| Revision as of 09:18, 13 October 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per [[WP:CHEMVALID|Chem/Drugbox validat...← Previous edit |
Latest revision as of 00:37, 17 June 2022 edit undoInnerstream (talk | contribs)Autopatrolled, Extended confirmed users4,071 editsmNo edit summary |
| (12 intermediate revisions by 11 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
| verifiedrevid = 449584968 |
|
| verifiedrevid = 455343846 |
|
|ImageFile=Motexafin lutetium.png |
|
| ImageFile=Motexafin lutetium.svg |
|
|ImageSize=200px |
|
| ImageSize=200px |
|
|IUPACName= |
|
| IUPACName= |
|
|OtherNames=Antrin; Lu texaphyrin; Lu-Tex; Lutetium texaphyrin; Lutrin; Optrin; PCI 0123 |
|
| OtherNames=Antrin; Lu texaphyrin; Lu-Tex; Lutetium texaphyrin; Lutrin; Optrin; PCI 0123 |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo=246252-04-0 |
|
| CASNo=246252-04-0 |
| ⚫ |
| PubChem=3081907 |
|
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| SMILES=CC()=O.CCC1=C2C(/C=C3N=C(/C=N/C4=CC(OCCOCCOCCOC)=C(OCCOCCOCCOC)C=C4/N=C/C(C(C)=C/5CCCO)=()C5=C/2)C(C)=C\3CCCO)=C1CC |
|
|
|
| UNII = 0V38NF6N89 |
|
⚫ |
| PubChem=3081907 |
|
⚫ |
| SMILES=CC()=O.CCC1=C2C(/C=C3N=C(/C=N/C4=CC(OCCOCCOCCOC)=C(OCCOCCOCCOC)C=C4/N=C/C(C(C)=C/5CCCO)=()C5=C/2)C(C)=C\3CCCO)=C1CC |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| C=52 | H=72 | Lu=1 | N=5 | O=14 |
|
| C=52 | H=72 | Lu=1 | N=5 | O=14 |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
| Line 29: |
Line 32: |
|
It is a photosensitiser for use in ] to treat skin conditions and superficial cancers. |
|
It is a photosensitiser for use in ] to treat skin conditions and superficial cancers. |
|
|
|
|
|
It has also been tested for use in ] (photodynamic treatment of diseased arteries).<ref>, 2002</ref> |
|
It has also been tested for use in ] (photodynamic treatment of diseased arteries).<ref> {{webarchive|url=https://web.archive.org/web/20110716075826/http://www2.prnewswire.com/cgi-bin/stories.pl?ACCT=104&STORY=%2Fwww%2Fstory%2F09-25-2002%2F0001806282&EDATE= |date=2011-07-16 }}, 2002</ref> |
|
|
|
|
|
It is photoactivated by 732 nm light which allows greater depth of penetration.<ref>http://findarticles.com/p/articles/mi_qa3931/is_200909/ai_n42040200/pg_9/ Porphyrin and Nonporphyrin Photosensitizers in Oncology: Preclinical and Clinical Advances in Photodynamic Therapy Photochemistry and Photobiology, Sep/Oct 2009. by O'Connor, Aisling E, Gallagher, William M, Byrne, Annette T </ref> |
|
It is photoactivated by 732 nm light which allows greater depth of penetration.<ref>http://findarticles.com/p/articles/mi_qa3931/is_200909/ai_n42040200/pg_9/ Porphyrin and Nonporphyrin Photosensitizers in Oncology: Preclinical and Clinical Advances in Photodynamic Therapy Photochemistry and Photobiology, Sep/Oct 2009. by O'Connor, Aisling E, Gallagher, William M, Byrne, Annette T</ref> |
|
|
|
|
|
==Clinical trials== |
|
==Clinical trials== |
|
Phase II clinical trials were in progress in 1999.<ref>, 1999</ref> |
|
Phase II clinical trials were in progress in 1999.<ref> {{Webarchive|url=https://archive.today/20120713142335/http://ir.pharmacyclics.com/releasedetail.cfm?ReleaseID=141812 |date=2012-07-13 }}, 1999</ref> |
|
|
|
|
|
A phase I trial for ] reported in 2009.<ref>{{cite journal | pmid = 18676760 | year = 2008 | last1 = Patel | first1 = H | last2 = Mick | first2 = R | last3 = Finlay | first3 = J | last4 = Zhu | first4 = TC | last5 = Rickter | first5 = E | last6 = Cengel | first6 = KA | last7 = Malkowicz | first7 = SB | last8 = Hahn | first8 = SM | last9 = Busch | first9 = TM | title = Motexafin lutetium-photodynamic therapy of prostate cancer: Short and long term effects on PSA | volume = 14 | issue = 15 | pages = 4869–76 | doi = 10.1158/1078-0432.CCR-08-0317 | pmc = 2680073 | journal = Clinical cancer research : an official journal of the American Association for Cancer Research }}</ref> |
|
A phase I trial for ] reported in 2009.<ref>{{cite journal | pmid = 18676760 | year = 2008 | last1 = Patel | first1 = H | last2 = Mick | first2 = R | last3 = Finlay | first3 = J | last4 = Zhu | first4 = TC | last5 = Rickter | first5 = E | last6 = Cengel | first6 = KA | last7 = Malkowicz | first7 = SB | last8 = Hahn | first8 = SM | last9 = Busch | first9 = TM | title = Motexafin lutetium-photodynamic therapy of prostate cancer: Short and long term effects on PSA | volume = 14 | issue = 15 | pages = 4869–76 | doi = 10.1158/1078-0432.CCR-08-0317 | pmc = 2680073 | journal = Clinical Cancer Research }}</ref> |
|
|
|
|
|
==References== |
|
==References== |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
|
⚫ |
{{Lutetium compounds}} |
|
|
|
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
|
|
| ⚫ |
{{Lutetium compounds}} |
|
|
|
|
|
|
|
|
|