| Revision as of 23:05, 11 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per [[Misplaced Pages:WikiProject Chemicals/Chembox validation|Chem/Drug← Previous edit |
Latest revision as of 22:18, 21 March 2024 edit undoMazewaxie (talk | contribs)Extended confirmed users, Pending changes reviewers, Rollbackers113,603 editsm WP:GENFIXESTag: AWB |
| (19 intermediate revisions by 16 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{drugbox |
|
|
|
{{Infobox drug |
|
⚫ |
| verifiedrevid = 444348498 |
|
⚫ |
| IUPAC_name = acetic acid |
|
⚫ |
| image = Mofezolac.png |
|
|
|
|
|
<!--Clinical data--> |
|
|
| tradename = |
|
|
| Drugs.com = {{drugs.com|international|mofezolac}} |
|
⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
⚫ |
| pregnancy_category = |
|
⚫ |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
⚫ |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
⚫ |
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
⚫ |
| legal_status = Rx-only |
|
⚫ |
| routes_of_administration = Oral |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
⚫ |
| bioavailability = |
|
⚫ |
| protein_bound = |
|
⚫ |
| metabolism = |
|
⚫ |
| elimination_half-life = |
|
⚫ |
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
⚫ |
| CAS_number = 78967-07-4 |
|
⚫ |
| ATC_prefix = none |
|
⚫ |
| ATC_suffix = |
|
⚫ |
| ATC_supplemental = |
|
⚫ |
| PubChem = 4237 |
|
⚫ |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
⚫ |
| DrugBank = |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = RVJ0BV3H3Y |
|
| UNII = RVJ0BV3H3Y |
| ⚫ |
| verifiedrevid = 437197852 |
|
| ⚫ |
| IUPAC_name = acetic acid |
|
| ⚫ |
| image = Mofezolac.png |
|
| ⚫ |
| CAS_number = 78967-07-4 |
|
|
| CAS_supplemental = |
|
| ⚫ |
| ATC_prefix = none |
|
| ⚫ |
| ATC_suffix = |
|
| ⚫ |
| ATC_supplemental = |
|
| ⚫ |
| PubChem = 4237 |
|
| ⚫ |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| ⚫ |
| DrugBank = |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D01718 |
|
| KEGG = D01718 |
|
| chemical_formula = |
|
| ChemSpiderID = 4089 |
|
|
|
|
|
<!--Chemical data--> |
|
| C=19 | H=17 | N=1 | O=5 |
|
| C=19 | H=17 | N=1 | O=5 |
|
⚫ |
| smiles = COC1=CC=C(C=C1)C2=C(ON=C2C3=CC=C(C=C3)OC)CC(=O)O |
|
| molecular_weight = 339.34 g/mol |
|
|
|
| StdInChI = 1S/C19H17NO5/c1-23-14-7-3-12(4-8-14)18-16(11-17(21)22)25-20-19(18)13-5-9-15(24-2)10-6-13/h3-10H,11H2,1-2H3,(H,21,22) |
| ⚫ |
| smiles = COC1=CC=C(C=C1)C2=C(ON=C2C3=CC=C(C=C3)OC)CC(=O)O |
|
|
|
| StdInChIKey = DJEIHHYCDCTAAH-UHFFFAOYSA-N |
| ⚫ |
| bioavailability = |
|
| ⚫ |
| protein_bound = |
|
| ⚫ |
| metabolism = |
|
| ⚫ |
| elimination_half-life = |
|
| ⚫ |
| excretion = |
|
| ⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| ⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| ⚫ |
| pregnancy_category= |
|
| ⚫ |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
| ⚫ |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| ⚫ |
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
| ⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| ⚫ |
| legal_status = Rx-only |
|
| ⚫ |
| routes_of_administration = Oral |
|
|
}} |
|
}} |
|
|
|
|
|
|
'''Mofezolac''' (]), sold under the name '''Disopain''' in Japan, is a ] (NSAID) used for its ] and anti-inflammatory actions. It is often prescribed for ], lower ], ], and ] after surgery or trauma.<ref name="RAD-AR">{{cite web |title=Kusuri-no-Shiori (Drug Information Sheet) |publisher=RAD-AR Council, Japan |date=June 2018 |url=https://www.rad-ar.or.jp/siori/english/kekka.cgi?n=44023 |access-date=2021-10-18}}</ref> It is also being investigated for potential use in the treatment of ].