Revision as of 02:58, 14 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per Chem/Drugbox validation← Previous edit |
Latest revision as of 23:32, 5 April 2023 edit undoEntranced98 (talk | contribs)Extended confirmed users, Pending changes reviewers, Rollbackers172,831 edits Importing Wikidata short description: "Chemical compound"Tag: Shortdesc helper |
(10 intermediate revisions by 9 users not shown) |
Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{drugbox |
|
|
|
{{Drugbox |
|
|
| Verifiedfields = changed |
|
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 444738923 |
|
⚫ |
| IUPAC_name = (2''E'',2<nowiki>'</nowiki>''E'')-2,2'-(1''E'',2''E'')-propane-1,2-diylidenedihydrazinecarboximidamide |
|
⚫ |
| image = mitoguazone.png |
|
⚫ |
| image2 = mitoguazone_sf.gif |
|
|
|
|
|
<!--Clinical data--> |
|
|
| tradename = |
|
⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
⚫ |
| pregnancy_category = |
|
⚫ |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
⚫ |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
⚫ |
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
⚫ |
| legal_status = |
|
⚫ |
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
⚫ |
| bioavailability = |
|
⚫ |
| protein_bound = |
|
⚫ |
| metabolism = |
|
⚫ |
| elimination_half-life = |
|
⚫ |
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
⚫ |
| CAS_number = 459-86-9 |
|
⚫ |
| ATC_prefix = L01 |
|
⚫ |
| ATC_suffix = XX16 |
|
⚫ |
| PubChem = 5351154 |
|
⚫ |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
⚫ |
| DrugBank = |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = OD5Q0L447W |
|
| UNII = OD5Q0L447W |
⚫ |
| verifiedrevid = 443518984 |
|
⚫ |
| IUPAC_name = (2''E'',2<nowiki>'</nowiki>''E'')-2,2'-(1''E'',2''E'')-propane-1,2-diylidenedihydrazinecarboximidamide |
|
⚫ |
|synonyms = <small>2-<nowiki>amino]guanidine</small> |
|
⚫ |
| image = mitoguazone.png |
|
⚫ |
| image2 = mitoguazone_sf.gif |
|
⚫ |
| CAS_number = 459-86-9 |
|
⚫ |
| ATC_prefix = L01 |
|
⚫ |
| ATC_suffix = XX16 |
|
⚫ |
| PubChem = 5351154 |
|
⚫ |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
⚫ |
| DrugBank = |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D07258 |
|
| KEGG = D07258 |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
⚫ |
| C=5|H=12|N=8 |
|
|
|
| ChEBI = 43996 |
|
| molecular_weight = 184.20 g/mol |
|
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
⚫ |
| bioavailability = |
|
|
|
| ChemSpiderID = 4508218 |
⚫ |
| protein_bound = |
|
⚫ |
| metabolism = |
|
⚫ |
| elimination_half-life = |
|
⚫ |
| excretion = |
|
⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
⚫ |
| pregnancy_category= |
|
⚫ |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
⚫ |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
⚫ |
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
⚫ |
| legal_status = |
|
⚫ |
| routes_of_administration = |
|
⚫ |
}} |
|
|
|
|
|
|
|
<!--Chemical data--> |
|
'''Mitoguazone''' (also known as methylglyoxal bis(guanylhydrazone) or MGBG) is a drug used in ]. |
|
|
⚫ |
| C=5 | H=12 | N=8 |
|
⚫ |
| synonyms = <small>2-<nowiki>amino]guanidine</small> |
|
|
| smiles = C\C(\C=N\NC(N)=N)=N/NC(N)=N |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C5H12N8/c1-3(11-13-5(8)9)2-10-12-4(6)7/h2H,1H3,(H4,6,7,12)(H4,8,9,13)/b10-2+,11-3+ |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = PKDBCJSWQUOKDO-UHFFFAOYSA-M |
|
⚫ |
}} |
|
|
|
|
|
|
'''Mitoguazone''' (also known as methylglyoxal bis(guanylhydrazone) or MGBG) is a drug used in ].<ref name="pmid2655552">{{cite journal | vauthors = Hoffmann H, Gutsche W, Amlacher R, Schulze W, Werner W, Lenk H, Wohlrab W, Haupt E | title = | language = German | journal = Archiv für Geschwulstforschung | volume = 59 | issue = 2 | pages = 135–48 | date = 1989 | pmid = 2655552 | doi = | url = }}</ref> |
|
|
|
|
|
|
== References == |
|
|
{{Reflist}} |
|
|
|
|
|
{{Chemotherapeutic agents}} |
|
{{Chemotherapeutic agents}} |