| Revision as of 10:37, 12 October 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per Chem/Drugbox validation (repor...← Previous edit |
Latest revision as of 00:15, 5 November 2022 edit undoEntranced98 (talk | contribs)Extended confirmed users, Pending changes reviewers, Rollbackers173,243 edits +sd |
| (20 intermediate revisions by 16 users not shown) |
| Line 1: |
Line 1: |
|
|
{{short description|Chemical compound}} |
|
{{Drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
|
| verifiedrevid = 455184213 |
|
| verifiedrevid = 462255885 |
|
| IUPAC_name = ''N''--2-methylbenzamide |
|
| IUPAC_name = ''N''--2-methylbenzamide |
|
| image = Mozavaptan structure.svg |
|
| image = Mozavaptan structure.svg |
| Line 24: |
Line 26: |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| IUPHAR_ligand = 2197 |
|
|
| CAS_number_Ref = {{cascite|correct|CAS}} |
|
| CAS_number = 137975-06-5 |
|
| CAS_number = 137975-06-5 |
|
| ATC_prefix = none |
|
| ATC_prefix = none |
| Line 32: |
Line 36: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = WRNXUQJJCIZICJ-UHFFFAOYSA-N |
|
| StdInChIKey = WRNXUQJJCIZICJ-UHFFFAOYSA-N |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEMBL = 420762 |
|
| PubChem = 119369 |
|
| PubChem = 119369 |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
| Line 43: |
Line 49: |
|
| chemical_formula = |
|
| chemical_formula = |
|
| C=27 | H=29 | N=3 | O=2 |
|
| C=27 | H=29 | N=3 | O=2 |
|
|
| smiles = Cc1ccccc1C(=O)Nc2ccc(cc2)C(=O)N3c4ccccc4C(CCC3)N(C)C |
|
| molecular_weight = 427.53 g/mol |
|
|
| smiles = CC1=CC=CC=C1C(=O)NC2=CC=C(C=C2)C(=O)N3CCCC(C4=CC=CC=C43)N(C)C |
|
|
| InChI = 1S/C27H29N3O2/c1-19-9-4-5-10-22(19)26(31)28-21-16-14-20(15-17-21)27(32)30-18-8-13-24(29(2)3)23-11-6-7-12-25(23)30/h4-7,9-12,14-17,24H,8,13,18H2,1-3H3,(H,28,31) |
|
|
}} |
|
}} |
|
|
|
|
|
'''Mozavaptan''' (]) is a ] marketed by ]. In Japan, it was approved in October ] for ] (low blood ] levels) caused by ] (SIADH) due to ADH producing tumors. |
|
'''Mozavaptan''' (]) is a ] marketed by ]. In Japan, it was approved in October 2006 for ] (low blood ] levels) caused by ] (SIADH) due to ADH producing tumors. |
|
|
|
|
|
==References== |
|
==References== |
|
|
* {{cite journal | vauthors = Spreitzer H | date = November 20, 2006 | title = Neue Wirkstoffe - Conivaptan | journal = Österreichische Apothekerzeitung | issue = 24/2006 | language = German }} |
|
* {{cite journal |
|
|
|
* {{cite web | title = Conivaptan hydrochloride | url = http://www.prous.com/molecules/default.asp?ID=153 | publisher = Prous Science | work = Molecule of the Month | date = November 2006 |archive-url = https://web.archive.org/web/20120213003638/http://www.prous.com/molecules/default.asp?ID=153|archive-date = 2012-02-13}} |
|
| author = H. Spreitzer |
|
|
|
|
|
| date = November 20, 2006 |
|
|
| title = Neue Wirkstoffe - Conivaptan |
|
|
| journal = Österreichische Apothekerzeitung |
|
|
| issue = 24/2006 |
|
|
| language = German |
|
|
}} |
|
|
* |
|
|
|
|
|
|
{{Diuretics}} |
|
{{Diuretics}} |
|
|
{{Oxytocin and vasopressin receptor modulators}} |
|
{{Neuropeptide agonists and antagonists}} |
|
|
|
|
|
|
] |
|
] |
| ⚫ |
] |
|
|
] |
|
] |
|
] |
|
|
] |
|
] |
|
|
] |
|
⚫ |
] |
|
|
|
|
|
|
|
|
|
{{antihypertensive-stub}} |
|
{{antihypertensive-stub}} |
|
|
|
|
] |
|