| Revision as of 14:29, 12 May 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (← Previous edit |
Latest revision as of 23:09, 4 May 2023 edit undoLegionMammal978 (talk | contribs)Extended confirmed users7,894 edits add semisystematic name |
| (20 intermediate revisions by 14 users not shown) |
| Line 1: |
Line 1: |
|
{{distinguish|methyl acetate}} |
|
{{distinguish|methyl acetate}} |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 379645294 |
|
|
|
| Watchedfields = changed |
| ⚫ |
|Reference=<ref> at ]</ref> |
|
|
⚫ |
| verifiedrevid = 428760115 |
| ⚫ |
|Name=<small>L</small>-Menthyl acetate |
|
|
⚫ |
| Reference = <ref> at ]</ref> |
| ⚫ |
|ImageFile=Menthyl acetate.png |
|
|
⚫ |
| Name = {{sm|l}}-Menthyl acetate |
| ⚫ |
|ImageSize=150px |
|
|
⚫ |
| ImageFile = Menthyl acetate.png |
| ⚫ |
|IUPACName=Acetic acid ester |
|
|
⚫ |
| ImageSize = 150px |
| ⚫ |
|OtherNames=(1''R'')-(−)-Menthyl acetate |
|
|
|
| IUPACName = (1''R'',3''R'',4''S'')-''p''-Menthan-3-yl acetate |
|
|Section1={{Chembox Identifiers |
|
|
|
| SystematicName = (1''R'',2''S'',5''R'')-5-Methyl-2-(propan-2-yl)cyclohexyl acetate |
| ⚫ |
| CASNo=2623-23-6 |
|
|
⚫ |
| OtherNames = (1''R'')-(−)-Menthyl acetate |
| ⚫ |
| PubChem=220674 |
|
|
|
Ethanoic (1''R'',2''S'',5''R'')-2-isopropyl-5-methylcyclohexane-1-carboxylate |
| ⚫ |
| SMILES=C1CC((C1)OC(=O)C)C(C)C |
|
|
⚫ |
Acetic (1''R'',2''S'',5''R'')-2-isopropyl-5-methylcyclohexane-1-carboxylate |
| ⚫ |
}} |
|
|
|Section2={{Chembox Properties |
|
| Section1 = {{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
| ⚫ |
| Formula=C<sub>12</sub>H<sub>22</sub>O<sub>2</sub> |
|
|
⚫ |
| CASNo = 2623-23-6 |
| ⚫ |
| MolarMass=198.30 g/mol |
|
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| Appearance= |
|
|
|
| UNII = W8C5F4H1OA |
| ⚫ |
| Density=0.92 g/mL |
|
|
⚫ |
| PubChem = 220674 |
| ⚫ |
| MeltingPt= |
|
|
⚫ |
| SMILES = C1CC((C1)OC(=O)C)C(C)C |
|
| BoilingPt=229-230 °C |
|
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
| ⚫ |
| Solubility= |
|
|
|
| ChemSpiderID = 191402 |
| ⚫ |
}} |
|
|
|
| InChI = 1/C12H22O2/c1-8(2)11-6-5-9(3)7-12(11)14-10(4)13/h8-9,11-12H,5-7H2,1-4H3/t9-,11+,12-/m1/s1 |
| ⚫ |
|Section3={{Chembox Hazards |
|
|
|
| InChIKey = XHXUANMFYXWVNG-ADEWGFFLBI |
| ⚫ |
| MainHazards= |
|
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
| FlashPt=77 °C |
|
|
|
| StdInChI = 1S/C12H22O2/c1-8(2)11-6-5-9(3)7-12(11)14-10(4)13/h8-9,11-12H,5-7H2,1-4H3/t9-,11+,12-/m1/s1 |
|
| Autoignition= |
|
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
| ⚫ |
}} |
|
|
|
| StdInChIKey = XHXUANMFYXWVNG-ADEWGFFLSA-N |
|
⚫ |
}} |
|
|
| Section2 = {{Chembox Properties |
|
⚫ |
| Formula = C<sub>12</sub>H<sub>22</sub>O<sub>2</sub> |
|
⚫ |
| MolarMass = 198.30 g/mol |
|
⚫ |
| Appearance = |
|
⚫ |
| Density = 0.92 g/mL |
|
⚫ |
| MeltingPt = |
|
|
| BoilingPtC = 229–230 |
|
|
| BoilingPt_notes = |
|
⚫ |
| Solubility = |
|
⚫ |
}} |
|
⚫ |
| Section3 = {{Chembox Hazards |
|
⚫ |
| MainHazards = |
|
|
| FlashPtC = 77 |
|
|
| AutoignitionPtC = |
|
⚫ |
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Menthyl acetate''' is a natural ] which contributes to the smell and flavor of ]. It is the ] ] of ]. Menthyl acetate constitutes 3-5% of the ] of '']''.<ref>''PDR for Herbal Medicines'', 4th Edition, Thomson Healthcare, page 640. ISBN 978-1563636783</ref> |
|
'''Menthyl acetate''' is a natural ] which contributes to the smell and flavor of ]. It is the ] ] of ]. Menthyl acetate constitutes 3–5% of the ] of '']'', contributing to its smell and flavour.<ref>''PDR for Herbal Medicines'', 4th Edition, Thomson Healthcare, page 640. {{ISBN|978-1-56363-678-3}}</ref><ref>''Nature’s Treatment for Irritable Bowel Syndrome: Studies on the Isolation of (−)-Menthol from Peppermint Oil and Its Conversion to (−)-Menthyl Acetate'' Maeve Egan, Éilis Margaret Connors, Zeeshan Anwar, and John J. Walsh Journal of Chemical Education 2015 92 (10), 1736-1740 {{doi|10.1021/ed5007037}}</ref> |
|
|
|
|
|
==References== |
|
==References== |
| Line 36: |
Line 53: |
|
] |
|
] |
|
] |
|
] |
|
|
|
|
] |
|