| Revision as of 10:28, 24 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{chembox}} taken from revid 462237049 of page Methyl_violet for the Chem/Drugbox validation project (updated: 'ChemSpiderID'). |
Latest revision as of 00:31, 19 January 2025 edit 86.134.66.218 (talk)No edit summary |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
| Watchedfields = changed |
|
| Watchedfields = changed |
|
| verifiedrevid = 394767957 |
|
| verifiedrevid = 462241694 |
|
| Name = '''Methyl violet 2B''' |
|
| Name = Methyl violet 6B |
|
| ImageFile = Methyl Violet 6B.png |
|
| ImageFile = Methyl Violet 6B.svg |
|
| ImageSize = 200px |
|
| ImageSize = |
|
| ImageName = Methyl violet 2B |
|
| ImageName = Methyl violet 6B |
|
|
| IUPACName = 4--(4-methyliminocyclohexa-2,5-dien-1-ylidene)methyl]-''N'',''N''-dimethylaniline hydrochloride |
|
| IUPACName = Methyl violet 2B |
|
|
| OtherNames = Gentian Violet B |
|
| OtherNames = {{ubl |
|
|
| Gentian violet B, |
|
|
| Methylrosanilinium chloride, |
|
|
| Pentamethylparosanilinium chloride, |
|
|
| Basic violet 3, |
|
|
}} |
|
|
| SystematicName = |
|
| Section1 = {{Chembox Identifiers |
|
| Section1 = {{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 64894 |
|
| ChEMBL = 1201088 |
|
| ChemSpiderID = 10588 |
|
| ChemSpiderID = 170606 |
|
| InChI1 = |
|
| EC_number = 610-776-8 |
|
| InChIKey1 = |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo = 8004-87-3 |
|
| CASNo = 603-47-4 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| Pubchem = 196986 |
|
|
|
| UNII = H2G44K8M7S |
|
|
| PubChem = 164877 |
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
| StdInChI = 1S/C25H30N3.ClH/c1-26(2)22-13-7-19(8-14-22)25(20-9-15-23(16-10-20)27(3)4)21-11-17-24(18-12-21)28(5)6;/h7-18H,1-6H3;1H/q+1;/p-1 |
|
| StdInChI = 1S/C24H27N3.ClH/c1-25-21-12-6-18(7-13-21)24(19-8-14-22(15-9-19)26(2)3)20-10-16-23(17-11-20)27(4)5;/h6-17H,1-5H3;1H |
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
| StdInChIKey = ZXJXZNDDNMQXFV-UHFFFAOYSA-M |
|
| StdInChIKey = JFTBTTPUYRGXDG-UHFFFAOYSA-N |
|
|
| SMILES = CN=C1C=CC(=C(C2=CC=C(C=C2)N(C)C)C3=CC=C(C=C3)N(C)C)C=C1.Cl |
|
| SMILES = |
|
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
| Section2 = {{Chembox Properties |
|
| Formula = C<sub>24</sub>H<sub>28</sub>N<sub>3</sub>Cl |
|
| Formula = C<sub>24</sub>H<sub>28</sub>N<sub>3</sub>Cl |
|
| MolarMass = |
|
| MolarMass = |
|
| Appearance =Green to dark-green powder<ref name=b1>{{cite book|author=R. W. Sabnis|title=Handbook of Biological Dyes and Stains: Synthesis and Industrial Applications|url=http://books.google.com/books?id=M59Kw54ehwAC&pg=PA309|accessdate=27 June 2011|date=29 March 2010|publisher=John Wiley and Sons|isbn=9780470407530|pages=309–}}</ref> |
|
| Appearance =Green to dark-green powder<ref name=b1>{{cite book|first=R. W. |last=Sabnis|title=Handbook of Biological Dyes and Stains: Synthesis and Industrial Applications|url=https://books.google.com/books?id=M59Kw54ehwAC&pg=PA309|access-date=27 June 2011|date=29 March 2010|publisher=]|isbn=978-0-470-40753-0|pages=309–}}</ref> |
|
| Solubility = Soluble in water, ethanol, insoluble in ]<ref name=b1/> |
|
| Solubility = Soluble in water, ethanol, insoluble in ]<ref name=b1/> |
|
| Density = |
|
| Density = |
|
|
| MeltingPtC = 137 |
|
| MeltingPt = 137 °C (279 °F) – decomposes<ref name=b1/> |
|
| MeltingPt_notes = decomposes<ref name=b1/> |
|
| BoilingPt =}} |
|
| BoilingPt = |
|
|
}} |
|
|
| Section3 = |
|
|
| Section4 = |
|
|
| Section5 = |
|
|
| Section6 = |
|
}} |
|
}} |
|
|
|
|
|
{{Expand German|Methylviolett 6B|date=June 2024}} |
|
|
'''Methyl violet 6B''' (Pentamethylparosanilinium chloride, 4--(4-methyliminocyclohexa-2,5-dien-1-ylidene)methyl]-''N'',''N''-dimethylaniline hydrochloride) is a violet ] from the group of cationic dyes and an essential component of C.I. Basic Violet 1 (trivial name ]). The compound is sometimes equated with methyl violet in the literature. |
|
|
|
|
|
Methyl violets are mixtures of tetramethyl (2B), pentamethyl (6B) and hexamethyl (10B) pararosanilins.<ref>{{cite journal|first1=C. |last1=Bouasla |first2=M. E. H. |last2=Samar |first3=F. |last3=Ismail |title=Degradation of methyl violet 6B dye by the Fenton process |journal=Desalination |volume=254 |issue=1–3 |date=2010 |pages=35–41 |doi=10.1016/j.desal.2009.12.017}}</ref> |
|
|
|
|
|
== Synthesis == |
|
|
To produce methyl violet 6B, ] is oxidized with atmospheric ] and ] as a catalyst, using ] and large amounts of salt as a diluent. The central carbon atom of the dye is provided by the oxidation of a methyl group of ''N'',''N''-dimethylaniline to ].<ref name="KVenkataraman">{{citation |author=] |date=1952 |location=New York, London |pages=719 |publisher=Academic Press |title=The Chemistry of Synthetic Dyes |volume=II}}</ref> |
|
|
In this process, a reaction product is obtained that contains the tetra- to hexamethylated compounds in addition to the pentamethylated compound. |
|
|
|
|
|
] |
|
|
|
|
|
== References == |
|
|
{{Reflist}} |
|
|
|
|
|
{{DEFAULTSORT:Methyl Violet}} |
|
|
] |
|
|
] |
|
|
] |