(Difference between pages)

Page 1

Page 1Revision 1

Page 2

Page 2Revision 2

Content deleted Content addedVisualWikitext

Revision as of 07:15, 9 March 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (changes to watched fields - updated 'UNII_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (report errors or [[user talk:		Latest revision as of 15:35, 7 January 2022 edit Lennart97 (talk | contribs)Extended confirmed users, Page movers69,825 editsm Disambiguating links to Alcohol (link changed to Alcohol (chemistry)) using DisamAssist.
Line 1:		Line 1:
	{{chembox		{{chembox
	| Watchedfields = changed		| Watchedfields = changed
	| verifiedrevid = 402114675		| verifiedrevid = 417919604
	| Name = Ethyl (-)-<small>L</small>-lactate		| Name = Methyl DL-Lactate
	| ImageFile = Ethyl L-lactate.png		| ImageFile = Methyl DL-lactate.png
		⚫	| ImageName = Methyl <small>L</small>-lactate
	| ImageSize = 200px
		⚫	| IUPACName = Methyl 2-hydroxypropanoate
⚫	| ImageName = Ethyl <small>L</small>-lactate
			| OtherNames = 2-Hydroxy- Methyl Ester Propanoic Acid; 2-Hydroxypropanoic Acid, Methyl Ester; Lactic Acid, Methyl Ester
⚫	| IUPACName = Ethyl (''R'')-2-hydroxypropanoate
		⚫	|Section1={{Chembox Identifiers
	| OtherNames = Ethyl lactate; Lactic acid ethyl ester; 2-Hydroxypropanoic acid ethyl ester; Actylol; Acytol
		⚫	| SMILES = CC(C(=O)OC)O
⚫	| Section1 = {{Chembox Identifiers
		⚫	| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
⚫	| SMILES = CCOC(=O)C(C)O
		⚫	| ChemSpiderID = 13839235
⚫	| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
		⚫	| InChI = InChI=1S/C4H8O3/c1-3(5)4(6)7-2/h3,5H,1-2H3
⚫	| ChemSpiderID = 13837423
		⚫	| InChIKey = LPEKGGXMPWTOCB-UHFFFAOYSA-N
⚫	| InChI = 1/C5H10O3/c1-3-8-5(7)4(2)6/h4,6H,3H2,1-2H3
		⚫	| CASNo = 547-64-8
	| InChIKey = LZCLXQDLBQLTDK-UHFFFAOYAV
		⚫	| CASNo_Comment = (racemate)(<small>L</small>-isomer)
	| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
		⚫	| CASNo_Ref = {{cascite|correct|CAS}}
	| StdInChI = 1S/C5H10O3/c1-3-8-5(7)4(2)6/h4,6H,3H2,1-2H3
	| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}		| CASNo1_Ref = {{cascite|correct|??}}
		⚫	| CASNo1 = 27871-49-4
⚫	| StdInChIKey = LZCLXQDLBQLTDK-UHFFFAOYSA-N
		⚫	| CASNo1_Comment = (<small>L</small>-isomer)
⚫	| CASNo = 687-47-8
			| CASNo2_Ref = {{cascite|correct|??}}
⚫	| CASNo_Comment = (<small>L</small>-isomer)
			| CASNo2 = 17392-83-5
⚫	| CASNo_Ref = {{cascite|correct|CAS}}
			| CASNo2_Comment = (<small>D</small>-isomer)
⚫	| CASNo1 = 97-64-3
			| UNII_Ref = {{fdacite|correct|FDA}}
⚫	| CASNo_Comment = (racemate)
	| CASNo2 = 7699-00-5		| UNII = H10S91526X
		⚫	| UNII_Comment = (racemate
⚫	| CASNo_Comment = (<small>D</small>-isomer)
			| UNII1_Ref = {{fdacite|correct|FDA}}
⚫	| PubChem = 7344
	| RTECS = OD5075000		| UNII1 = 0379G9C44S
			| UNII1_Comment = (<small>L</small>-isomer)
			| UNII2_Ref = {{fdacite|correct|FDA}}
			| UNII2 = 45MZ1T3TBV
			| UNII2_Comment = (<small>D</small>-isomer)
		⚫	| PubChem = 11040
			| RTECS = OD5670000
	}}		}}
	| Section2 = {{Chembox Properties		|Section2={{Chembox Properties
	| C=5|H=10|O=3		| C=4|H=8|O=3
	| Appearance = Clear to slightly yellow liquid		| Appearance = colourless clear liquid
	| Density = 1.03 g/cm<sup>3</sup>		| Density = 1.093 g/cm<sup>3</sup>
	| Solubility = Miscible		| Solubility = Miscible
	| Solvent = ]<br /> and most ]s		| Solvent = ]<br /> and most ]s
	| SolubleOther = Miscible		| SolubleOther = Miscible
	| MeltingPtC = -26		| MeltingPtC = -66
			| BoilingPtC = 144 to 145
	| BoilingPtCL = 151
	| BoilingPtCH = 155
	| SpecRotation = −11.3°
	}}		}}
	| Section7 = {{Chembox Hazards		|Section7={{Chembox Hazards
			| ExternalSDS = MSDS
	| ExternalMSDS =
	| MainHazards = Irritant (Xi)		| MainHazards = Irritant (Xi)
			| GHSPictograms = {{GHS02}} {{GHS07}}
⚫	| NFPA-H = 1
