| Revision as of 16:43, 3 August 2011 editYikrazuul (talk | contribs)Rollbackers1,991 edits svg← Previous edit |
Latest revision as of 00:01, 31 July 2024 edit undoOzzie10aaaa (talk | contribs)Autopatrolled, Extended confirmed users, New page reviewers213,605 editsm Cleaned up using AutoEd |
| (26 intermediate revisions by 23 users not shown) |
| Line 1: |
Line 1: |
|
{{Chembox |
|
{{Chembox |
|
|
| Verifiedfields = changed |
|
|
| Watchedfields = changed |
|
|
| verifiedrevid = 442867817 |
|
| ImageFile = Morphiceptin.svg |
|
| ImageFile = Morphiceptin.svg |
|
| ImageSize = |
|
| ImageSize = |
|
| ImageAlt = |
|
| ImageAlt = |
|
| IUPACName = (2S)-1--N--1-oxo-3-phenylpropan-2-yl]pyrrolidine-2-carboxamide <ref name=ChemBase>{{cite web|title=Morphiceptin|url=http://www.chembase.com/cbid_119303.htm|work=Morphiceptin|publisher=ChemBase|accessdate=1 August 2011}}</ref> |
|
| IUPACName = (2S)-1--N--1-oxo-3-phenylpropan-2-yl]pyrrolidine-2-carboxamide<ref name=ChemBase>{{cite web|title=Morphiceptin|url=http://www.chembase.com/cbid_119303.htm|publisher=ChemBase|access-date=1 August 2011|archive-url=https://web.archive.org/web/20120315180103/http://www.chembase.com/cbid_119303.htm|archive-date=15 March 2012|url-status=dead}}</ref> |
|
| OtherNames = Tyr-Pro-Phe-Pro-NH2, PLO17 |
|
| OtherNames = Tyr-Pro-Phe-Pro-NH2, PLO17 |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo = 87777-29-5 |
|
|
| PubChem = 119303 |
|
| CASNo = 74135-04-9 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| SMILES = }} |
|
|
|
| UNII = 97TZA8ANPC |
| ⚫ |
| Section2 = {{Chembox Properties |
|
|
|
| PubChem = 119303 |
| ⚫ |
| Formula = C<sub>28</sub>H<sub>35</sub>N<sub>5</sub>O<sub>5</sub> |
|
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
| ⚫ |
| MolarMass = 521.6 |
|
|
|
| ChemSpiderID = 106565 |
| ⚫ |
| Appearance = |
|
|
|
| SMILES = c1ccc(cc1)C(C(=O)N2CCC2C(=O)N)NC(=O)3CCCN3C(=O)(Cc4ccc(cc4)O)N |
| ⚫ |
| Density = |
|
|
|
| InChI = 1/C28H35N5O5/c29-21(16-19-10-12-20(34)13-11-19)27(37)33-15-5-9-24(33)26(36)31-22(17-18-6-2-1-3-7-18)28(38)32-14-4-8-23(32)25(30)35/h1-3,6-7,10-13,21-24,34H,4-5,8-9,14-17,29H2,(H2,30,35)(H,31,36)/t21-,22-,23-,24-/m0/s1 |
| ⚫ |
| MeltingPt = |
|
|
|
| InChIKey = LSQXZIUREIDSHZ-ZJZGAYNABZ |
| ⚫ |
| BoilingPt = |
|
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
| Solubility = }} |
|
|
|
| StdInChI = 1S/C28H35N5O5/c29-21(16-19-10-12-20(34)13-11-19)27(37)33-15-5-9-24(33)26(36)31-22(17-18-6-2-1-3-7-18)28(38)32-14-4-8-23(32)25(30)35/h1-3,6-7,10-13,21-24,34H,4-5,8-9,14-17,29H2,(H2,30,35)(H,31,36)/t21-,22-,23-,24-/m0/s1 |
| ⚫ |
| Section3 = {{Chembox Hazards |
|
|
|
|
| ⚫ |
| MainHazards = |
|
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
| ⚫ |
| FlashPt = |
|
|
|
| StdInChIKey = LSQXZIUREIDSHZ-ZJZGAYNASA-N }} |
|
| Autoignition = }} |
|
|
⚫ |
|Section2={{Chembox Properties |
|
⚫ |
| Formula = C<sub>28</sub>H<sub>35</sub>N<sub>5</sub>O<sub>5</sub> |
|
⚫ |
| MolarMass = 521.6 g/mol |
|
⚫ |
| Appearance = |
|
⚫ |
| Density = |
|
⚫ |
| MeltingPt = |
|
⚫ |
| BoilingPt = |
|
⚫ |
| Solubility = }} |
|
⚫ |
|Section3={{Chembox Hazards |
|
⚫ |
| MainHazards = |
|
⚫ |
| FlashPt = |
|
|
| AutoignitionPt = }} |
|
}} |
|
}} |
|
|
|
|
|
'''Morphiceptin''' is a tetrapeptide (Tyr-Pro-Phe-Pro-NH<sub>2</sub>) that is a selective ] ]. It is derived from ] and has over 1000 times selectivity for μ receptors over ]. When administered intracerebroventricularly, morphiceptin had an analgesic ED<sub>50</sub> of 1.7 nmol per animal. The analgesic effects of morphiceptin were reversed by ], meaning that the analgesic effect is mediated by the μ opioid receptor.<ref name="Chang 1982">{{cite journal|last=Chang|first=K|title=Analgesic activity of intracerebroventricular administration of morphiceptin and β-casomorphins: Correlation with the morphine (μ) receptor binding affinity|journal=Life Sciences|month=May|volume=1982|issue=18|pages=1547-1551|doi=10.1016/0024-3205(82)90242-9|accessdate=1 August 2011}}</ref> |
|
'''Morphiceptin''' is a ] (Tyr-Pro-Phe-Pro-NH<sub>2</sub>) that is a ] ] ]. It is derived from ] and has over 1,000 times selectivity for μ- over ]. When injected intracerebroventricularly (into the ventricular system of the brain), morphiceptin had an ] ED<sub>50</sub> of 1.7 nmol per animal. The analgesic effects of morphiceptin were reversed by ], meaning that the analgesic effect is mediated by the μ-opioid receptor.<ref name="Chang 1982">{{cite journal|last=Chang|first=K|title=Analgesic activity of intracerebroventricular administration of morphiceptin and β-casomorphins: Correlation with the morphine (μ) receptor binding affinity|journal=Life Sciences|date=3 May 1982|volume=30|issue=18|pages=1547–1551|doi=10.1016/0024-3205(82)90242-9|pmid=6281604}}</ref> |
|
|
|
|
|
|
Morphiceptin is the (1S,2S,3S,4S)-form whereas ] is the (1S,2S,3S,4R)-form . |
| ⚫ |
== References == |
|
|
|
|
|
|
|
== See also == |
|
|
* ] |
|
|
|
|
⚫ |
== References == |
|
{{Reflist}} |
|
{{Reflist}} |
|
|
|
|
|
{{Opioids}} |
|
{{Opioidergics}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
|
] |