| Revision as of 15:42, 24 February 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Script assisted update of identifiers from ChemSpider, CommonChemistry and FDA for the Chem/Drugbox validation project - Updated: ChEMBL KEGG.← Previous edit |
Latest revision as of 23:29, 13 July 2022 edit undoInternetArchiveBot (talk | contribs)Bots, Pending changes reviewers5,384,382 edits Rescuing 1 sources and tagging 0 as dead.) #IABot (v2.0.8.8) (Ost316 - 10367 |
| (33 intermediate revisions by 25 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 402389513 |
|
|
|
| Watchedfields = changed |
| ⚫ |
|ImageFile=Methidathion.png |
|
|
⚫ |
| verifiedrevid = 415702375 |
| ⚫ |
|ImageSize=200px |
|
|
⚫ |
| ImageFile=Methidathion vector.svg |
|
|IUPACName=3-(dimethoxyphosphinothioylsulfanylmethyl)-5-methoxy-1,3,4-thiadiazol-2-one |
|
|
⚫ |
| ImageSize=200px |
| ⚫ |
|OtherNames= Supracide, Ultracide, Suprathion |
|
|
|
| PIN=''S''- ''O'',''O''-dimethyl phosphorodithioate |
| ⚫ |
|Section1= {{Chembox Identifiers |
|
|
⚫ |
| OtherNames= Supracide, Ultracide, Suprathion |
| ⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
⚫ |
|Section1={{Chembox Identifiers |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 13115 |
|
| ChemSpiderID = 13115 |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = C14431 |
|
| KEGG = C14431 |
|
| InChI = 1/C6H11N2O4PS3/c1-10-5-7-8(6(9)16-5)4-15-13(14,11-2)12-3/h4H2,1-3H3 |
|
| InChI = 1/C6H11N2O4PS3/c1-10-5-7-8(6(9)16-5)4-15-13(14,11-2)12-3/h4H2,1-3H3 |
|
| InChIKey = MEBQXILRKZHVCX-UHFFFAOYAL |
|
| InChIKey = MEBQXILRKZHVCX-UHFFFAOYAL |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 226651 |
|
| ChEMBL = 226651 |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
| Line 18: |
Line 22: |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo=950-37-8 |
|
| CASNo=950-37-8 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| PubChem=13709 |
|
|
|
| UNII = Y2P145U7KK |
| ⚫ |
| SMILES = O=C1SC(=N/N1CSP(=S)(OC)OC)\OC |
|
|
⚫ |
| PubChem=13709 |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 34837 |
|
⚫ |
| SMILES = O=C1SC(=N/N1CSP(=S)(OC)OC)\OC |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>6</sub>H<sub>11</sub>N<sub>2</sub>O<sub>4</sub>PS<sub>3</sub> |
|
| Formula=C<sub>6</sub>H<sub>11</sub>N<sub>2</sub>O<sub>4</sub>PS<sub>3</sub> |
|
| MolarMass=302.331 |
|
| MolarMass=302.331 g/mol |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3= {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
|
'''Methidathion''' is an ] ];<ref>{{cite journal|title=The effects of methidathion on liver: role of vitamins E and C|journal=Toxicology and Industrial Health|volume=19|issue=2–6|pages=63–67|doi=10.1191/0748233703th176oa|pmid=15697176|year=2016|last1=Gokalp|first1=Osman|last2=Gulle|first2=Kanat|last3=Sulak|first3=Osman|last4=Cicek|first4=Ekrem|last5=Altuntas|first5=Irfan|s2cid=23209774}}</ref> its use is banned in the European Union and USA.<ref>{{Cite web |url=http://www.pan-europe.info/Resources/Links/Banned_in_the_EU.pdf |title=Archived copy |access-date=2012-03-02 |archive-date=2013-06-05 |archive-url=https://web.archive.org/web/20130605090824/http://www.pan-europe.info/Resources/Links/Banned_in_the_EU.pdf |url-status=dead }}</ref> |
|
'''Methidathion''' is an ] ].<ref><!-- dead link--></ref> |
|
|
|
|
|
|
Methidathion has been used as an insecticide in many countries to control caterpillars of '']''.<ref>{{cite web | url=http://kiengiangbiospherereserve.com.vn/project/uploads/doc/12.Control_bark_eating_caterpillar.pdf | title=CONTROL OF BARK EATING CATERPILLAR | publisher=German Development Cooperation | access-date=13 July 2016 | url-status=dead | archive-url=https://web.archive.org/web/20160813081430/http://kiengiangbiospherereserve.com.vn/project/uploads/doc/12.Control_bark_eating_caterpillar.pdf | archive-date=13 August 2016 }}</ref> |
|
|
|
|
|
In 2012, residues were found in Thai vegetables at levels 100 times the legal limit. ] routinely uses many pesticides banned in the US and EU and in amounts far exceeding limits.<ref>{{Cite web|url=http://www.nationmultimedia.com/life/The-pesticides-on-our-plates-30188702.html|title = Nation Thailand news website, thai news, thailand news, Bangkok thailand, aec, breaking news : Nation Thailand}}</ref> |
|
|
|
|
|
==References== |
|
==References== |
| Line 45: |
Line 57: |
|
* |
|
* |
|
|
|
|
|
{{insecticides}} |
|
{{Insecticides}} |
|
|
{{Acetylcholine metabolism and transport modulators}} |
|
{{Cholinergics}} |
|
| ⚫ |
{{organic-compound-stub}} |
|
|
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
|
|
⚫ |
{{organic-compound-stub}} |