| Revision as of 14:25, 8 July 2009 editEdgar181 (talk | contribs)Extended confirmed users196,325 edits chembox data, etc.← Previous edit |
Latest revision as of 23:41, 22 June 2023 edit undoHeadbomb (talk | contribs)Edit filter managers, Autopatrolled, Extended confirmed users, Page movers, File movers, New page reviewers, Pending changes reviewers, Rollbackers, Template editors454,366 edits ce |
| (20 intermediate revisions by 14 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
|ImageFile=Menogaril.png |
|
|
|
| Watchedfields = changed |
| ⚫ |
|ImageSize=200px |
|
|
|
| verifiedrevid = 300995705 |
| ⚫ |
|IUPACName= |
|
|
⚫ |
| ImageFile=Menogaril.png |
| ⚫ |
|OtherNames=7-''O''-Methylnogarol |
|
|
⚫ |
| ImageSize=200px |
|
⚫ |
| IUPACName= |
|
⚫ |
| OtherNames=7-''O''-Methylnogarol |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| UNII_Ref = {{fdacite|changed|FDA}} |
| ⚫ |
| CASNo=71628-96-1 |
|
|
|
| UNII = 8JSV4O30HQ |
| ⚫ |
| PubChem=320697 |
|
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| SMILES=C1(C(C2=C(C1)C=C3C(=C2O)C(=O)C4=C(C=C5C(=C4C3=O)OC6(((C5(O6)C)O)N(C)C)O)O)OC) |
|
|
⚫ |
| CASNo=71628-96-1 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 1234391 |
|
⚫ |
| PubChem = 5288818 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 4450900 |
|
|
| SMILES = CO1C(C)(O)Cc2cc3c(c(O)c21)C(=O)c1c(O)cc2c(c1C3=O)O1O2(C)(O)(N(C)C)1O |
|
|
| InChI = 1/C28H31NO10/c1-27(36)8-10-6-11-16(21(32)15(10)14(9-27)37-5)22(33)17-13(30)7-12-24(18(17)20(11)31)38-26-23(34)19(29(3)4)25(35)28(12,2)39-26/h6-7,14,19,23,25-26,30,32,34-36H,8-9H2,1-5H3/t14-,19+,23+,25-,26-,27-,28-/m1/s1 |
|
|
| InChIKey = LWYJUZBXGAFFLP-OCNCTQISBR |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C28H31NO10/c1-27(36)8-10-6-11-16(21(32)15(10)14(9-27)37-5)22(33)17-13(30)7-12-24(18(17)20(11)31)38-26-23(34)19(29(3)4)25(35)28(12,2)39-26/h6-7,14,19,23,25-26,30,32,34-36H,8-9H2,1-5H3/t14-,19+,23+,25-,26-,27-,28-/m1/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = LWYJUZBXGAFFLP-OCNCTQISSA-N |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>28</sub>H<sub>31</sub>NO<sub>10</sub> |
|
| Formula=C<sub>28</sub>H<sub>31</sub>NO<sub>10</sub> |
|
| MolarMass=541.55 g/mol |
|
| MolarMass=541.55 g/mol |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
|
'''Menogaril''' is an ] analog of ] which was developed in late 1970s. It has even stronger anticancer activity than nogalamycin and has less toxicity than nogalamycin. However, its development for clinical use was cancelled due to only moderate success with relatively high incidence of serious toxicity (43-44% in ] patients).<ref name="Moore 1999">{{cite journal | title=Phase II trial of menogaril in non-Hodgkin's lymphomas: a Southwest Oncology Group trial. |author1=Moore DF Jr |author2=Brown TD |author3=LeBlanc M |author4=Dahlberg S |author5=Miller TP |author6=McClure S |author7=Fisher RI. | journal=Invest New Drugs | year=1999 | volume=17 | issue=2 | pages=169–72 | doi=10.1023/A:1006375301205}}</ref> |
|
'''Menogaril''' is a ] analog. |
|
|
|
|
|
|
|
== References == |
|
|
<references/> |
|
|
|
|
|
|
{{Chemotherapeutic agents}} |
|
{{pharma-stub}} |
|
|
|
|
|
|
] |
|
] |
|
|
|
|
|
|
|
|
{{antineoplastic-drug-stub}} |