Revision as of 12:58, 11 April 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (changes to watched fields - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (report [[Wikipe← Previous edit |
Latest revision as of 04:58, 28 February 2024 edit undoChem Sim 2001 (talk | contribs)Extended confirmed users576 edits restored high-quality PNG drawn according to MoS |
(61 intermediate revisions by 40 users not shown) |
Line 1: |
Line 1: |
|
{{chembox |
|
{{Chembox |
|
|
| Verifiedfields = changed |
|
| Watchedfields = changed |
|
| Watchedfields = changed |
|
| verifiedrevid = 395933124 |
|
| verifiedrevid = 423505240 |
|
|Reference=<ref name=goodscent>, at goodscents.com</ref><ref>, at Sigma-Aldrich</ref> |
|
| Reference = <ref name=goodscent>, at goodscents.com</ref><ref>, at Sigma-Aldrich</ref> |
|
| ImageFile = Methyl cinnamate.png |
|
| ImageFile = Methyl cinnamate.png |
|
| ImageSize = 190px |
|
| ImageSize = 190px |
|
| ImageName = Skeletal formula |
|
| ImageAlt = Skeletal formula of methyl cinnamate |
|
| ImageFile1 = Methyl-cinnamate-3D-balls.png |
|
| ImageFile1 = Methyl cinnamate 3D spacefill.png |
|
| ImageName1 = Ball-and-stick model |
|
| ImageAlt1 = Ball-and-stick model of the methyl cinnamate molecule |
|
| IUPACName = Methyl (''E'')-3-Phenylprop-2-enoate |
|
| PIN = Methyl (2''E'')-3-phenylprop-2-enoate |
|
| OtherNames = |
|
| OtherNames = Methyl cinnamate |
|
|Section1= {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo=1754-62-7 |
|
|
|
| CASNo = 103-26-4 |
|
| PubChem=637520 |
|
|
|
| ChEBI = 6857 |
|
| EINECS=203-093-8 |
|
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| SMILES=COC(=O)C=CC1=CC=CC=C1 |
|
|
|
| ChEMBL = 55060 |
|
}} |
|
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|Section2= {{Chembox Properties |
|
|
|
| ChemSpiderID = 21105944 |
|
| Formula=C<sub>10</sub>H<sub>10</sub>O<sub>2</sub> |
|
|
|
| EINECS = 203-093-8 |
|
| MolarMass=162.185 g/mol |
|
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| Appearance= |
|
|
|
| KEGG = C06358 |
|
| Density=1.092 g/cm^3 |
|
|
|
| PubChem = 637520 |
|
| MeltingPt=34-38 °C |
|
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| BoilingPt=261-262 °C |
|
|
|
| UNII = 533CV2ZCQL |
|
| Solubility=Insoluble |
|
|
|
| InChI = 1/C10H10O2/c1-12-10(11)8-7-9-5-3-2-4-6-9/h2-8H,1H3/b8-7+ |
|
}} |
|
|
|
| InChIKey = CCRCUPLGCSFEDV-BQYQJAHWBN |
|
|Section3= {{Chembox Hazards |
|
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
| MainHazards= |
|
|
|
| StdInChI = 1S/C10H10O2/c1-12-10(11)8-7-9-5-3-2-4-6-9/h2-8H,1H3/b8-7+ |
|
| FlashPt= >230 °F |
|
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
| Autoignition= |
|
|
|
| StdInChIKey = CCRCUPLGCSFEDV-BQYQJAHWSA-N |
|
| SPhrases={{S22}} {{S24/25}} |
|
|
|
| SMILES = COC(=O)C=CC1=CC=CC=C1 |
|
}} |
|
|
|
}} |
|
|
|Section2={{Chembox Properties |
|
|
| C=10|H=10|O=2 |
|
|
| Appearance = |
|
|
| Density = 1.092{{nbsp}}g/cm<sup>3</sup> |
|
|
| MeltingPtC = 34–38 |
|
|
| BoilingPtC = 261–262 |
|
|
| Solubility = Insoluble |
|
|
}} |
|
|
|Section3={{Chembox Hazards |
|
|
| MainHazards = |
|
|
| FlashPt = > |
|
|
| FlashPtC = 110 |
|
|
| AutoignitionPt = |
|
|
| GHS_ref=<ref>{{cite web |title=Methyl cinnamate |url=https://pubchem.ncbi.nlm.nih.gov/compound/637520#section=Safety-and-Hazards |website=pubchem.ncbi.nlm.nih.gov |language=en}}</ref> |
|
|
| GHSPictograms = {{GHS07}} |
|
|
| GHSSignalWord = Warning |
|
|
| HPhrases = {{H-phrases|317}} |
|
|
| PPhrases = {{P-phrases|261|272|280|302+352|321|333+313|363|501}} |
|
|
}} |
|
}} |
|
}} |
|
|
