictionary of Alkaloids with CD-ROM | publisher=CRC Press | year=2010 | isbn=978-1-4200-7770-4 | url=https://books.google.com/books?id=mynNBQAAQBAJ&pg=PA103 | access-date=28 September 2024 | page=103}}</ref> It is used in ] ] form as an effervescent ] with 250{{nbsp}}times the ] of tablet levodopa.<ref name="HickeyStacy2011">{{cite journal | vauthors = Hickey P, Stacy M | title = Available and emerging treatments for Parkinson's disease: a review | journal = Drug Design, Development and Therapy | volume = 5 | pages = 241–254 | year = 2011 | pmid = 21607020 | pmc = 3096539 | doi = 10.2147/DDDT.S11836 | doi-access = free }}</ref><ref name="StocchiMarconi2010">{{cite journal | vauthors = Stocchi F, Marconi S | title = Factors associated with motor fluctuations and dyskinesia in Parkinson Disease: potential role of a new melevodopa plus carbidopa formulation (Sirio) | journal = Clin Neuropharmacol | volume = 33 | issue = 4 | pages = 198–203 | date = July 2010 | pmid = 20414107 | doi = 10.1097/WNF.0b013e3181de8924 | url = }}</ref> In ] with ], as ] (brand name '''Sirio'''), it is approved for use in the treatment of ].<ref name="AdisInsight">{{cite web | title=Melevodopa/carbidopa | work = AdisInsight | publisher = Springer Nature Switzerland AG | date=23 September 2021 | url=https://adisinsight.springer.com/drugs/800010247 | access-date=27 September 2024}}</ref><ref name="DrugBank">{{cite web | title=Melevodopa: Uses, Interactions, Mechanism of Action | website=DrugBank Online | date=1 April 2015 | url=https://go.drugbank.com/drugs/DB13313 | access-date=27 September 2024}}</ref> |
|
'''Melevodopa''' is a ] agent. It is the ] ] of ]. |
|
|
|
|
|
|
== See also == |
|
==See also== |
|
* ] |
|
* ] |
|
|
* ] |
|
|
* ] |
|
|
|
|
|
== References == |
|
==References== |
|
{{Reflist|2}} |
|
{{Reflist}} |
|
|
|
|
|
|
|
|
|
|
{{Antiparkinson agents}} |
| ⚫ |
{{Antiparkinsonian}} |
|
|
|
{{Dopamine receptor modulators}} |
|
{{Dopaminergics}} |
|
|
{{Phenethylamines}} |
|
{{Phenethylamines}} |
|
|
|
|
|
⚫ |
] |
|
|
|
|
⚫ |
] |
|
|
|
| ⚫ |
] |
|
| ⚫ |
] |
|
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
] |
|
|
] |
|
⚫ |
] |
|
|
|
|
|
|
|
|
|
{{nervous-system-drug-stub}} |
|
{{Nervous-system-drug-stub}} |