			| GHSSignalWord = warning
⚫	| NFPA-F = 1
			| HPhrases = {{HPhrases|H226|H319|H335}}
	| NFPA-R = 0
			| PPhrases = {{PPhrases|P210|P305+P351+P338}}
	| RPhrases = {{R10}} {{R37}} {{R41}}
			| GHS_ref = <ref>GHS: {{GESTIS|ZVG=510290|Name=Methyl lactate}}</ref>
	| SPhrases = {{S2}} {{S24}} {{S26}} {{S39}}
	| FlashPt = 46 °C		| NFPA-H = 1
		⚫	| NFPA-F = 2
		⚫	| NFPA-R = 0
			| FlashPtC = 49
	}}		}}
	| Section8 = {{Chembox Related		|Section8={{Chembox Related
	| OtherCpds = ]		| OtherCompounds = ]
	}}		}}
	}}		}}
	'''Ethyl lactate''', also known as lactic acid ethyl ester, is a monobasic ] formed from ] and ], commonly used as a ]. This compound is considered ] and can be used as a water-rinsible degreaser. Ethyl lactate is found naturally in small quantities in a wide variety of foods including ], ], and various ]s. The odor of ethyl lactate when dilute is mild, ]y, ]y, with hints of fruit and ].		'''Methyl lactate''', also known as lactic acid methyl ], is the organic compound with the formula CH<sub>3</sub>CH(OH)CO<sub>2</sub>CH<sub>3</sub>. It is the methyl ester of ]. A colorless liquid, it is the simplest chiral ester. Being naturally derived, it is readily available as a single enantiomer.
			==Uses==
	Ethyl lactate is produced from biological sources, and can be either the levo (''S'') form or dextro (''R'') form, depending on the organism that is the source of the ]. Most biologically sourced ethyl lactate is ethyl (-)-<small>L</small>-lactate. Ethyl lactate is also produced industrially from petrochemical stocks, and this ethyl lactate consists of the racemic mixture of levo and dextro forms. In some jurisdictions, the ''natural'' product is exempt from many restrictions placed upon use and disposal of solvents. Because both enantiomers are found in nature, and because ethyl lactate is easily biodegradable, it is considered to be a ''green'' solvent.
			It is a solvent for ], cellulose acetate, cellulose acetobutyrate and cellulose acetopropionate. It is used in the manufacture of ] and dopes where it contributes high tolerance for diluents, good flaw and blush resistance.<ref>"Industrial Solvents Handbook" by Ernest W. Flick. 5th Edition. William Andrew Inc., 1998. {{ISBN|0-8155-1413-1}}, {{ISBN|978-0-8155-1413-8}}</ref>
			The synthesis of ] from methyl lactate has been commercialized using a ].<ref name=Gordon>{{cite journal |doi=10.1038/s41570-018-0049-z|title=The role of the metal-bound N–H functionality in Noyori-type molecular catalysts|year=2018|last1=Dub|first1=Pavel A.|last2=Gordon|first2=John C.|s2cid=106394152|journal=Nature Reviews Chemistry|volume=2|issue=12|pages=396–408}}</ref>
	Due to its relatively low toxicity, ethyl lactate is used commonly in pharmaceutical preparations, ]s,<ref>{{Dead link|date=December 2010}} ], Center for Food Safety and Applied Nutrition</ref> and ]. Ethyl lactate is also used as solvent for ], ] ], and cellulose ]s.<ref>"Industrial Solvents Handbook" by Ernest W. Flick. 5th Edition. William Andrew Inc., 1998. ISBN 0815514131, 9780815514138</ref>
			==See also==
	Ethyl lactate ] in the presence of ] and ]s or ] into ] and ].
			*], a more commonly used ester of lactic acid
	Ethyl lactate can be used as a cosolvent to produce suitable conditions for the formation of aryl aldimines.<ref>{{cite journal | author = Jacqueline S. Bennett, Kaitlyn L. Charles, Matthew R. Miner, Caitlin F. Heuberger, Elijah J. Spina, Michael F. Bartels and Taylor Foreman | title = Ethyl lactate as a tunable solvent for the synthesis of aryl aldimines | journal = Green Chem. | year = 2009 | volume = 11 | issue = 2 | pages = 166–168 | doi = 10.1039/b817379f}}</ref>
	==References==		==References==
	{{reflist}}		{{reflist}}
	{{Use dmy dates|date=December 2010}}
		⚫	]
		⚫	]
	]		]
⚫	]
⚫	]
	]
	]
	]