| Revision as of 09:02, 2 June 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (changes to verified fields - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref') per Chem/Drugbox validation (report [[Wikipedia_talk:Wi← Previous edit |
Latest revision as of 11:50, 17 March 2021 edit undoLegionMammal978 (talk | contribs)Extended confirmed users7,894 editsm moved PIN |
| (13 intermediate revisions by 12 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 343030096 |
|
| verifiedrevid = 432143455 |
|
| ImageFile = Methazole.png |
|
| ImageFile = Methazole.png |
|
| ImageSize = 200px |
|
| ImageSize = 200 |
|
|
| ImageAlt = Skeletal formula of methazole |
| ⚫ |
| IUPACName = 2-(3,4-Dichlorophenyl)-4-methyl-1,2,4-oxadiazolidine-3,5-dione |
|
|
|
| ImageFile1 = Methazole-3D-spacefill.png |
| ⚫ |
| OtherNames = Metazole<br>Oxydiazol<br>VCS 438<br>Paxilon<br>Probe |
|
|
|
| ImageSize1 = 200 |
| ⚫ |
| Section1 = {{Chembox Identifiers |
|
|
|
| ImageAlt1 = Space-filling model of methazole |
| ⚫ |
| CASNo = 20354-26-1 |
|
|
⚫ |
| PIN = 2-(3,4-Dichlorophenyl)-4-methyl-1,2,4-oxadiazolidine-3,5-dione |
| ⚫ |
| PubChem = 4690 |
|
|
⚫ |
| OtherNames = Metazole; Oxydiazol; VCS 438; Paxilon; Probe; Metazol; Mezopur; Oxydiazol; Bioxone; Chlormethazole |
| ⚫ |
| KEGG_Ref = {{keggcite|changed|kegg}} |
|
|
⚫ |
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
⚫ |
| CASNo = 20354-26-1 |
|
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
|
| UNII = E35M7EMD3V |
|
⚫ |
| PubChem = 4690 |
|
⚫ |
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = C19123 |
|
| KEGG = C19123 |
|
| SMILES = CN1C(=O)N(OC1=O)C2=CC(=C(C=C2)Cl)Cl |
|
| SMILES = CN1C(=O)N(OC1=O)C2=CC(=C(C=C2)Cl)Cl |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 4528 |
|
|
| InChI = 1/C9H6Cl2N2O3/c1-12-8(14)13(16-9(12)15)5-2-3-6(10)7(11)4-5/h2-4H,1H3 |
|
|
| InChIKey = LRUUNMYPIBZBQH-UHFFFAOYAP |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C9H6Cl2N2O3/c1-12-8(14)13(16-9(12)15)5-2-3-6(10)7(11)4-5/h2-4H,1H3 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = LRUUNMYPIBZBQH-UHFFFAOYSA-N |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C=9|H=6|Cl=2|N=2|O=3 |
|
| Formula = C<sub>9</sub>H<sub>6</sub>Cl<sub>2</sub>N<sub>2</sub>O<sub>3</sub> |
|
|
|
| Appearance = |
|
| MolarMass = 261.061 g/mol |
|
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = |
|
| MeltingPt = |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = |
|
| Solubility = |
|
|
}} |
|
}} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = |
|
| AutoignitionPt = |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Methazole''' (C<sub>9</sub>H<sub>6</sub>Cl<sub>2</sub>N<sub>2</sub>O<sub>3</sub>) is a ] in the family of herbicides known as oxadiazolones. |
|
'''Methazole''' (C<sub>9</sub>H<sub>6</sub>Cl<sub>2</sub>N<sub>2</sub>O<sub>3</sub>) is an obsolete<ref name=Hertfordshire>{{cite web | url = https://sitem.herts.ac.uk/aeru/iupac/Reports/454.htm | title = Methazole | publisher = University of Hertfordshire}}</ref> ] in the family of herbicides known as ]s. It was used as a post-emergent treatment for controlling weeds.<ref name=Hertfordshire/> |
|
|
|
|
|
==References== |
|
==References== |
|
{{Unreferenced|date=November 2008}} |
|
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
| Line 39: |
Line 53: |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
|
|
|
|
{{heterocyclic-stub}} |
|
{{heterocyclic-stub}} |
|
|
|
|
] |
|