Misplaced Pages

Mephenytoin: Difference between revisions

Article snapshot taken from[REDACTED] with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
Browse history interactively
Page 1
Page 2
← Previous editContent deleted Content addedVisualWikitext
Revision as of 14:27, 18 January 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (no changed fields - added verified revid - updated 'ChEMBL_Ref') per Chem/Drugbox validation (report errors or [[user talk:CheMoB← Previous edit Latest revision as of 13:06, 13 January 2023 edit undoEntranced98 (talk | contribs)Extended confirmed users, Pending changes reviewers, Rollbackers174,416 edits +sd 
(27 intermediate revisions by 16 users not shown)
Line 1: Line 1:
{{short description|Chemical compound}}
{{Drugbox| verifiedrevid = 408588661
{{Drugbox
|
| Watchedfields = changed
|IUPAC_name = ''5-ethyl-3-methyl-5-phenyl-imidazolidine-2,4-dione''
| verifiedrevid = 459493896
| image=Mephenytoin.svg
| IUPAC_name = 5-Ethyl-3-methyl-5-phenyl-imidazolidine-2,4-dione
| width=120
| image = Mephenytoin.svg
| alt = Structural formula of mephenytoin
| width = 135
| image2 = Mephenytoin 3D spacefill.png
| alt2 = Space-filling model of the mephenytoin molecule
| width2 = 160

<!--Clinical data-->
| tradename =
| Drugs.com = {{drugs.com|CONS|mephenytoin}}
| MedlinePlus = a611020
| pregnancy_US = C
| legal_status =
| routes_of_administration = Oral

<!--Pharmacokinetic data-->
| bioavailability =
| metabolism = ]
| elimination_half-life = 7 hours
| excretion =

<!--Identifiers-->
| IUPHAR_ligand = 7223
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 50-12-4
| ATC_prefix = N03
| ATC_suffix = AB04
| ATC_supplemental=
| PubChem = 4060
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB00532
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 3920 | ChemSpiderID = 3920
| UNII_Ref = {{fdacite|correct|FDA}} | UNII_Ref = {{fdacite|correct|FDA}}
| UNII = R420KW629U | UNII = R420KW629U
| KEGG_Ref = {{keggcite|correct|kegg}}
| InChI = 1/C12H14N2O2/c1-3-12(9-7-5-4-6-8-9)10(15)14(2)11(16)13-12/h4-8H,3H2,1-2H3,(H,13,16)
| KEGG = D00375
| InChIKey = GMHKMTDVRCWUDX-UHFFFAOYAK
| smiles = O=C2N(C(=O)NC2(c1ccccc1)CC)C
| ChEMBL_Ref = {{ebicite|correct|EBI}} | ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 861 | ChEMBL = 861

<!--Chemical data-->
| C=12 | H=14 | N=2 | O=2
| smiles = O=C2N(C(=O)NC2(c1ccccc1)CC)C
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C12H14N2O2/c1-3-12(9-7-5-4-6-8-9)10(15)14(2)11(16)13-12/h4-8H,3H2,1-2H3,(H,13,16) | StdInChI = 1S/C12H14N2O2/c1-3-12(9-7-5-4-6-8-9)10(15)14(2)11(16)13-12/h4-8H,3H2,1-2H3,(H,13,16)
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = GMHKMTDVRCWUDX-UHFFFAOYSA-N | StdInChIKey = GMHKMTDVRCWUDX-UHFFFAOYSA-N
| CAS_number=50-12-4
| CASNo_Ref = {{cascite|correct|CAS}}
| ATC_prefix=N03
| ATC_suffix=AB04
| PubChem=4060
| DrugBank=APRD00512
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D00375
| C=12 | H=14 | N=2 | O=2
| molecular_weight = 218.252
| elimination_half-life= 7 hours
| pregnancy_US = C
| routes_of_administration= Oral
}} }}

<!--
| ATC_supplemental=
| bioavailability=
| metabolism = Cyp 2C19
| excretion =
| legal_status =
-->
'''Mephenytoin''' (marketed as '''Mesantoin''' by Novartis) is a ], used as an ]. It was introduced approximately 10 years after ], in the late 1940s. The significant ] of mephenytoin is ] (5-ethyl-5-phenylhydantoin), which was the first hydantoin (briefly used as a ]). However, nirvanol is quite toxic and mephenytoin was only considered after other less toxic anticonvulsants had failed. It can cause potentially fatal blood ] in 1% of patients. '''Mephenytoin''' (marketed as '''Mesantoin''' by Novartis) is a ], used as an ]. It was introduced approximately 10 years after ], in the late 1940s. The significant ] of mephenytoin is ] (5-ethyl-5-phenylhydantoin), which was the first hydantoin (briefly used as a ]). However, nirvanol is quite toxic and mephenytoin was only considered after other less toxic anticonvulsants had failed. It can cause potentially fatal blood ] in 1% of patients.


Line 43: Line 58:


==References== ==References==
{{refbegin}}
* ''The Treatment of Epilepsy'' edited by S. D. Shorvon, David R. Fish, Emilio Perucca, W. Edwin Dodson. Blackwell Publishing. 2004. ISBN 0-632-06046-8
* ''The Medical Treatment of Epilepsy'' by Stanley R Resor. Published by Marcel Dekker (1991). ISBN 0-8247-8549-5. * {{cite book | title = The Treatment of Epilepsy | veditors = Shorvon SD, Fish DR, Perucca E, Dodson WE | publisher = Blackwell Publishing | date = 2004 | isbn = 0-632-06046-8 }}
* {{cite book | title = The Medical Treatment of Epilepsy | vauthors = Resor SR | publisher = Marcel Dekker | date = 1991 | isbn = 0-8247-8549-5 }}
* * {{cite web | url = http://ctdbase.org/detail.go?type=chem&acc=D008617 | work = The Comparative Toxicogenomics Database | title = Mephenytoin }}
{{refend}}


{{Anticonvulsants}} {{Anticonvulsants}}
Mephenytoin: Difference between revisions Add topic