| Revision as of 20:20, 29 July 2010 editPotatoBot (talk | contribs)Bots51,239 editsm Stub sorting and placement of stub template(s): antineoplastic-drug-stub← Previous edit |
Latest revision as of 23:01, 1 April 2023 edit undoEntranced98 (talk | contribs)Extended confirmed users, Pending changes reviewers, Rollbackers172,956 edits Importing Wikidata short description: "Chemical compound"Tag: Shortdesc helper |
| (27 intermediate revisions by 17 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{Drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
| ⚫ |
| IUPAC_name = 3-(2-chloroethyl)-4-oxo-3,4-dihydroimidazotetrazine-8-carboxamide |
|
|
|
| Watchedfields = changed |
| ⚫ |
| image = Mitozolomide.svg |
|
|
|
| verifiedrevid = 376147382 |
| ⚫ |
| CAS_number = 85622-95-3 |
|
|
⚫ |
| IUPAC_name = 3-(2-chloroethyl)-4-oxo-3,4-dihydroimidazotetrazine-8-carboxamide |
| ⚫ |
| ATC_prefix = none |
|
|
⚫ |
| image = Mitozolomide.svg |
| ⚫ |
| ATC_suffix = |
|
|
|
| width = 210 |
| ⚫ |
| PubChem = 71766 |
|
|
|
|
| ⚫ |
| DrugBank = |
|
|
|
<!--Clinical data--> |
| ⚫ |
| C=7|H=7|Cl=1|N=6|O=2 |
|
|
|
| tradename = |
|
| molecular_weight = 242.622 g/mol |
|
|
⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
| ⚫ |
| smiles = NC(=O)c1ncn2C(=O)N(CCCl)\N=N/c12 |
|
|
|
| pregnancy_US = <!-- A / B / C / D / X --> |
| ⚫ |
| bioavailability = |
|
|
⚫ |
| pregnancy_category = |
| ⚫ |
| protein_bound = |
|
|
⚫ |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
| metabolism = |
|
|
⚫ |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
| ⚫ |
| elimination_half-life = |
|
|
| excretion = |
|
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
|
| legal_status = |
| ⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
|
⚫ |
| routes_of_administration = |
| ⚫ |
| pregnancy_category= |
|
|
|
|
| ⚫ |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
|
|
<!--Pharmacokinetic data--> |
| ⚫ |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
|
⚫ |
| bioavailability = |
|
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
|
⚫ |
| protein_bound = |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
|
| legal_status = |
|
| metabolism = |
|
⚫ |
| elimination_half-life = |
| ⚫ |
| routes_of_administration = |
|
|
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
⚫ |
| CAS_number = 85622-95-3 |
|
⚫ |
| ATC_prefix = none |
|
⚫ |
| ATC_suffix = |
|
⚫ |
| PubChem = 71766 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
⚫ |
| DrugBank = |
|
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
|
| UNII = E3U7286V3W |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 435951 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 64805 |
|
|
|
|
|
<!--Chemical data--> |
|
⚫ |
| C=7 | H=7 | Cl=1 | N=6 | O=2 |
|
⚫ |
| smiles = NC(=O)c1ncn2C(=O)N(CCCl)\N=N/c12 |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C7H7ClN6O2/c8-1-2-14-7(16)13-3-10-4(5(9)15)6(13)11-12-14/h3H,1-2H2,(H2,9,15) |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = QXYYYPFGTSJXNS-UHFFFAOYSA-N |
|
}} |
|
}} |
|
'''Mitozolomide''' (]) is an ]. It is an ] derivative. |
|
'''Mitozolomide''' (]) is an ]. It is an ] derivative. |
|
|
|
|
|
Development of mitozolomide was discontinued during ] ]s after it was found to cause severe and unpredictable ].<ref>{{cite journal |author=Fairbairn LJ, Chinnasamy N, Lashford LS, Chinnasamy D, Rafferty JA |title=Enhancing hemopoietic drug resistance: a rationale for reconsidering the clinical use of mitozolomide |journal=Cancer Gene Ther |volume=7 |issue=2 |pages=233–9 |year=2000 |month=February |pmid=10770631 |url=http://www.nature.com/cgt/journal/v7/n2/pdf/7700120a.pdf |doi=10.1038/sj.cgt.7700120}}</ref> ], which has been in clinical use since 1999, is a less toxic ] of mitozolomide.<ref>{{cite journal |author=Newlands ES, Blackledge GR, Slack JA, ''et al.'' |title=Phase I trial of temozolomide (CCRG 81045: M&B 39831: NSC 362856) |journal=Br J Cancer |volume=65 |issue=2 |pages=287–91 |year=1992 |month=February |pmid=1739631 |pmc=1977719}}</ref> |
|
Development of mitozolomide was discontinued during ] ]s after it was found to cause severe and unpredictable ].<ref>{{cite journal |vauthors=Fairbairn LJ, Chinnasamy N, Lashford LS, Chinnasamy D, Rafferty JA |title=Enhancing hemopoietic drug resistance: a rationale for reconsidering the clinical use of mitozolomide |journal=Cancer Gene Ther |volume=7 |issue=2 |pages=233–9 |date=February 2000 |pmid=10770631 |url=http://www.nature.com/cgt/journal/v7/n2/pdf/7700120a.pdf |doi=10.1038/sj.cgt.7700120|s2cid=2597751 |doi-access=free }}</ref> ], which has been in clinical use since 1999, is a less toxic ] of mitozolomide.<ref>{{cite journal |vauthors=Newlands ES, Blackledge GR, Slack JA, etal |title=Phase I trial of temozolomide (CCRG 81045: M&B 39831: NSC 362856) |journal=Br J Cancer |volume=65 |issue=2 |pages=287–91 |date=February 1992 |pmid=1739631 |pmc=1977719 |doi=10.1038/bjc.1992.57}}</ref> |
|
|
|
|
|
==References== |
|
==References== |
| Line 34: |
Line 59: |
|
{{Chemotherapeutic agents}} |
|
{{Chemotherapeutic agents}} |
|
|
|
|
|
] |
|
] |
|
|
] |
|
|
|
|
|
] |
|
|
] |
|
|
|
|
|
{{antineoplastic-drug-stub}} |
|
{{antineoplastic-drug-stub}} |