'''Methyl cinnamate''' is the ] ] of ] and is a white or transparent solid with a strong, aromatic odor. It is found naturally in a variety of plants, including in fruits, like ], and some culinary spices, such as ] and some varieties of ].<ref>{{cite journal | doi = 10.1590/S0103-50532003000500008 | title = Essential oil composition from twelve varieties of basil (Ocimum spp) grown in Colombia | year = 2003 | last1 = Viña | first1 = Amparo | last2 = Murillo | first2 = Elizabeth | journal = Journal of the Brazilian Chemical Society | volume = 14 | issue = 5 | pages = 744–9 | doi-access = free }}</ref> '']'' has the highest known concentrations of methyl cinnamate (98%) with a 2–6% fresh weight yield in the leaf and twigs.<ref>{{Cite book | vauthors = Boland DJ, Brophy JJ,((House APN)) | title = Eucalyptus Leaf Oils | year = 1991 | isbn = 978-0-909605-69-8}}</ref> |
|
|
|
|
|
|
Methyl cinnamate is used in the flavor and perfume industries. The flavor is fruity and strawberry-like; and the odor is sweet, balsamic with fruity odor, reminiscent of cinnamon and strawberry.<ref name=goodscent/> |
|
|
|
|
|
|
It is known to attract males of various ]s, such as '']''.<ref>{{cite journal | doi = 10.2307/1541248 | last1 = Williams | first1 = N.H. | last2 = Whitten | first2 = W.M. | year = 1983 | title = Orchid floral fragrances and male euglossine bees: methods and advances in the last sesquidecade | journal = Biol. Bull. | volume = 164 | issue = 3| pages = 355–395 | jstor = 1541248 | url = https://www.biodiversitylibrary.org/part/35261 }}</ref> |
|
'''Methyl cinnamate''' is the ] ] of ] and is a white or transparent solid with a strong, aromatic odor. It is found naturally in a variety of plants, including in fruits, like ], and some culinary spices, such as ] and some varieties of ].<ref>Amparo Viña; Elizabeth Murillo, ''Essential oil composition from twelve varieties of basil (Ocimum spp) grown in Colombia'', Journal of the Brazilian Chemical Society, vol.14 no.5 São Paulo Sept./Oct. 2003 http://www.scielo.br/scielo.php?script=sci_arttext&pid=S0103-50532003000500008</ref><ref name=lookchem/> '']'' has the highest known concentrations of methyl cinnamate (98%) with a 2-6% fresh weight yield in the leaf and twigs.<ref>Boland, D.J., Brophy, J.J., and A.P.N. House, ''Eucalyptus Leaf Oils'', 1991, ISBN 0-909605-69-6</ref> |
|
|
|
|
|
|
|
]{{clear left}} |
|
Methyl cinnamate is used in the flavor and perfume industries. The flavor is fruity and strawberry-like; and the odor is sweet, balsamic with fruity odor, reminiscent of cinnamon and strawberry.<ref name=goodscent/> |
|
|
|
|
|
|
It is known to attract males of various ]s, such as '']''.<ref>{{cite journal | doi = 10.2307/1541248 | last1 = Williams | first1 = N.H. | last2 = Whitten | first2 = W.M. | year = 1983 | title = Orchid floral fragrances and male euglossine bees: methods and advances in the last sesquidecade | url = | journal = Biol. Bull. | volume = 164 | issue = 3| pages = 355–395 }}</ref> |
|
|
|
|
|
] |
|
|
{{clearleft}} |
|
|
== List of plants that contain the chemical == |
|
== List of plants that contain the chemical == |
|
* '']'' 'Strawberry gum' |
|
* '']'' 'Strawberry Gum' |
|
|
* '']'' South American (Ecuadorian) Cinnamon, Ishpingo<ref>{{cite journal |doi=10.1016/j.foodchem.2003.07.019 |title=Chemical composition and biological activities of Ishpingo essential oil, a traditional Ecuadorian spice from Ocotea quixos (Lam.) Kosterm. (Lauraceae) flower calices |journal=Food Chemistry |volume=85 |issue=3 |pages=415–21 |year=2004 |last1=Bruni |first1=Renato |last2=Medici |first2=Alessandro |last3=Andreotti |first3=Elisa |last4=Fantin |first4=Carlo |last5=Muzzoli |first5=Mariavittoria |last6=Dehesa |first6=Marco |last7=Romagnoli |first7=Carlo |last8=Sacchetti |first8=Gianni |hdl=11381/1449234 |hdl-access=free }}</ref> |
