Revision as of 09:42, 12 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (no changed fields - added verified revid - updated 'ChEMBL_Ref', 'ChEBI_Ref', 'ChEBI_Ref') per Chem/Drugbox validation (report [[Misplaced Pages talk:WikiProject_Pharmacology|erro← Previous edit |
Latest revision as of 14:01, 20 December 2023 edit undoMaxim Masiutin (talk | contribs)Extended confirmed users, IP block exemptions, Pending changes reviewers31,043 edits Alter: journal, issue. Formatted dashes. | Use this bot. Report bugs. | #UCB_CommandLine 38/733 |
(25 intermediate revisions by 21 users not shown) |
Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{drugbox |
|
|
|
{{Drugbox |
|
|
| Watchedfields = changed |
|
|
| verifiedrevid = 444413988 |
|
|
| IUPAC_name = (2''S'',3''S'',4''R'',6''S'')-6-<nowiki/>{oxy}-2-methyloxan-3-yl]oxy}-4-hydroxy-2,4-dimethyloxan-3-yl propanoate |
|
|
| image = Midecamycin.png |
|
|
|
|
|
<!--Clinical data--> |
|
|
| tradename = |
|
|
| Drugs.com = {{drugs.com|international|midecamycin}} |
|
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
|
| pregnancy_category = |
|
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
|
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
|
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
|
| legal_status = |
|
|
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
|
| bioavailability = |
|
|
| protein_bound = |
|
|
| metabolism = |
|
|
| elimination_half-life = |
|
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
|
| CAS_number = 35457-80-8 |
|
|
| ATC_prefix = J01 |
|
|
| ATC_suffix = FA03 |
|
|
| PubChem = 5382853 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
|
| DrugBank = |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
| ChemSpiderID = 4445365 |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = N34Z0Y5UH7 |
|
| UNII = N34Z0Y5UH7 |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| verifiedrevid = 443704815 |
|
|
|
| KEGG = D01339 |
|
| IUPAC_name = (2''S'',3''S'',4''R'',6''S'')-6-{oxy}-2-methyloxan-3-yl]oxy}-4-hydroxy-2,4-dimethyloxan-3-yl propanoate |
|
|
|
|
|
| image = Midecamycin.png |
|
|
|
<!--Chemical data--> |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
|
| C=41 | H=67 | N=1 | O=15 |
|
| ChemSpiderID = 4445365 |
|
|
| InChI = 1/C41H67NO15/c1-11-30(45)54-29-21-32(47)51-24(4)16-14-13-15-17-28(44)23(3)20-27(18-19-43)37(38(29)50-10)57-40-35(48)34(42(8)9)36(25(5)53-40)56-33-22-41(7,49)39(26(6)52-33)55-31(46)12-2/h13-15,17,19,23-29,33-40,44,48-49H,11-12,16,18,20-22H2,1-10H3/b14-13+,17-15+/t23-,24-,25-,26+,27+,28+,29-,33+,34-,35-,36-,37+,38+,39+,40+,41-/m1/s1 |
|
|
| InChIKey = DMUAPQTXSSNEDD-QALJCMCCBZ |
|
|
| smiles = O=CC3C(C)(O)/C=C/C=C/C(OC(=O)C(OC(=O)CC)(OC)3O2O((O1O((OC(=O)CC)(O)(C1)C)C)(N(C)C)2O)C)C |
|
| smiles = O=CC3C(C)(O)/C=C/C=C/C(OC(=O)C(OC(=O)CC)(OC)3O2O((O1O((OC(=O)CC)(O)(C1)C)C)(N(C)C)2O)C)C |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
Line 14: |
Line 48: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = DMUAPQTXSSNEDD-QALJCMCCSA-N |
|
| StdInChIKey = DMUAPQTXSSNEDD-QALJCMCCSA-N |
|
|
| melting_point = 155 |
|
| CAS_number = 35457-80-8 |
|
|
|
| melting_high = 156 |
|
| ATC_prefix = J01 |
|
|
|
| solubility = Soluble in ''acidic/low pH'' water; Very soluble in methanol, chloroform, ethyl acetate, benzene, ethyl ether; Almost completely in ethanol(>95.5) |
|
| ATC_suffix = FA03 |
|
|
| PubChem = 5382853 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
|
| DrugBank = |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
|
| KEGG = D01339 |
|
|
| C=41|H=67|N=1|O=15 |
|
|
| molecular_weight = 813.968 g/mol |
|
|
| melting_point = 155 |
|
|
| melting_high = 156 |
|
|
| solubility = Soluble in ''acidic/low pH'' water; Very soluble in methanol, chloroform, ethyl acetate, benzene, ethyl ether; Almost completely in ethanol(>95.5) |
|
|
| bioavailability = |
|
|
| protein_bound = |
|
|
| metabolism = |
|
|
| elimination_half-life = |
|
|
| excretion = |
|
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
|
| pregnancy_category= |
|
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
|
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
|
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
|
| legal_status = |
|
|
| routes_of_administration = |
|
|
}} |
|
}} |
|
|
|
|
|
|
'''Midecamycin''' is a ] ]<ref name="pmid308022">{{cite journal | vauthors = Salhi A, Vindel JA, Brunaud M, Berceaux G, Marin A, Wuatelet C | title = Properties of midecamycin, a new macrolide antibiotic | journal = Giornale Italiano di Chemioterapia | volume = 24 | issue = 1–2 | pages = 67–76 | date = 1977 | pmid = 308022 }}</ref> that is synthesized from ''Streptomyces mycarofaciens''.<ref name="pmid2491329">{{cite journal | vauthors = Wang YG, Hutchinson CR | title = Cloning of midecamycin biosynthetic genes from Streptomyces mycarofaciens 1748 | journal = Chinese Journal of Biotechnology | volume = 5 | issue = 4 | pages = 191–201 | date = 1989 | pmid = 2491329 }}</ref> |
|
'''Midecamycin''' is a ] antibiotic. Synthesized from ''Streptomyces mycarofaciens''. |
|
|
|
|
|
|
==Physical Properties== |
|
==Physical Properties== |
|
|
|
|
|
|
Its ] may vary depending on the compound type and the source consulted. For example, the Merck Index gives a melting point of 155-156 ] for the A<sub>1</sub> type while the ] reports 153-158 Celsius. The Merck Index also gives a melting point of 122-125 Celsius for the A<sub>3</sub> type.{{cn|date=January 2023}} |
|
Melting point vary depending on the compound type. It may also vary depending on the source consulted. Example: |
|
|
|
|
|
For the A<sub>1</sub> type: |
|
|
|
|
|
The Merck Index reports 155-156 Celsius. |
|
|
The Japanese Pharmacopoeia reports 153–158 Celsius. |
|
|
|
|
|
For the A<sub>3</sub> type: |
|
|
|
|
|
The Merck Index reports 122-125 Celsius. |
|
|
|
|
|
|
|
|
|
|
|
|
|
== References == |
|
|
{{Reflist}} |
|
|
|
|
|
|
{{Antibiotic-stub}} |
|
{{Macrolides, lincosamides and streptogramins}} |
|
{{Macrolides, lincosamides and streptogramins}} |
|
|
|
|
|
] |
|
] |
|
|
] |
|
|
|
|
|
] |
|
|
|
|
|
] |
|
{{antibiotic-stub}} |
|
|
|
] |
|
|
|
|
|
] |
|
] |
|
|
|
] |
|
] |
|
|
|
] |
|
] |
|
|
] |
|