<ref name="pmid22001217">{{cite journal | vauthors = Calvello R, Panaro MA, Carbone ML, Cianciulli A, Perrone MG, Vitale P, Malerba P, Scilimati A | display-authors = 6 | title = Novel selective COX-1 inhibitors suppress neuroinflammatory mediators in LPS-stimulated N13 microglial cells | journal = Pharmacological Research | volume = 65 | issue = 1 | pages = 137–148 | date = January 2012 | pmid = 22001217 | doi = 10.1016/j.phrs.2011.09.009 | hdl = 11586/117804 | hdl-access = free }}</ref><ref name="pmid28649222">{{cite journal | vauthors = Calvello R, Lofrumento DD, Perrone MG, Cianciulli A, Salvatore R, Vitale P, De Nuccio F, Giannotti L, Nicolardi G, Panaro MA, Scilimati A | display-authors = 6 | title = Highly Selective Cyclooxygenase-1 Inhibitors P6 and Mofezolac Counteract Inflammatory State both ''In Vitro'' and ''In Vivo'' Models of Neuroinflammation | journal = Frontiers in Neurology | volume = 8 | issue = | pages = 251 | year = 2017 | pmid = 28649222 | pmc = 5465243 | doi = 10.3389/fneur.2017.00251 | doi-access = free }}</ref> |
|
'''Mofezolac''' (]) is a ]. |
|
|
|
|
|
|
|
Common side effects include ], stomach discomfort, nausea, sleepiness, itch, hives, rash, erythema, and ]. Serious side effects include ]s, ], ], ], ], and ].<ref name="RAD-AR"/> Use is not recommended during ] or breastfeeding.<ref name="pmdsi">{{cite journal |title=Pharmaceuticals and Medical Devices Safety Information |number=381 |date=March 2021 |publisher=Japan Ministry of Health, Labour and Welfare |translator=Pharmaceuticals and Medical Devices Agency}}</ref> |
|
|
|
|
|
Mofezolac acts via selective inhibition of the ] ] and consequent suppression of ] synthesis.<ref name="pmid2109726">{{cite journal | vauthors = Ono N, Yamamoto N, Sunami A, Yamasaki Y, Miyake H | title = | language = Japanese | journal = Nihon Yakurigaku Zasshi. Folia Pharmacologica Japonica | volume = 95 | issue = 2 | pages = 63–81 | date = February 1990 | pmid = 2109726 | doi = 10.1254/fpj.95.2_63 | doi-access = free }}</ref> It is the most potent and selective reversible COX-1 inhibitor.<ref name="pmid30590258">{{cite journal | vauthors = Pati ML, Vitale P, Ferorelli S, Iaselli M, Miciaccia M, Boccarelli A, Di Mauro GD, Fortuna CG, Souza Domingos TF, Rodrigues Pereira da Silva LC, de Pádula M, Cabral LM, Sathler PC, Vacca A, Scilimati A, Perrone MG | display-authors = 6 | title = Translational impact of novel widely pharmacological characterized mofezolac-derived COX-1 inhibitors combined with bortezomib on human multiple myeloma cell lines viability | journal = European Journal of Medicinal Chemistry | volume = 164 | pages = 59–76 | date = February 2019 | pmid = 30590258 | doi = 10.1016/j.ejmech.2018.12.029 | s2cid = 58648199 | hdl = 11586/227733 | hdl-access = free }}</ref> Studies of ] COX-1 in complex with mofezolac indicate that the drug forms a combination of electrostatic, H-bond, hydrophobic, and van der Waals contacts with the enzyme ] channel, contributing to mofezolac's high binding affinity.<ref name="pmid28710965">{{cite journal | vauthors = Cingolani G, Panella A, Perrone MG, Vitale P, Di Mauro G, Fortuna CG, Armen RS, Ferorelli S, Smith WL, Scilimati A | display-authors = 6 | title = Structural basis for selective inhibition of Cyclooxygenase-1 (COX-1) by diarylisoxazoles mofezolac and 3-(5-chlorofuran-2-yl)-5-methyl-4-phenylisoxazole (P6) | journal = European Journal of Medicinal Chemistry | volume = 138 | issue = | pages = 661–668 | date = September 2017 | pmid = 28710965 | pmc = 5992922 | doi = 10.1016/j.ejmech.2017.06.045 }}</ref> |
|
|
|
|
|
Mofezolac belongs to the class of ]s and is a substrate of ].<ref name="kegg">{{cite web |title=DRUG: Mofezolac |website=KEGG |url=https://www.genome.jp/entry/D01718 |access-date=2021-10-18}}</ref> |
|
|
|
|
|
It is manufactured and marketed by ] ES Pharma Co., Ltd.<ref name="RAD-AR"/> |
|
|
|
|
|
== References == |
|
|
{{Reflist|2}} |
|
|
|
|
|
{{Anti-inflammatory and antirheumatic products}} |
|
{{Anti-inflammatory and antirheumatic products}} |
|
|
{{Prostanoidergics}} |
|
{{NSAIDs}} |
|
|
|
|
|
|
] |
|
|
|
|
|
|
|
|