| Revision as of 11:57, 24 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 457279625 of page Meptazinol for the Chem/Drugbox validation project (updated: 'CAS_number'). |
Latest revision as of 13:00, 21 October 2024 edit JWBE (talk | contribs)Extended confirmed users10,126 edits removed Category:Phenols; added Category:3-Hydroxyphenyl compounds using HotCat |
| Line 1: |
Line 1: |
|
|
{{Short description|Opioid analgesic drug}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{Drugbox |
|
{{Drugbox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 408589699 |
|
| verifiedrevid = 462248630 |
|
| IUPAC_name = (''RS'')-3-(3-ethyl-1-methylazepan-3-yl)phenol |
|
| IUPAC_name = (''RS'')-3-(3-Ethyl-1-methylazepan-3-yl)phenol |
|
| image = Meptazinol Enantiomers Structural Formulae.png |
|
|
| width = 200 |
|
| image = Meptazinol.svg |
|
| image2 = |
|
| width = 150 |
|
|
| chirality = ] |
| ⚫ |
| width2 = |
|
|
⚫ |
<!--Clinical data-->| tradename = Meptid |
|
| imagename = 1 : 1 mixture (racemate) |
|
|
| drug_name = Meptazinol |
|
|
|
|
| ⚫ |
<!--Clinical data--> |
|
|
| tradename = |
|
|
| Drugs.com = {{drugs.com|international|meptazinol}} |
|
| Drugs.com = {{drugs.com|international|meptazinol}} |
|
| licence_EU = <!-- EMEA requires brand name --> |
|
| licence_EU = <!-- EMEA requires brand name --> |
| Line 18: |
Line 14: |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| pregnancy_category = |
|
| pregnancy_category = |
|
|
| legal_AU = Schedule 4 |
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
|
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| legal_UK = POM |
|
| legal_UK = POM |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_status = |
|
| legal_status = |
|
| dependency_liability = Low |
|
| dependency_liability = Low |
|
| routes_of_administration = Oral, ], ] |
|
| routes_of_administration = ], ], ] |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data-->| bioavailability = |
|
| bioavailability = |
|
| protein_bound = |
|
⚫ |
| metabolism = The peak analgesic effect is seen within 30–60 minutes and lasts about 3–4 hours |
|
| protein_bound = |
|
|
⚫ |
| elimination_half-life = Half-life (1.4–4 hours) |
| ⚫ |
| metabolism = The peak analgesic effect is seen within 30–60 minutes and lasts about 3–4 hours. |
|
|
⚫ |
| excretion = The drug is rapidly metabolized to the ], and mostly excreted in the urine |
| ⚫ |
| elimination_half-life = Half-Life (1.4–4 hours). |
|
| ⚫ |
| excretion = The drug is rapidly metabolised to the glucuronide, and mostly excreted in the urine. |
|
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers-->| class = ] |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| index2_label = HCl |
|
|
| CAS_number_Ref = {{cascite|correct|CAS}} |
|
| CAS_number = <!-- blanked - oldvalue: 54340-58-8 --> |
|
| CAS_number = 54340-58-8 |
|
|
| CAS_number2_Ref = {{cascite|correct|CAS}} |
|
|
| CAS_number2 = 59263-76-2 |
|
⚫ |
| UNII_Ref = {{fdacite|correct|FDA}} |
|
⚫ |
| UNII = 18Y7S5JKZD |
|
|
| UNII2_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII2 = T62FQ4ZCPA |
|
| ATC_prefix = N02 |
|
| ATC_prefix = N02 |
|
| ATC_suffix = AX05 |
|
| ATC_suffix = AX05 |
|
| ATC_supplemental = |
|
| ATC_supplemental = |
|
| PubChem = 41049 |
|
| PubChem = 41049 |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = |
|
| DrugBank = |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 37469 |
|
| ChemSpiderID = 37469 |
| ⚫ |
| UNII_Ref = {{fdacite|changed|FDA}} |
|
| ⚫ |
| UNII = 18Y7S5JKZD |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D08182 |
|
| KEGG = D08182 |
| Line 52: |
Line 52: |
|
| ChEMBL = 314437 |
|
| ChEMBL = 314437 |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data-->| C = 15 |
|
| chemical_formula = |
|
| H = 23 |
|
| C=15 | H=23 | N=1 | O=1 |
|
| N = 1 |
|
⚫ |
| O = 1 |
|
| molecular_weight = 233.34922 g/mol |
|
|
| smiles = Oc1cccc(c1)C2(CC)CCCCN(C)C2 |
|
| smiles = OC1=CC=CC(C2(CCCCN(C2)C)CC)=C1 |
|
| InChI = 1/C15H23NO/c1-3-15(9-4-5-10-16(2)12-15)13-7-6-8-14(17)11-13/h6-8,11,17H,3-5,9-10,12H2,1-2H3 |
|
|
| InChIKey = JLICHNCFTLFZJN-UHFFFAOYAS |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C15H23NO/c1-3-15(9-4-5-10-16(2)12-15)13-7-6-8-14(17)11-13/h6-8,11,17H,3-5,9-10,12H2,1-2H3 |
|
| StdInChI = 1S/C15H23NO/c1-3-15(9-4-5-10-16(2)12-15)13-7-6-8-14(17)11-13/h6-8,11,17H,3-5,9-10,12H2,1-2H3 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = JLICHNCFTLFZJN-UHFFFAOYSA-N |
|
| StdInChIKey = JLICHNCFTLFZJN-UHFFFAOYSA-N |
|
| synonyms = |
|
| synonyms = |
|
| density = |
|
| density = |
|
| melting_notes = |
|
| melting_notes = |
|
| boiling_point = |
|
| boiling_point = |
|
| solubility = |
|
| solubility = |
|
| specific_rotation = |
|
| specific_rotation = |
|
| sec_combustion = |
|
| sec_combustion = |
|
}} |
|
}} |
|
|
|
|
|
'''Meptazinol''', sold under the brand name '''Meptid''', is an ] ] developed by ] in the 1970s.<ref>{{ cite patent | country = US | status = patent | number = 4197239 | title = Hexahydroazepine, Piperidine and Pyrrolidine Derivatives | gdate = 1980-04-08 | inventor = Cavalla JF, Shepherd RG, White AC | assign1 = Wyeth }}</ref> Indications for use in moderate to severe ], most commonly used to treat pain in ] (]). |
|
|
|
|
|
Meptazinol is a 3-phenylazepane derivative, whereas the other phenazepanes like ] and ] are ]s. |
|
|
|
|
|
A partial ] ], its mixed ]/] activity affords it a lower risk of ] and ] than full μ ]s like ]. Meptazinol exhibits not only a short onset of action, but also a shorter duration of action relative to other ]s such as ], ], or ].<ref name="Holmes 1985">{{ cite journal |vauthors=Holmes B, Ward A | title = Meptazinol. A Review of its Pharmacodynamic and Pharmacokinetic Properties and Therapeutic Efficacy | journal = Drugs | year = 1985 | volume = 30 | issue = 4 | pages = 285–312 | pmid = 2998723 | doi=10.2165/00003495-198530040-00001| s2cid = 208818234 }}</ref> |
|
|
|
|
|
==References== |
|
|
{{Reflist|30em}} |
|
|
|
|
|
==External links== |
|
|
* {{MeshName|Meptazinol}} |
|
|
|
|
|
{{Analgesics}} |
|
|
{{Opioidergics}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
|
|
|
{{analgesic-stub}} |