Misplaced Pages

Methylenomycin B: Difference between revisions

Article snapshot taken from[REDACTED] with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
Browse history interactively
Page 1
Page 2
← Previous editContent deleted Content addedVisualWikitext
Revision as of 20:46, 29 April 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (← Previous edit Latest revision as of 14:28, 7 January 2023 edit undoAnomieBOT (talk | contribs)Bots6,588,322 editsm Dating maintenance tags: {{Cn}} 
(23 intermediate revisions by 19 users not shown)
Line 1: Line 1:
{{chembox {{Chembox
| Watchedfields = changed
| verifiedrevid = 426620757 | verifiedrevid = 426622303
| ImageFile = Methylenomycin B.svg | ImageFile = Methylenomycin B.svg
| ImageSize = 250 px | ImageSize = 170 px
| ImageAlt = Structural formula of methylenomycin B
| IUPACName = 2,3-Dimethyl-5-methylene-2-cyclopenten-1-one<ref name="dl">{{cite web|url=http://www.druglead.com/cds/Methylenomycins.html|title=Methylenomycins|date=2009|accessdate=9 February 2010}}</ref>
| ImageFile1 = Methylenomycin B 3D ball.png

| ImageSize1 = 170
| ImageAlt1 = Ball-and-stick model of the methylenomycin B molecule
| IUPACName = 2,3-Dimethyl-5-methylene-2-cyclopenten-1-one
| OtherNames = | OtherNames =
| Section1 = {{Chembox Identifiers |Section1={{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 2303992 | ChemSpiderID = 2303992
| InChI1 = 1/C8H10O/c1-5-4-6(2)8(9)7(5)3/h2,4H2,1,3H3 | InChI1 = 1/C8H10O/c1-5-4-6(2)8(9)7(5)3/h2,4H2,1,3H3
| InChIKey1 = YDXIEAHUYZKJOH-UHFFFAOYAN | InChIKey1 = YDXIEAHUYZKJOH-UHFFFAOYAN
| CASNo_Ref = {{cascite|correct|??}}
| CASNo = 52775-77-6
| PubChem = 3040648 | CASNo = 52775-77-6
| UNII_Ref = {{fdacite|correct|FDA}}
⚫ | SMILES = O=C/1\C(=C)CC(=C\1C)\C
| UNII = WLO3E84KAS
⚫ | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| PubChem = 3040648
⚫ | SMILES = O=C/1\C(=C)CC(=C\1C)\C
⚫ | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = YDXIEAHUYZKJOH-UHFFFAOYSA-N | StdInChIKey = YDXIEAHUYZKJOH-UHFFFAOYSA-N
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
⚫ | StdInChI = 1S/C8H10O/c1-5-4-6(2)8(9)7(5)3/h2,4H2,1,3H3
| ChemSpiderID = 2303992
⚫ }}
| SMILES = O=C/1\C(=C)CC(=C\1C)\C
⚫ |Section2={{Chembox Properties
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| C=8
⚫ | StdInChI=1S/C8H10O/c1-5-4-6(2)8(9)7(5)3/h2,4H2,1,3H3
| H=10
⚫ }}
| O=1
⚫ | Section2 = {{Chembox Properties
| Appearance =
| Formula = C<sub>8</sub>H<sub>10</sub>O
| Density =
| MolarMass = 122.16 g mol<sup>-1</sup>
| Appearance = | MeltingPt =
| Density = | BoilingPt =
| MeltingPt = | Solubility =
⚫ }}
| BoilingPt =
⚫ |Section3={{Chembox Hazards
| Solubility =
| MainHazards =
⚫ }}
⚫ | FlashPt =
⚫ | Section3 = {{Chembox Hazards
| MainHazards = | AutoignitionPt =
⚫ }}
⚫ | FlashPt =
| Autoignition =
⚫ }}
}} }}
'''Methylenomycin B''' is a cyclopentanoid antibiotic produced by '']'' A3(2) that is effective against both ] and ] bacteria.<ref name="pmid8655502">{{cite journal |author=Brian P, Riggle PJ, Santos RA, Champness WC |title=Global negative regulation of Streptomyces coelicolor antibiotic synthesis mediated by an absA-encoded putative signal transduction system |journal=J. Bacteriol. |volume=178 |issue=11 |pages=3221–31 |year=1996 |month=June |pmid=8655502 |pmc=178074 |doi= |url=http://jb.asm.org/cgi/pmidlookup?view=long&pmid=8655502}}</ref><ref name="pmid1537793">{{cite journal |author=Hobbs G, Obanye AI, Petty J, ''et al.'' |title=An integrated approach to studying regulation of production of the antibiotic methylenomycin by Streptomyces coelicolor A3(2) |journal=J. Bacteriol. |volume=174 |issue=5 |pages=1487–94 |year=1992 |month=March |pmid=1537793 |pmc=206543 |doi= |url=http://jb.asm.org/cgi/pmidlookup?view=long&pmid=1537793}}</ref> Methylenomycins are naturally produced in two variants: A and B. '''Methylenomycin B''' is a ] derived antibiotic produced by '']'' A3(2) that is effective against both ] and ] bacteria.<ref name="pmid8655502">{{cite journal |vauthors=Brian P, Riggle PJ, Santos RA, Champness WC |title=Global negative regulation of Streptomyces coelicolor antibiotic synthesis mediated by an absA-encoded putative signal transduction system |journal=J. Bacteriol. |volume=178 |issue=11 |pages=3221–31 |date=June 1996 |pmid=8655502 |pmc=178074 |doi= 10.1128/jb.178.11.3221-3231.1996}}</ref><ref name="pmid1537793">{{cite journal |vauthors=Hobbs G, Obanye AI, Petty J, etal |title=An integrated approach to studying regulation of production of the antibiotic methylenomycin by Streptomyces coelicolor A3(2) |journal=J. Bacteriol. |volume=174 |issue=5 |pages=1487–94 |date=March 1992 |pmid=1537793 |pmc=206543 |doi= 10.1128/jb.174.5.1487-1494.1992}}</ref> Methylenomycins are naturally produced in two variants: A and B.{{cn|date=January 2023}}


==See also== ==See also==
Line 46: Line 51:


] ]
] ]
]
]



{{Antibiotic-stub}} {{Antibiotic-stub}}
Methylenomycin B: Difference between revisions Add topic