Revision as of 08:44, 1 September 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (changes to watched fields - added verified revid - updated 'ChemSpiderID_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per Chem/Drugbox validation (report [[Misplaced Pages talk:Wiki← Previous edit |
Latest revision as of 22:44, 2 April 2023 edit undoEntranced98 (talk | contribs)Extended confirmed users, Pending changes reviewers, Rollbackers172,984 edits Importing Wikidata short description: "Chemical compound"Tag: Shortdesc helper |
(21 intermediate revisions by 15 users not shown) |
Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{Drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
|
| Watchedfields = changed |
|
| Watchedfields = changed |
|
| verifiedrevid = 444569284 |
|
| verifiedrevid = 447824180 |
|
| IUPAC_name = 1-benzyl-3-ethyl-6,7-dimethoxyisoquinoline |
|
| IUPAC_name = 1-Benzyl-3-ethyl-6,7-dimethoxyisoquinoline |
|
| image = Moxaverine.png |
|
| image = Moxaverine structure.svg |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
|
| Drugs.com = {{drugs.com|international|moxaverine}} |
|
| Drugs.com = {{drugs.com|international|moxaverine}} |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| pregnancy_category = |
|
| pregnancy_category = |
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_status = |
|
| legal_status = |
|
| routes_of_administration = |
|
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = |
|
| bioavailability = |
|
| protein_bound = |
|
| protein_bound = |
|
| metabolism = |
|
| metabolism = |
|
| elimination_half-life = |
|
| elimination_half-life = |
|
| excretion = |
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = 10539-19-2 |
|
| CAS_number = 10539-19-2 |
|
| ATC_prefix = A03 |
|
| ATC_prefix = A03 |
Line 31: |
Line 34: |
|
| PubChem = 70882 |
|
| PubChem = 70882 |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = |
|
| DrugBank = |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = P3P08Y1XJ4 |
|
| UNII = P3P08Y1XJ4 |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D07089 |
|
| KEGG = D07089 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 64045 |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=20 | H=21 | N=1 | O=2 |
|
| C=20 | H=21 | N=1 | O=2 |
|
|
| smiles = CCC1=NC(=C2C=C(C(=CC2=C1)OC)OC)CC3=CC=CC=C3 |
|
| molecular_weight = 307.386 g/mol |
|
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C20H21NO2/c1-4-16-11-15-12-19(22-2)20(23-3)13-17(15)18(21-16)10-14-8-6-5-7-9-14/h5-9,11-13H,4,10H2,1-3H3 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = MYCMTMIGRXJNSO-UHFFFAOYSA-N |
|
}} |
|
}} |
|
'''Moxaverine''' is a drug used to treat ] ] disorders. |
|
|
|
|
|
|
It is a ].<ref name="pmid2854468">{{cite journal |author=Mannhold R |title=Inhibition of calmodulin dependent c-AMP-phosphodiesterase by moxaverine and papaverine |journal=Arzneimittelforschung |volume=38 |issue=12 |pages=1806–8 |year=1988 |month=December |pmid=2854468 |doi= |url=}}</ref> |
|
'''Moxaverine''' has been used in therapy based on the direct vasodilatory effect of the drug, a ],<ref name="pmid2854468">{{cite journal | vauthors = Mannhold R | title = Inhibition of calmodulin dependent c-AMP-phosphodiesterase by moxaverine and papaverine | journal = Arzneimittel-Forschung | volume = 38 | issue = 12 | pages = 1806–8 | date = December 1988 | pmid = 2854468 }}</ref> and on its influence on the ] properties of red blood cells.<ref>{{cite journal | vauthors = Schmid-Schönbein H, Schröder S, Grebe R, Artmann G, Eschweiler H, Teitel P | title = Influence of moxaverine hydrochloride on membrane curvature and microsieve filterability of red cells after exposure to hyperosmolarity and lactacidosis | journal = Arzneimittel-Forschung | volume = 38 | issue = 5 | pages = 710–6 | date = May 1988 | pmid = 3415714 }}</ref> |
|
|
|
|
|
Moxaverine hydrochloride (Kollateral forte®, Ursapharm. Saarbrücken, Germany) has been shown to increase ocular blood flow in patients with age-related ], primary open angle ], and to increase choroidal and retrobulbar blood flow in elderly patients with eye diseases associated with hypo-perfusion.<ref>{{cite journal | vauthors = Pemp B, Garhofer G, Lasta M, Schmidl D, Wolzt M, Schmetterer L | title = The effects of moxaverine on ocular blood flow in patients with age-related macular degeneration or primary open angle glaucoma and in healthy control subjects | journal = Acta Ophthalmologica | volume = 90 | issue = 2 | pages = 139–45 | date = March 2012 | pmid = 20456253 | doi = 10.1111/j.1755-3768.2010.01878.x | s2cid = 3269602 | doi-access = free }}</ref> The ocular efficacy of moxaverine has been explored in the clinic.<ref>{{ClinicalTrialsGov|NCT01629680|A Randomized, Placebo-controlled Study Investigating the Effects of Moxaverine on Ocular Blood Flow After Oral Administration in Healthy Subjects}}</ref> |
|
|
|
|
|
== References == |
|
== References == |
Line 49: |
Line 59: |
|
|
|
|
|
{{Drugs for functional gastrointestinal disorders}} |
|
{{Drugs for functional gastrointestinal disorders}} |
|
|
{{Phosphodiesterase inhibitors}} |
|
|
|
|
|
] |
|
] |
|
⚫ |
] |
|
] |
|
] |
⚫ |
] |
|
|
] |
|
] |
|
|
|
|
|
|
|
|
{{gastrointestinal-drug-stub}} |
|
{{gastrointestinal-drug-stub}} |
|
|
|
|
] |
|
|
] |
|