| Revision as of 18:31, 7 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Script assisted update of identifiers for the Chem/Drugbox validation project (updated: 'DrugBank').← Previous edit |
Latest revision as of 13:06, 13 January 2023 edit undoEntranced98 (talk | contribs)Extended confirmed users, Pending changes reviewers, Rollbackers172,972 edits +sd |
| (21 intermediate revisions by 15 users not shown) |
| Line 1: |
Line 1: |
|
|
{{short description|Chemical compound}} |
|
{{Drugbox |
|
{{Drugbox |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 408590253 |
|
| verifiedrevid = 459493896 |
|
| IUPAC_name = ''5-ethyl-3-methyl-5-phenyl-imidazolidine-2,4-dione'' |
|
| IUPAC_name = 5-Ethyl-3-methyl-5-phenyl-imidazolidine-2,4-dione |
|
| image = Mephenytoin.svg |
|
| image = Mephenytoin.svg |
|
|
| alt = Structural formula of mephenytoin |
|
| width = 120 |
|
| width = 135 |
|
|
| image2 = Mephenytoin 3D spacefill.png |
|
|
| alt2 = Space-filling model of the mephenytoin molecule |
|
|
| width2 = 160 |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
|
| Drugs.com = {{drugs.com|CONS|mephenytoin}} |
|
| Drugs.com = {{drugs.com|CONS|mephenytoin}} |
|
| MedlinePlus = a611020 |
|
| MedlinePlus = a611020 |
|
| pregnancy_US = C |
|
| pregnancy_US = C |
|
⚫ |
| legal_status = |
|
| routes_of_administration = Oral |
|
| routes_of_administration = Oral |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
⚫ |
| bioavailability = |
|
⚫ |
| metabolism = ] |
|
| elimination_half-life = 7 hours |
|
| elimination_half-life = 7 hours |
|
⚫ |
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| IUPHAR_ligand = 7223 |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = 50-12-4 |
|
| CAS_number = 50-12-4 |
|
| ATC_prefix = N03 |
|
| ATC_prefix = N03 |
|
| ATC_suffix = AB04 |
|
| ATC_suffix = AB04 |
|
⚫ |
| ATC_supplemental= |
|
| PubChem = 4060 |
|
| PubChem = 4060 |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
| Line 34: |
Line 45: |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=12 | H=14 | N=2 | O=2 |
|
| C=12 | H=14 | N=2 | O=2 |
|
| molecular_weight = 218.252 |
|
|
| smiles = O=C2N(C(=O)NC2(c1ccccc1)CC)C |
|
| smiles = O=C2N(C(=O)NC2(c1ccccc1)CC)C |
|
| InChI = 1/C12H14N2O2/c1-3-12(9-7-5-4-6-8-9)10(15)14(2)11(16)13-12/h4-8H,3H2,1-2H3,(H,13,16) |
|
|
| InChIKey = GMHKMTDVRCWUDX-UHFFFAOYAK |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C12H14N2O2/c1-3-12(9-7-5-4-6-8-9)10(15)14(2)11(16)13-12/h4-8H,3H2,1-2H3,(H,13,16) |
|
| StdInChI = 1S/C12H14N2O2/c1-3-12(9-7-5-4-6-8-9)10(15)14(2)11(16)13-12/h4-8H,3H2,1-2H3,(H,13,16) |
| Line 44: |
Line 52: |
|
| StdInChIKey = GMHKMTDVRCWUDX-UHFFFAOYSA-N |
|
| StdInChIKey = GMHKMTDVRCWUDX-UHFFFAOYSA-N |
|
}} |
|
}} |
|
|
|
|
<!-- |
|
| ⚫ |
| ATC_supplemental= |
|
| ⚫ |
| bioavailability= |
|
| ⚫ |
| metabolism = Cyp 2C19 |
|
| ⚫ |
| excretion = |
|
| ⚫ |
| legal_status = |
|
|
--> |
|
|
'''Mephenytoin''' (marketed as '''Mesantoin''' by Novartis) is a ], used as an ]. It was introduced approximately 10 years after ], in the late 1940s. The significant ] of mephenytoin is ] (5-ethyl-5-phenylhydantoin), which was the first hydantoin (briefly used as a ]). However, nirvanol is quite toxic and mephenytoin was only considered after other less toxic anticonvulsants had failed. It can cause potentially fatal blood ] in 1% of patients. |
|
'''Mephenytoin''' (marketed as '''Mesantoin''' by Novartis) is a ], used as an ]. It was introduced approximately 10 years after ], in the late 1940s. The significant ] of mephenytoin is ] (5-ethyl-5-phenylhydantoin), which was the first hydantoin (briefly used as a ]). However, nirvanol is quite toxic and mephenytoin was only considered after other less toxic anticonvulsants had failed. It can cause potentially fatal blood ] in 1% of patients. |
|
|
|
|
| Line 56: |
Line 58: |
|
|
|
|
|
==References== |
|
==References== |
|
|
{{refbegin}} |
|
* ''The Treatment of Epilepsy'' edited by S. D. Shorvon, David R. Fish, Emilio Perucca, W. Edwin Dodson. Blackwell Publishing. 2004. ISBN 0-632-06046-8 |
|
|
* ''The Medical Treatment of Epilepsy'' by Stanley R Resor. Published by Marcel Dekker (1991). ISBN 0-8247-8549-5. |
|
* {{cite book | title = The Treatment of Epilepsy | veditors = Shorvon SD, Fish DR, Perucca E, Dodson WE | publisher = Blackwell Publishing | date = 2004 | isbn = 0-632-06046-8 }} |
|
|
* {{cite book | title = The Medical Treatment of Epilepsy | vauthors = Resor SR | publisher = Marcel Dekker | date = 1991 | isbn = 0-8247-8549-5 }} |
|
* |
|
* {{cite web | url = http://ctdbase.org/detail.go?type=chem&acc=D008617 | work = The Comparative Toxicogenomics Database | title = Mephenytoin }} |
|
|
{{refend}} |
|
|
|
|
|
{{Anticonvulsants}} |
|
{{Anticonvulsants}} |