|
* '']'' cv.Purple Lovingly (Querendona Morada) |
|
|
|
* '']'' cv. Purple Lovingly (Querendona Morada) |
|
* ''Ocimum americanum'' cv. Purple Castle (Castilla Morada) |
|
* ''Ocimum americanum'' cv. Purple Castle (Castilla Morada) |
|
* ''Ocimum americanum'' cv. Purple Long-legged (Zancona morada) |
|
* ''Ocimum americanum'' cv. Purple Long-legged (Zancona morada) |
Line 50: |
Line 70: |
|
* '']'' cv. Sweet Castle (Dulce de Castilla) |
|
* '']'' cv. Sweet Castle (Dulce de Castilla) |
|
* ''Ocimum basilicum'' cv. White Compact (Blanca compacta) |
|
* ''Ocimum basilicum'' cv. White Compact (Blanca compacta) |
|
* ''Ocimum basilicum'' cv. large green leaves (Verde des horjas grandes) |
|
* ''Ocimum basilicum'' cv. large green leaves ({{lang|es|verde des horjas grandes}}) |
|
* '']'' cv. Cinnamon (Canela) |
|
* '']'' cv. Cinnamon (Canela) |
|
* '']'' cv. Little Virgin (Virgen pequena) |
|
* '']'' cv. Little Virgin (Virgen pequena) |
Line 56: |
Line 76: |
|
* '']'' sp. cv. Purple ruffle (Crespa morada) |
|
* '']'' sp. cv. Purple ruffle (Crespa morada) |
|
* '']'' sp. cv. White Ruffle (Crespa blanca) |
|
* '']'' sp. cv. White Ruffle (Crespa blanca) |
|
|
* '']'', an orchid |
|
|
* ] |
|
|
|
|
|
== Toxicology & safety == |
|
== Toxicology and safety == |
|
Moderately toxic by ingestion. The oral LD50 for rats is 2610 mg/kg.<ref> '']''. No. 13 (1975),p681.</ref> It is combustible as a liquid, and when heated to decomposition it emits acrid smoke and irritating fumes. |
|
Moderately toxic by ingestion. The oral {{LD50}} for rats is 2610 mg/kg.<ref>{{cite book|author=Richard J. Lewis|title=Food Additives Handbook|url=https://books.google.com/books?id=nC7OGhzZn5YC&pg=PA304|year=1989|publisher=Springer Science & Business Media|isbn=978-0-442-20508-9|pages=304–}}</ref> |
|
|
It is combustible as a liquid, and when heated to decomposition it emits acrid smoke and irritating fumes. |
|
<ref name=lookchem></ref> |
|
|
|
|
|
|
==Compendial status== |
|
==Compendial status== |
|
* ].<ref name=ptm>{{cite web |
|
* ]<ref name=ptm>{{cite web |
|
| last = ] |
|
| last = Therapeutic Goods Administration |
|
|
| author-link = Therapeutic Goods Administration |
|
| first = |
|
|
| authorlink = |
|
|
| coauthors = |
|
|
| title = Approved Terminology for Medicines |
|
| title = Approved Terminology for Medicines |
|
| work = |
|
|
| publisher = |
|
|
| date = 1999 |
|
| date = 1999 |
|
| url = http://www.tga.gov.au/docs/pdf/aan/aan.pdf |
|
| url = http://www.tga.gov.au/docs/pdf/aan/aan.pdf |
|
|
| access-date = 29 June 2009 |
|
| format = |
|
|
|
| archive-url = https://web.archive.org/web/20060522093356/http://www.tga.gov.au/docs/pdf/aan/aan.pdf |
|
| doi = |
|
|
| accessdate = 29 June 2009 |
|
| archive-date = 22 May 2006 |
|
|
| url-status = dead |
|
}}</ref> |
|
}}</ref> |
|
|
|
|
==References== |
|
|
<references/> |
|
|
|
|
|
|
== See also == |
|
== See also == |
|
* ] |
|
* ] |
|
|
* ], a court case concerning a company attempting to ]. |
|
|
|
|
|
== References == |
|
|
{{Reflist}} |
|
|
|
|
|
{{DEFAULTSORT:Methyl Cinnamate}} |
|
{{DEFAULTSORT:Methyl Cinnamate}} |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
|
|
] |
|
] |
|
|
|
|
|
__NOTOC__ <!-- Removes the table of contents. Delete this line when the article get longer. --> |
|