Revision as of 19:37, 13 June 2011 edit178.191.165.242 (talk) added hedione synonym← Previous edit |
Latest revision as of 18:46, 4 October 2022 edit undoJessicapierce (talk | contribs)Extended confirmed users113,314 editsm minor copy edits |
(30 intermediate revisions by 21 users not shown) |
Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
⚫ |
| verifiedrevid = 399133300 |
|
|
|
| Watchedfields = changed |
|
| ImageFile = Hédione.png |
|
|
⚫ |
| verifiedrevid = 434108344 |
⚫ |
| ImageSize = |
|
|
|
| ImageFile = Methyl dihydrojasmonate Structural Formula V1.svg |
⚫ |
| IUPACName = Methyl 2-(3-oxo-2-pentylcyclopentyl)acetate |
|
|
⚫ |
| ImageSize = 150px |
|
⚫ |
| PIN = Methyl 2-(3-oxo-2-pentylcyclopentyl)acetate |
|
| OtherNames = Hedione<br>Kharismal<br>Cepionate |
|
| OtherNames = Hedione<br>Kharismal<br>Cepionate |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo = 24851-98-7 |
|
|
| PubChem = 24901528 |
|
| CASNo = 24851-98-7 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
⚫ |
| SMILES = O=C(OC)CC1C(C(=O)CC1)CCCCC |
|
|
|
| UNII = 3GW44CIE3Y |
|
|
| PubChem = 102861 |
|
⚫ |
| SMILES = O=C(OC)CC1C(C(=O)CC1)CCCCC |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| C=13|H=22|O=3 |
|
| C=13 | H=22 | O=3 |
|
| Appearance = Clear to pale yellow oily liquid |
|
| Appearance = Clear to pale yellow oily liquid |
|
| MeltingPt = |
|
| MeltingPt = |
|
| BoilingPtC = 110 |
|
| BoilingPtC= 307.8 |
|
| Solubility = |
|
| Solubility = |
|
}} |
|
}} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = Flammable |
|
| FlashPt = 113 °C |
|
| FlashPtC = 113 |
|
| Autoignition = |
|
| AutoignitionPtC = |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Methyl dihydrojasmonate''' is an ] and a diffusive ], with the smell vaguely similar to ]. In ]s the odor is floral and ] while epimerized mixtures exhibit a dense fatty floral odor with odor recognition thresholds of 15 parts per billion.<ref>{{Citation|first= John C. |last=Leffingwell |publisher=Leffingwell & Associates|year=2001|title= The Methyl dihydrojasmonates}}</ref> |
|
'''Methyl dihydrojasmonate''' is an ] that smells similar to ]. In ]s the odor is floral and ] while epimerized mixtures exhibit a dense buttery-floral odor with odor recognition thresholds of 15 parts per billion.<ref>{{Citation|first= John C. |last=Leffingwell |publisher=Leffingwell & Associates|year=2001|title= The Methyl dihydrojasmonates}}</ref> |
|
|
|
|
|
The compound is also known as '''hedione''' or '''kharismal'''. Its boiling point is 110°C at 0.2 mmHg and it has an refractive Index: 1.45800 to 1.46200 (20.00°C). |
|
|
|
|
|
==See also== |
|
|
* ] |
|
|
|
|
|
The compound is also known as Hedione |
|
|
==References== |
|
==References== |
|
{{reflist}} |
|
{{reflist}} |
Line 33: |
Line 42: |
|
{{ester-stub}} |
|
{{ester-stub}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
|
] |
|
] |
|