| Revision as of 10:28, 24 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 462237049 of page Methyl_violet for the Chem/Drugbox validation project (updated: 'ChemSpiderID'). |
Latest revision as of 16:16, 25 September 2024 edit 2620:117:503f:b2::d80c (talk) changed CASRN from 84215-49-8 to 84215-49-6 as the wrong CASRN had been recorded. (84215-49-8 is not mapped to any chemical as best as I can tell). |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
| Watchedfields = changed |
|
| Watchedfields = changed |
|
| verifiedrevid = 394767957 |
|
| verifiedrevid = 462241694 |
|
| Name = '''Methyl violet 2B''' |
|
| Name = Methyl violet 2B |
|
| ImageFile = Methyl Violet 6B.png |
|
| ImageFile = Methyl Violet 2B.svg |
|
| ImageSize = 200px |
|
| ImageSize = |
|
| ImageName = Methyl violet 2B |
|
| ImageName = Methyl violet 2B |
|
|
| IUPACName = 4,4'-bis(N,N-dimethylaniline)hydrochloride |
|
| IUPACName = Methyl violet 2B |
|
|
| OtherNames = Gentian Violet B |
|
| OtherNames = {{ubl |
|
|
| Tetraamethylparosanilinium chloride |
|
|
}} |
|
|
| SystematicName = |
|
| Section1 = {{Chembox Identifiers |
|
| Section1 = {{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
| ChEBI = 90108 |
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
| ChEMBL = 64894 |
|
| ChEMBL = |
|
| ChemSpiderID = 10588 |
|
| ChemSpiderID = 21164086 |
|
| InChI1 = |
|
| EC_number = 610-776-8 |
|
| InChIKey1 = |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo = 8004-87-3 |
|
| CASNo = 84215-49-6 |
|
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
| Pubchem = 196986 |
|
|
|
| UNII = 9691711H0F |
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
|
| PubChem = 91997555 |
|
| StdInChI = 1S/C25H30N3.ClH/c1-26(2)22-13-7-19(8-14-22)25(20-9-15-23(16-10-20)27(3)4)21-11-17-24(18-12-21)28(5)6;/h7-18H,1-6H3;1H/q+1;/p-1 |
|
|
|
| StdInChI_Ref = |
|
|
| StdInChI = |
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
| StdInChIKey = ZXJXZNDDNMQXFV-UHFFFAOYSA-M |
|
| StdInChIKey = WWKGVZASJYXZKN-UHFFFAOYSA-N |
|
|
| SMILES = CN(C)C1=CC=C(C=C1)C(=C2C=CC(=N)C=C2)C3=CC=C(C=C3)N(C)C.Cl |
|
| SMILES = |
|
|
|
|
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
| Section2 = {{Chembox Properties |
|
| Formula = C<sub>24</sub>H<sub>28</sub>N<sub>3</sub>Cl |
|
| Formula = C<sub>23</sub>H<sub>26</sub>N<sub>3</sub>Cl |
|
| MolarMass = |
|
| MolarMass = |
|
| Appearance =Green to dark-green powder<ref name=b1>{{cite book|author=R. W. Sabnis|title=Handbook of Biological Dyes and Stains: Synthesis and Industrial Applications|url=http://books.google.com/books?id=M59Kw54ehwAC&pg=PA309|accessdate=27 June 2011|date=29 March 2010|publisher=John Wiley and Sons|isbn=9780470407530|pages=309–}}</ref> |
|
| Appearance =Green to dark-green powder<ref name=b1>{{cite book|author=R. W. Sabnis|title=Handbook of Biological Dyes and Stains: Synthesis and Industrial Applications|url=https://books.google.com/books?id=M59Kw54ehwAC&pg=PA309|access-date=27 June 2011|date=29 March 2010|publisher=]|isbn=978-0-470-40753-0|pages=309–}}</ref> |
|
| Solubility = Soluble in water, ethanol, insoluble in ]<ref name=b1/> |
|
| Solubility = Soluble in water, ethanol, insoluble in ]<ref name=b1/> |
|
| Density = |
|
| Density = |
|
|
| MeltingPtC = |
|
| MeltingPt = 137 °C (279 °F) – decomposes<ref name=b1/> |
|
| MeltingPt_notes = decomposes<ref name=b1/> |
|
| BoilingPt =}} |
|
| BoilingPt = |
|
|
}} |
|
|
| Section3 = |
|
|
| Section4 = |
|
|
| Section5 = |
|
|
| Section6 = |
|
}} |
|
}} |
|
|
|
|
|
'''Methyl violet 2B''' ('''Tetramethylparosanilinium chloride''', 4,4'-bis(N,N-dimethylaniline)hydrochloride) is a violet ] from the group of cationic dyes and an essential component of C.I. Basic Violet 1 (trivial name ]). Methyl violets are mixtures of tetramethyl (2B), pentamethyl (]) and hexamethyl (10B) pararosanilins.<ref>C. Bouasla, M. E. H. Samar, F, Ismail: ''Degradation of methyl violet 6B dye by the Fenton process.'' In: ''].'' 254.1–3, 2010, S. 35–41, ].</ref> |
|
|
|
|
|
== References == |
|
|
{{Reflist}} |
|
|
|
|
|
{{DEFAULTSORT:Methyl Violet}} |
|
|
] |
|
|
] |
|
|
] |